From ba3c29b92ec29c8c321f7e6160a4a25f65f18088 Mon Sep 17 00:00:00 2001 From: Jake Potrebic Date: Sun, 29 Sep 2024 16:48:34 -0700 Subject: [PATCH] Finish converting all events to jspecify annotations --- patches/api/0002-Build-system-changes.patch | 7 +- patches/api/0003-Test-changes.patch | 4 +- patches/api/0004-Code-Generation.patch | 4 +- patches/api/0006-Adventure.patch | 91 +++--- patches/api/0007-Paper-Utils.patch | 17 +- .../0008-Use-ASM-for-event-executors.patch | 150 +++++----- patches/api/0009-Paper-Plugins.patch | 4 +- ...0015-Expose-server-build-information.patch | 16 +- .../0021-Add-exception-reporting-event.patch | 16 +- ...Entity-AddTo-RemoveFrom-World-Events.patch | 10 +- patches/api/0032-EntityPathfindEvent.patch | 5 +- ...0035-Add-PlayerUseUnknownEntityEvent.patch | 17 +- patches/api/0039-LootTable-API.patch | 80 ++--- .../0049-PlayerTeleportEndGatewayEvent.patch | 10 +- .../api/0057-Basic-PlayerProfile-API.patch | 4 +- .../0066-ProfileWhitelistVerifyEvent.patch | 35 +-- ...low-plugins-to-use-SLF4J-for-logging.patch | 4 +- patches/api/0069-Add-PlayerJumpEvent.patch | 23 +- ...or-plugins-modifying-the-parent-of-t.patch | 26 +- .../api/0071-Add-PlayerArmorChangeEvent.patch | 35 +-- patches/api/0073-AsyncTabCompleteEvent.patch | 7 +- ...nt-protocol-version-and-virtual-host.patch | 14 +- .../0076-PlayerPickupExperienceEvent.patch | 16 +- ...PlayerAdvancementCriterionGrantEvent.patch | 22 +- .../0083-Fill-Profile-Property-Events.patch | 43 ++- ...-support-to-PaperServerListPingEvent.patch | 4 +- ...ld.spawnParticle-API-and-add-Builder.patch | 283 ++++++++---------- .../api/0099-EndermanAttackPlayerEvent.patch | 5 +- .../api/0100-WitchConsumePotionEvent.patch | 5 +- patches/api/0110-PlayerReadyArrowEvent.patch | 22 +- patches/api/0115-RangedEntity-API.patch | 11 +- patches/api/0120-EnderDragon-Events.patch | 5 +- patches/api/0121-PlayerElytraBoostEvent.patch | 23 +- .../0122-PlayerLaunchProjectileEvent.patch | 21 +- patches/api/0127-AnvilDamageEvent.patch | 5 +- .../api/0133-Slime-Pathfinder-Events.patch | 6 +- patches/api/0135-Add-More-Creeper-API.patch | 6 +- patches/api/0143-Mob-Pathfinding-API.patch | 73 ++--- patches/api/0151-Turtle-API.patch | 18 +- .../0152-Add-spectator-target-events.patch | 35 +-- .../api/0164-Add-PlayerPostRespawnEvent.patch | 14 +- patches/api/0167-Server-Tick-Events.patch | 10 +- patches/api/0178-Entity-Jump-API.patch | 6 +- .../0183-Add-Player-Client-Options-API.patch | 39 +-- ...PlayerAttackEntityCooldownResetEvent.patch | 16 +- patches/api/0187-Add-Mob-Goal-API.patch | 100 +++---- .../0188-Add-villager-reputation-API.patch | 15 +- ...implement-PlayerRecipeBookClickEvent.patch | 20 +- ...reResultEvent-PrepareGrindstoneEvent.patch | 6 +- .../0216-Add-PlayerItemCooldownEvent.patch | 17 +- ...0219-Player-Chunk-Load-Unload-Events.patch | 24 +- patches/api/0222-Added-PlayerTradeEvent.patch | 33 +- ...6-Add-PlayerFlowerPotManipulateEvent.patch | 17 +- .../0229-Added-WorldGameRuleChangeEvent.patch | 24 +- .../0231-Add-BlockFailedDispenseEvent.patch | 5 +- ...2-Added-PlayerLecternPageChangeEvent.patch | 18 +- ...3-Added-PlayerLoomPatternSelectEvent.patch | 17 +- .../api/0237-Add-StructuresLocateEvent.patch | 35 +-- .../api/0238-Add-BlockPreDispenseEvent.patch | 5 +- ...-Added-PlayerChangeBeaconEffectEvent.patch | 31 +- ...d-PlayerStonecutterRecipeSelectEvent.patch | 17 +- patches/api/0249-Add-worldborder-events.patch | 54 ++-- .../0250-added-PlayerNameEntityEvent.patch | 27 +- .../api/0259-Added-PlayerDeepSleepEvent.patch | 13 +- .../0261-Added-PlayerBedFailEnterEvent.patch | 26 +- ...283-Add-ElderGuardianAppearanceEvent.patch | 5 +- .../api/0288-Adds-PlayerArmSwingEvent.patch | 8 +- ...Add-PlayerSignCommandPreprocessEvent.patch | 14 +- .../api/0293-Add-PlayerSetSpawnEvent.patch | 35 +-- .../0313-Add-PlayerItemFrameChangeEvent.patch | 21 +- .../0347-Add-PlayerStopUsingItemEvent.patch | 14 +- ...3-Add-PlayerInventorySlotChangeEvent.patch | 15 +- .../0370-Add-PrePlayerAttackEntityEvent.patch | 15 +- ...0373-Add-paper-dumplisteners-command.patch | 34 +-- .../0377-Player-Entity-Tracking-Events.patch | 26 +- ...96-Add-event-for-player-editing-sign.patch | 17 +- .../api/0401-Add-PlayerFailMoveEvent.patch | 19 +- .../api/0412-Add-PlayerPickItemEvent.patch | 23 +- .../0435-Add-PlayerShieldDisableEvent.patch | 14 +- .../api/0455-Add-CartographyItemEvent.patch | 19 +- .../0466-Brigadier-based-command-API.patch | 24 +- .../server/0353-Implement-Mob-Goal-API.patch | 6 +- 82 files changed, 977 insertions(+), 1103 deletions(-) diff --git a/patches/api/0002-Build-system-changes.patch b/patches/api/0002-Build-system-changes.patch index 768ba2bc9..60f39fcfc 100644 --- a/patches/api/0002-Build-system-changes.patch +++ b/patches/api/0002-Build-system-changes.patch @@ -5,7 +5,7 @@ Subject: [PATCH] Build system changes diff --git a/build.gradle.kts b/build.gradle.kts -index 6271e2bad0ed937c2c46a8c8fdf186c46b0b620e..2e99ea99cfc96b3602ba26b20a402e7d30f0f05f 100644 +index 6271e2bad0ed937c2c46a8c8fdf186c46b0b620e..78aadebda145fe83327ceb430c4b38f9a8e45a2b 100644 --- a/build.gradle.kts +++ b/build.gradle.kts @@ -18,15 +18,27 @@ dependencies { @@ -37,7 +37,7 @@ index 6271e2bad0ed937c2c46a8c8fdf186c46b0b620e..2e99ea99cfc96b3602ba26b20a402e7d testImplementation("org.apache.commons:commons-lang3:3.12.0") testImplementation("org.junit.jupiter:junit-jupiter:5.10.2") testImplementation("org.hamcrest:hamcrest:2.2") -@@ -69,8 +81,12 @@ tasks.withType { +@@ -69,8 +81,13 @@ tasks.withType { options.links( "https://guava.dev/releases/32.1.2-jre/api/docs/", "https://javadoc.io/doc/org.yaml/snakeyaml/2.2/", @@ -47,11 +47,12 @@ index 6271e2bad0ed937c2c46a8c8fdf186c46b0b620e..2e99ea99cfc96b3602ba26b20a402e7d + // Paper start - add missing javadoc links + "https://javadoc.io/doc/org.joml/joml/1.10.5/index.html", + "https://www.javadoc.io/doc/com.google.code.gson/gson/2.10.1", ++ "https://jspecify.dev/docs/api/", + // Paper end ) options.tags("apiNote:a:API Note:") -@@ -89,3 +105,14 @@ tasks.withType { +@@ -89,3 +106,14 @@ tasks.withType { tasks.test { useJUnitPlatform() } diff --git a/patches/api/0003-Test-changes.patch b/patches/api/0003-Test-changes.patch index 1d9364efc..f712825f8 100644 --- a/patches/api/0003-Test-changes.patch +++ b/patches/api/0003-Test-changes.patch @@ -12,10 +12,10 @@ Co-authored-by: Riley Park Co-authored-by: Jake Potrebic diff --git a/build.gradle.kts b/build.gradle.kts -index 2e99ea99cfc96b3602ba26b20a402e7d30f0f05f..d91ce069b5fce4afb245691bd90f448d6dfdc492 100644 +index 78aadebda145fe83327ceb430c4b38f9a8e45a2b..8c7a5be5193ae397ec324d78566edce90608ed57 100644 --- a/build.gradle.kts +++ b/build.gradle.kts -@@ -106,6 +106,12 @@ tasks.test { +@@ -107,6 +107,12 @@ tasks.test { useJUnitPlatform() } diff --git a/patches/api/0004-Code-Generation.patch b/patches/api/0004-Code-Generation.patch index 6bad58426..c19456fe1 100644 --- a/patches/api/0004-Code-Generation.patch +++ b/patches/api/0004-Code-Generation.patch @@ -7,7 +7,7 @@ Currently includes generated key holder classes for types used in the Registry Modification API diff --git a/build.gradle.kts b/build.gradle.kts -index d91ce069b5fce4afb245691bd90f448d6dfdc492..f715ae19c1e71d854a722130d3db447887fa2d2b 100644 +index 8c7a5be5193ae397ec324d78566edce90608ed57..877ea06c0ea8c8c0c73d23fbb996f6692c100d98 100644 --- a/build.gradle.kts +++ b/build.gradle.kts @@ -1,6 +1,7 @@ @@ -41,7 +41,7 @@ index d91ce069b5fce4afb245691bd90f448d6dfdc492..f715ae19c1e71d854a722130d3db4478 configure { publications.create("maven") { from(components["java"]) -@@ -122,3 +139,14 @@ tasks.check { +@@ -123,3 +140,14 @@ tasks.check { dependsOn(scanJar) } // Paper end diff --git a/patches/api/0006-Adventure.patch b/patches/api/0006-Adventure.patch index efad521b0..a26f91f26 100644 --- a/patches/api/0006-Adventure.patch +++ b/patches/api/0006-Adventure.patch @@ -8,7 +8,7 @@ Co-authored-by: Jake Potrebic Co-authored-by: Yannick Lamprecht diff --git a/build.gradle.kts b/build.gradle.kts -index 7470f18dc36c5e4357ce3bb936c4842066df9114..7624069435a9be6c4249a444db0bf1bf54691caa 100644 +index 3383fb91249ea53740326b538abd905f84ff0e3c..74f0e2b812c1e2e922b136fefe505fc8cbe33e83 100644 --- a/build.gradle.kts +++ b/build.gradle.kts @@ -11,12 +11,28 @@ java { @@ -55,7 +55,7 @@ index 7470f18dc36c5e4357ce3bb936c4842066df9114..7624069435a9be6c4249a444db0bf1bf // Paper end compileOnly("org.apache.maven:maven-resolver-provider:3.9.6") -@@ -100,14 +123,31 @@ tasks.withType { +@@ -100,15 +123,32 @@ tasks.withType { "https://guava.dev/releases/32.1.2-jre/api/docs/", "https://javadoc.io/doc/org.yaml/snakeyaml/2.2/", "https://javadoc.io/doc/org.jetbrains/annotations/$annotationsVersion/", // Paper - we don't want Java 5 annotations @@ -64,6 +64,7 @@ index 7470f18dc36c5e4357ce3bb936c4842066df9114..7624069435a9be6c4249a444db0bf1bf // Paper start - add missing javadoc links "https://javadoc.io/doc/org.joml/joml/1.10.5/index.html", "https://www.javadoc.io/doc/com.google.code.gson/gson/2.10.1", + "https://jspecify.dev/docs/api/", // Paper end + // Paper start + "https://jd.advntr.dev/api/$adventureVersion/", @@ -208,13 +209,14 @@ index 0000000000000000000000000000000000000000..2ad76b1751ba707f7ae0d283aa1cbaf6 +} diff --git a/src/main/java/io/papermc/paper/event/player/AbstractChatEvent.java b/src/main/java/io/papermc/paper/event/player/AbstractChatEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803a7017a28 +index 0000000000000000000000000000000000000000..9a95d203151d2c91b0eec494e3674f0facfaa305 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/AbstractChatEvent.java -@@ -0,0 +1,127 @@ +@@ -0,0 +1,122 @@ +package io.papermc.paper.event.player; + +import io.papermc.paper.chat.ChatRenderer; ++import java.util.Set; +import net.kyori.adventure.audience.Audience; +import net.kyori.adventure.chat.SignedMessage; +import net.kyori.adventure.text.Component; @@ -222,9 +224,7 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 +import org.bukkit.event.Cancellable; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+ -+import java.util.Set; ++import org.jspecify.annotations.NullMarked; + +import static java.util.Objects.requireNonNull; + @@ -232,6 +232,7 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * An abstract implementation of a chat event, handling shared logic. + */ +@ApiStatus.NonExtendable ++@NullMarked +public abstract class AbstractChatEvent extends PlayerEvent implements Cancellable { + + private final Set viewers; @@ -242,7 +243,7 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + + private boolean cancelled; + -+ AbstractChatEvent(final boolean async, final @NotNull Player player, final @NotNull Set viewers, final @NotNull ChatRenderer renderer, final @NotNull Component message, final @NotNull Component originalMessage, final @NotNull SignedMessage signedMessage) { ++ AbstractChatEvent(final boolean async, final Player player, final Set viewers, final ChatRenderer renderer, final Component message, final Component originalMessage, final SignedMessage signedMessage) { + super(player, async); + this.viewers = viewers; + this.renderer = renderer; @@ -259,7 +260,6 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * + * @return a mutable set of {@link Audience audiences} who will receive the chat message + */ -+ @NotNull + public final Set viewers() { + return this.viewers; + } @@ -270,7 +270,7 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * @param renderer the chat renderer + * @throws NullPointerException if {@code renderer} is {@code null} + */ -+ public final void renderer(final @NotNull ChatRenderer renderer) { ++ public final void renderer(final ChatRenderer renderer) { + this.renderer = requireNonNull(renderer, "renderer"); + } + @@ -279,7 +279,6 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * + * @return the chat renderer + */ -+ @NotNull + public final ChatRenderer renderer() { + return this.renderer; + } @@ -290,7 +289,6 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * + * @return the user-supplied message + */ -+ @NotNull + public final Component message() { + return this.message; + } @@ -301,7 +299,7 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * @param message the user-supplied message + * @throws NullPointerException if {@code message} is {@code null} + */ -+ public final void message(final @NotNull Component message) { ++ public final void message(final Component message) { + this.message = requireNonNull(message, "message"); + } + @@ -312,7 +310,6 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * + * @return the original user-supplied message + */ -+ @NotNull + public final Component originalMessage() { + return this.originalMessage; + } @@ -324,7 +321,6 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 + * + * @return the signed message + */ -+ @NotNull + public final SignedMessage signedMessage() { + return this.signedMessage; + } @@ -341,41 +337,42 @@ index 0000000000000000000000000000000000000000..a0fd845bc9b2540c398fe1dbbf821803 +} diff --git a/src/main/java/io/papermc/paper/event/player/AsyncChatCommandDecorateEvent.java b/src/main/java/io/papermc/paper/event/player/AsyncChatCommandDecorateEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..01cf89d3558132912c4d0eb48c98cd8c06e46a67 +index 0000000000000000000000000000000000000000..ddd4c90f83b5cb8f069ff53760abb3c4adfd1168 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/AsyncChatCommandDecorateEvent.java -@@ -0,0 +1,28 @@ +@@ -0,0 +1,29 @@ +package io.papermc.paper.event.player; + +import net.kyori.adventure.text.Component; +import org.bukkit.entity.Player; +import org.bukkit.event.HandlerList; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +@ApiStatus.Experimental ++@NullMarked +public class AsyncChatCommandDecorateEvent extends AsyncChatDecorateEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + @ApiStatus.Internal -+ public AsyncChatCommandDecorateEvent(@Nullable Player player, @NotNull Component originalMessage) { ++ public AsyncChatCommandDecorateEvent(final @Nullable Player player, final Component originalMessage) { + super(player, originalMessage); + } + + @Override -+ public @NotNull HandlerList getHandlers() { ++ public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ public static @NotNull HandlerList getHandlerList() { ++ public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/src/main/java/io/papermc/paper/event/player/AsyncChatDecorateEvent.java b/src/main/java/io/papermc/paper/event/player/AsyncChatDecorateEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..2e492f4cd179135bd40ad951ab23acb562be2f06 +index 0000000000000000000000000000000000000000..9e5ea0cd006bd9744b84923620841f07fa40c2cb --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/AsyncChatDecorateEvent.java @@ -0,0 +1,105 @@ @@ -387,9 +384,8 @@ index 0000000000000000000000000000000000000000..2e492f4cd179135bd40ad951ab23acb5 +import org.bukkit.event.HandlerList; +import org.bukkit.event.server.ServerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.Contract; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * This event is fired when the server decorates a component for chat purposes. This is called @@ -401,18 +397,19 @@ index 0000000000000000000000000000000000000000..2e492f4cd179135bd40ad951ab23acb5 + * See {@link AsyncChatCommandDecorateEvent} for the decoration of messages sent via commands + */ +@ApiStatus.Experimental ++@NullMarked +public class AsyncChatDecorateEvent extends ServerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ private final Player player; ++ private final @Nullable Player player; + private final Component originalMessage; + private Component result; + + private boolean cancelled; + + @ApiStatus.Internal -+ public AsyncChatDecorateEvent(final @Nullable Player player, final @NotNull Component originalMessage) { ++ public AsyncChatDecorateEvent(final @Nullable Player player, final Component originalMessage) { + super(true); + this.player = player; + this.originalMessage = originalMessage; @@ -436,7 +433,7 @@ index 0000000000000000000000000000000000000000..2e492f4cd179135bd40ad951ab23acb5 + * + * @return the input + */ -+ public @NotNull Component originalMessage() { ++ public Component originalMessage() { + return this.originalMessage; + } + @@ -447,7 +444,7 @@ index 0000000000000000000000000000000000000000..2e492f4cd179135bd40ad951ab23acb5 + * + * @return the result + */ -+ public @NotNull Component result() { ++ public Component result() { + return this.result; + } + @@ -456,7 +453,7 @@ index 0000000000000000000000000000000000000000..2e492f4cd179135bd40ad951ab23acb5 + * + * @param result the result + */ -+ public void result(@NotNull Component result) { ++ public void result(final Component result) { + this.result = result; + } + @@ -471,36 +468,36 @@ index 0000000000000000000000000000000000000000..2e492f4cd179135bd40ad951ab23acb5 + * component. + */ + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + + @Override -+ public @NotNull HandlerList getHandlers() { ++ public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ public static @NotNull HandlerList getHandlerList() { ++ public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/src/main/java/io/papermc/paper/event/player/AsyncChatEvent.java b/src/main/java/io/papermc/paper/event/player/AsyncChatEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..4adae8b8a8640ffbd6a86b0908ca21fded737b88 +index 0000000000000000000000000000000000000000..50c3e117dec63811823b4e6395bf4f090692ee8c --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/AsyncChatEvent.java -@@ -0,0 +1,45 @@ +@@ -0,0 +1,44 @@ +package io.papermc.paper.event.player; + -+import java.util.Set; +import io.papermc.paper.chat.ChatRenderer; ++import java.util.Set; +import net.kyori.adventure.audience.Audience; +import net.kyori.adventure.chat.SignedMessage; +import net.kyori.adventure.text.Component; +import org.bukkit.entity.Player; +import org.bukkit.event.HandlerList; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * An event fired when a {@link Player} sends a chat message to the server. @@ -515,36 +512,35 @@ index 0000000000000000000000000000000000000000..4adae8b8a8640ffbd6a86b0908ca21fd + * Care should be taken to check {@link #isAsynchronous()} and treat the event + * appropriately. + */ ++@NullMarked +public final class AsyncChatEvent extends AbstractChatEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + @ApiStatus.Internal -+ public AsyncChatEvent(final boolean async, final @NotNull Player player, final @NotNull Set viewers, final @NotNull ChatRenderer renderer, final @NotNull Component message, final @NotNull Component originalMessage, final @NotNull SignedMessage signedMessage) { ++ public AsyncChatEvent(final boolean async, final Player player, final Set viewers, final ChatRenderer renderer, final Component message, final Component originalMessage, final SignedMessage signedMessage) { + super(async, player, viewers, renderer, message, originalMessage, signedMessage); + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/src/main/java/io/papermc/paper/event/player/ChatEvent.java b/src/main/java/io/papermc/paper/event/player/ChatEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..7411f58f9f36beaadcc47c2264a4af313956ee03 +index 0000000000000000000000000000000000000000..42a82ce2316a4aad2883d24c7e2ff95d95f5881a --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/ChatEvent.java -@@ -0,0 +1,41 @@ +@@ -0,0 +1,40 @@ +package io.papermc.paper.event.player; + -+import java.util.Set; +import io.papermc.paper.chat.ChatRenderer; ++import java.util.Set; +import net.kyori.adventure.audience.Audience; +import net.kyori.adventure.chat.SignedMessage; +import net.kyori.adventure.text.Component; @@ -552,7 +548,7 @@ index 0000000000000000000000000000000000000000..7411f58f9f36beaadcc47c2264a4af31 +import org.bukkit.entity.Player; +import org.bukkit.event.HandlerList; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * An event fired when a {@link Player} sends a chat message to the server. @@ -562,22 +558,21 @@ index 0000000000000000000000000000000000000000..7411f58f9f36beaadcc47c2264a4af31 + */ +@Deprecated +@Warning(reason = "Listening to this event forces chat to wait for the main thread, delaying chat messages.") ++@NullMarked +public final class ChatEvent extends AbstractChatEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + @ApiStatus.Internal -+ public ChatEvent(final @NotNull Player player, final @NotNull Set viewers, final @NotNull ChatRenderer renderer, final @NotNull Component message, final @NotNull Component originalMessage, final @NotNull SignedMessage signedMessage) { ++ public ChatEvent(final Player player, final Set viewers, final ChatRenderer renderer, final Component message, final Component originalMessage, final SignedMessage signedMessage) { + super(false, player, viewers, renderer, message, originalMessage, signedMessage); + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0007-Paper-Utils.patch b/patches/api/0007-Paper-Utils.patch index a647b698a..38f5ac80a 100644 --- a/patches/api/0007-Paper-Utils.patch +++ b/patches/api/0007-Paper-Utils.patch @@ -6,22 +6,25 @@ Subject: [PATCH] Paper Utils diff --git a/src/main/java/com/destroystokyo/paper/util/SneakyThrow.java b/src/main/java/com/destroystokyo/paper/util/SneakyThrow.java new file mode 100644 -index 0000000000000000000000000000000000000000..9db0056ab94145819628b3ad8d8d26130d117fcf +index 0000000000000000000000000000000000000000..fbcd82b513b4cb9839f9d2b38d9c6c73148e30a6 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/util/SneakyThrow.java -@@ -0,0 +1,16 @@ +@@ -0,0 +1,19 @@ +package com.destroystokyo.paper.util; + -+import org.jetbrains.annotations.NotNull; ++import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; + -+public class SneakyThrow { ++@ApiStatus.Internal ++@NullMarked ++public final class SneakyThrow { + -+ public static void sneaky(@NotNull Throwable exception) { -+ SneakyThrow.throwSneaky(exception); ++ public static void sneaky(final Throwable exception) { ++ SneakyThrow.throwSneaky(exception); + } + + @SuppressWarnings("unchecked") -+ private static void throwSneaky(@NotNull Throwable exception) throws T { ++ private static void throwSneaky(final Throwable exception) throws T { + throw (T) exception; + } + diff --git a/patches/api/0008-Use-ASM-for-event-executors.patch b/patches/api/0008-Use-ASM-for-event-executors.patch index d06ca1676..964f911f6 100644 --- a/patches/api/0008-Use-ASM-for-event-executors.patch +++ b/patches/api/0008-Use-ASM-for-event-executors.patch @@ -6,7 +6,7 @@ Subject: [PATCH] Use ASM for event executors. Uses method handles for private or static methods. diff --git a/build.gradle.kts b/build.gradle.kts -index af3514113abdf3f42c41f1e7ff0f930cc1a417f5..ed0b67ac322aa22b191cd35502ae5b4f20af19f8 100644 +index 74f0e2b812c1e2e922b136fefe505fc8cbe33e83..1f627e81622e77b81b1228a467fbb9e6fd979e7a 100644 --- a/build.gradle.kts +++ b/build.gradle.kts @@ -47,6 +47,9 @@ dependencies { @@ -21,127 +21,138 @@ index af3514113abdf3f42c41f1e7ff0f930cc1a417f5..ed0b67ac322aa22b191cd35502ae5b4f compileOnly("org.apache.maven:maven-resolver-provider:3.9.6") diff --git a/src/main/java/com/destroystokyo/paper/event/executor/MethodHandleEventExecutor.java b/src/main/java/com/destroystokyo/paper/event/executor/MethodHandleEventExecutor.java new file mode 100644 -index 0000000000000000000000000000000000000000..5b28e9b1daba7834af67dbc193dd656bedd9a994 +index 0000000000000000000000000000000000000000..5a702481d28d90cb503faad0d9b9c3231bbff940 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/executor/MethodHandleEventExecutor.java -@@ -0,0 +1,42 @@ +@@ -0,0 +1,46 @@ +package com.destroystokyo.paper.event.executor; + ++import com.destroystokyo.paper.util.SneakyThrow; +import java.lang.invoke.MethodHandle; +import java.lang.invoke.MethodHandles; +import java.lang.reflect.Method; -+ -+import com.destroystokyo.paper.util.SneakyThrow; +import org.bukkit.event.Event; +import org.bukkit.event.EventException; +import org.bukkit.event.Listener; +import org.bukkit.plugin.EventExecutor; -+import org.jetbrains.annotations.NotNull; ++import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + ++@ApiStatus.Internal ++@NullMarked +public class MethodHandleEventExecutor implements EventExecutor { ++ + private final Class eventClass; + private final MethodHandle handle; + -+ public MethodHandleEventExecutor(@NotNull Class eventClass, @NotNull MethodHandle handle) { ++ public MethodHandleEventExecutor(final Class eventClass, final MethodHandle handle) { + this.eventClass = eventClass; + this.handle = handle; + } + -+ public MethodHandleEventExecutor(@NotNull Class eventClass, @NotNull Method m) { ++ public MethodHandleEventExecutor(final Class eventClass, final Method m) { + this.eventClass = eventClass; + try { + m.setAccessible(true); + this.handle = MethodHandles.lookup().unreflect(m); -+ } catch (IllegalAccessException e) { ++ } catch (final IllegalAccessException e) { + throw new AssertionError("Unable to set accessible", e); + } + } + + @Override -+ public void execute(@NotNull Listener listener, @NotNull Event event) throws EventException { -+ if (!eventClass.isInstance(event)) return; ++ public void execute(final Listener listener, final Event event) throws EventException { ++ if (!this.eventClass.isInstance(event)) return; + try { -+ handle.invoke(listener, event); -+ } catch (Throwable t) { ++ this.handle.invoke(listener, event); ++ } catch (final Throwable t) { + SneakyThrow.sneaky(t); + } + } +} diff --git a/src/main/java/com/destroystokyo/paper/event/executor/StaticMethodHandleEventExecutor.java b/src/main/java/com/destroystokyo/paper/event/executor/StaticMethodHandleEventExecutor.java new file mode 100644 -index 0000000000000000000000000000000000000000..827f2b27f70a7ec0bc11d039305c3e58c02a4ef4 +index 0000000000000000000000000000000000000000..bbdb5b472df116b71c459bdc6cc4b74267ea0f5e --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/executor/StaticMethodHandleEventExecutor.java -@@ -0,0 +1,42 @@ +@@ -0,0 +1,44 @@ +package com.destroystokyo.paper.event.executor; + ++import com.destroystokyo.paper.util.SneakyThrow; ++import com.google.common.base.Preconditions; +import java.lang.invoke.MethodHandle; +import java.lang.invoke.MethodHandles; +import java.lang.reflect.Method; +import java.lang.reflect.Modifier; -+ -+import com.destroystokyo.paper.util.SneakyThrow; -+import com.google.common.base.Preconditions; -+ +import org.bukkit.event.Event; +import org.bukkit.event.EventException; +import org.bukkit.event.Listener; +import org.bukkit.plugin.EventExecutor; -+import org.jetbrains.annotations.NotNull; ++import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; + ++@ApiStatus.Internal ++@NullMarked +public class StaticMethodHandleEventExecutor implements EventExecutor { ++ + private final Class eventClass; + private final MethodHandle handle; + -+ public StaticMethodHandleEventExecutor(@NotNull Class eventClass, @NotNull Method m) { ++ public StaticMethodHandleEventExecutor(final Class eventClass, final Method m) { + Preconditions.checkArgument(Modifier.isStatic(m.getModifiers()), "Not a static method: %s", m); + Preconditions.checkArgument(eventClass != null, "eventClass is null"); + this.eventClass = eventClass; + try { + m.setAccessible(true); + this.handle = MethodHandles.lookup().unreflect(m); -+ } catch (IllegalAccessException e) { ++ } catch (final IllegalAccessException e) { + throw new AssertionError("Unable to set accessible", e); + } + } + + @Override -+ public void execute(@NotNull Listener listener, @NotNull Event event) throws EventException { -+ if (!eventClass.isInstance(event)) return; ++ public void execute(final Listener listener, final Event event) throws EventException { ++ if (!this.eventClass.isInstance(event)) return; + try { -+ handle.invoke(event); -+ } catch (Throwable throwable) { ++ this.handle.invoke(event); ++ } catch (final Throwable throwable) { + SneakyThrow.sneaky(throwable); + } + } +} diff --git a/src/main/java/com/destroystokyo/paper/event/executor/asm/ASMEventExecutorGenerator.java b/src/main/java/com/destroystokyo/paper/event/executor/asm/ASMEventExecutorGenerator.java new file mode 100644 -index 0000000000000000000000000000000000000000..084c31af1a7ba32bb4c3dc8f16f67fd09ce0b6a4 +index 0000000000000000000000000000000000000000..abfcb6e8383ff311940d82afe4ff990649a082dc --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/executor/asm/ASMEventExecutorGenerator.java -@@ -0,0 +1,54 @@ +@@ -0,0 +1,59 @@ +package com.destroystokyo.paper.event.executor.asm; + +import java.lang.reflect.Method; +import java.util.concurrent.atomic.AtomicInteger; -+ +import org.bukkit.plugin.EventExecutor; -+import org.jetbrains.annotations.NotNull; ++import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; +import org.objectweb.asm.ClassWriter; +import org.objectweb.asm.Type; +import org.objectweb.asm.commons.GeneratorAdapter; + -+import static org.objectweb.asm.Opcodes.*; ++import static org.objectweb.asm.Opcodes.ACC_PUBLIC; ++import static org.objectweb.asm.Opcodes.INVOKEINTERFACE; ++import static org.objectweb.asm.Opcodes.INVOKESPECIAL; ++import static org.objectweb.asm.Opcodes.INVOKEVIRTUAL; ++import static org.objectweb.asm.Opcodes.V1_8; + -+public class ASMEventExecutorGenerator { ++@ApiStatus.Internal ++@NullMarked ++public final class ASMEventExecutorGenerator { + + private static final String EXECUTE_DESCRIPTOR = "(Lorg/bukkit/event/Listener;Lorg/bukkit/event/Event;)V"; + -+ @NotNull -+ public static byte[] generateEventExecutor(@NotNull Method m, @NotNull String name) { -+ ClassWriter writer = new ClassWriter(ClassWriter.COMPUTE_FRAMES | ClassWriter.COMPUTE_MAXS); -+ writer.visit(V1_8, ACC_PUBLIC, name.replace('.', '/'), null, Type.getInternalName(Object.class), new String[] {Type.getInternalName(EventExecutor.class)}); ++ public static byte[] generateEventExecutor(final Method m, final String name) { ++ final ClassWriter writer = new ClassWriter(ClassWriter.COMPUTE_FRAMES | ClassWriter.COMPUTE_MAXS); ++ writer.visit(V1_8, ACC_PUBLIC, name.replace('.', '/'), null, Type.getInternalName(Object.class), new String[]{Type.getInternalName(EventExecutor.class)}); + // Generate constructor + GeneratorAdapter methodGenerator = new GeneratorAdapter(writer.visitMethod(ACC_PUBLIC, "", "()V", null, null), ACC_PUBLIC, "", "()V"); + methodGenerator.loadThis(); @@ -169,22 +180,25 @@ index 0000000000000000000000000000000000000000..084c31af1a7ba32bb4c3dc8f16f67fd0 + } + + public static AtomicInteger NEXT_ID = new AtomicInteger(1); -+ @NotNull ++ + public static String generateName() { -+ int id = NEXT_ID.getAndIncrement(); ++ final int id = NEXT_ID.getAndIncrement(); + return "com.destroystokyo.paper.event.executor.asm.generated.GeneratedEventExecutor" + id; + } +} diff --git a/src/main/java/com/destroystokyo/paper/event/executor/asm/ClassDefiner.java b/src/main/java/com/destroystokyo/paper/event/executor/asm/ClassDefiner.java new file mode 100644 -index 0000000000000000000000000000000000000000..f79685b48bb581277a6891927988b6f7a4389dc4 +index 0000000000000000000000000000000000000000..581561fbd32c81ab1774ba8f0b7f3cec9392d99a --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/executor/asm/ClassDefiner.java -@@ -0,0 +1,34 @@ +@@ -0,0 +1,35 @@ +package com.destroystokyo.paper.event.executor.asm; + -+import org.jetbrains.annotations.NotNull; ++import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; + ++@ApiStatus.Internal ++@NullMarked +public interface ClassDefiner { + + /** @@ -192,7 +206,7 @@ index 0000000000000000000000000000000000000000..f79685b48bb581277a6891927988b6f7 + * + * @return if classes bypass access checks + */ -+ public default boolean isBypassAccessChecks() { ++ default boolean isBypassAccessChecks() { + return false; + } + @@ -206,79 +220,79 @@ index 0000000000000000000000000000000000000000..f79685b48bb581277a6891927988b6f7 + * @throws ClassFormatError if the class data is invalid + * @throws NullPointerException if any of the arguments are null + */ -+ @NotNull -+ public Class defineClass(@NotNull ClassLoader parentLoader, @NotNull String name, @NotNull byte[] data); ++ Class defineClass(ClassLoader parentLoader, String name, byte[] data); + -+ @NotNull -+ public static ClassDefiner getInstance() { ++ static ClassDefiner getInstance() { + return SafeClassDefiner.INSTANCE; + } + +} diff --git a/src/main/java/com/destroystokyo/paper/event/executor/asm/SafeClassDefiner.java b/src/main/java/com/destroystokyo/paper/event/executor/asm/SafeClassDefiner.java new file mode 100644 -index 0000000000000000000000000000000000000000..abcc966d8ee01d73c1d1480237ab46fa0ab55fdc +index 0000000000000000000000000000000000000000..48bcc72293c2a31b6e2dd2dcd6a79d618c72a137 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/executor/asm/SafeClassDefiner.java -@@ -0,0 +1,64 @@ +@@ -0,0 +1,66 @@ +package com.destroystokyo.paper.event.executor.asm; + -+import java.util.concurrent.ConcurrentMap; -+ +import com.google.common.base.Preconditions; -+ +import com.google.common.collect.MapMaker; -+import org.jetbrains.annotations.NotNull; ++import java.util.concurrent.ConcurrentMap; ++import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; + ++@ApiStatus.Internal ++@NullMarked +public class SafeClassDefiner implements ClassDefiner { ++ + /* default */ static final SafeClassDefiner INSTANCE = new SafeClassDefiner(); + -+ private SafeClassDefiner() {} ++ private SafeClassDefiner() { ++ } + + private final ConcurrentMap loaders = new MapMaker().weakKeys().makeMap(); + -+ @NotNull + @Override -+ public Class defineClass(@NotNull ClassLoader parentLoader, @NotNull String name, @NotNull byte[] data) { -+ GeneratedClassLoader loader = loaders.computeIfAbsent(parentLoader, GeneratedClassLoader::new); ++ public Class defineClass(final ClassLoader parentLoader, final String name, final byte[] data) { ++ final GeneratedClassLoader loader = this.loaders.computeIfAbsent(parentLoader, GeneratedClassLoader::new); + synchronized (loader.getClassLoadingLock(name)) { + Preconditions.checkState(!loader.hasClass(name), "%s already defined", name); -+ Class c = loader.define(name, data); ++ final Class c = loader.define(name, data); + assert c.getName().equals(name); + return c; + } + } + + private static class GeneratedClassLoader extends ClassLoader { ++ + static { + ClassLoader.registerAsParallelCapable(); + } + -+ protected GeneratedClassLoader(@NotNull ClassLoader parent) { ++ protected GeneratedClassLoader(final ClassLoader parent) { + super(parent); + } + -+ private Class define(@NotNull String name, byte[] data) { -+ synchronized (getClassLoadingLock(name)) { -+ assert !hasClass(name); -+ Class c = defineClass(name, data, 0, data.length); -+ resolveClass(c); ++ private Class define(final String name, final byte[] data) { ++ synchronized (this.getClassLoadingLock(name)) { ++ assert !this.hasClass(name); ++ final Class c = this.defineClass(name, data, 0, data.length); ++ this.resolveClass(c); + return c; + } + } + + @Override -+ @NotNull -+ public Object getClassLoadingLock(@NotNull String name) { ++ public Object getClassLoadingLock(final String name) { + return super.getClassLoadingLock(name); + } + -+ public boolean hasClass(@NotNull String name) { -+ synchronized (getClassLoadingLock(name)) { ++ public boolean hasClass(final String name) { ++ synchronized (this.getClassLoadingLock(name)) { + try { + Class.forName(name); + return true; -+ } catch (ClassNotFoundException e) { ++ } catch (final ClassNotFoundException e) { + return false; + } + } diff --git a/patches/api/0009-Paper-Plugins.patch b/patches/api/0009-Paper-Plugins.patch index b36c62b38..b29d687cc 100644 --- a/patches/api/0009-Paper-Plugins.patch +++ b/patches/api/0009-Paper-Plugins.patch @@ -5,7 +5,7 @@ Subject: [PATCH] Paper Plugins diff --git a/build.gradle.kts b/build.gradle.kts -index dd1e8d3fda7ae6e5f0dfc6a5293f1ac4eb5fd3f4..b88bf39df6fb920b2c802e7057468c1476d63778 100644 +index 1f627e81622e77b81b1228a467fbb9e6fd979e7a..3c50362de25617d878ef58f14f67c240005ff624 100644 --- a/build.gradle.kts +++ b/build.gradle.kts @@ -52,7 +52,7 @@ dependencies { @@ -17,7 +17,7 @@ index dd1e8d3fda7ae6e5f0dfc6a5293f1ac4eb5fd3f4..b88bf39df6fb920b2c802e7057468c14 compileOnly("org.apache.maven.resolver:maven-resolver-connector-basic:1.9.18") compileOnly("org.apache.maven.resolver:maven-resolver-transport-http:1.9.18") -@@ -140,6 +140,7 @@ tasks.withType { +@@ -141,6 +141,7 @@ tasks.withType { "https://jd.advntr.dev/text-serializer-plain/$adventureVersion/", "https://jd.advntr.dev/text-logger-slf4j/$adventureVersion/", // Paper end diff --git a/patches/api/0015-Expose-server-build-information.patch b/patches/api/0015-Expose-server-build-information.patch index f0299bf5f..3f8bdaf31 100644 --- a/patches/api/0015-Expose-server-build-information.patch +++ b/patches/api/0015-Expose-server-build-information.patch @@ -10,18 +10,21 @@ Co-authored-by: Riley Park diff --git a/src/main/java/com/destroystokyo/paper/util/VersionFetcher.java b/src/main/java/com/destroystokyo/paper/util/VersionFetcher.java new file mode 100644 -index 0000000000000000000000000000000000000000..a736d7bcdc5861a01b66ba36158db1c716339346 +index 0000000000000000000000000000000000000000..023cc52a9e28e1238c7452c0f3f577f2850fd861 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/util/VersionFetcher.java -@@ -0,0 +1,45 @@ +@@ -0,0 +1,47 @@ +package com.destroystokyo.paper.util; + +import net.kyori.adventure.text.Component; +import net.kyori.adventure.text.format.NamedTextColor; +import org.bukkit.Bukkit; -+import org.jetbrains.annotations.NotNull; ++import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public interface VersionFetcher { ++ + /** + * Amount of time to cache results for in milliseconds + *

@@ -39,9 +42,9 @@ index 0000000000000000000000000000000000000000..a736d7bcdc5861a01b66ba36158db1c7 + * @param serverVersion the current version of the server (will match {@link Bukkit#getVersion()}) + * @return the message to show when requesting a version + */ -+ @NotNull -+ Component getVersionMessage(@NotNull String serverVersion); ++ Component getVersionMessage(String serverVersion); + ++ @ApiStatus.Internal + class DummyVersionFetcher implements VersionFetcher { + + @Override @@ -49,9 +52,8 @@ index 0000000000000000000000000000000000000000..a736d7bcdc5861a01b66ba36158db1c7 + return -1; + } + -+ @NotNull + @Override -+ public Component getVersionMessage(@NotNull String serverVersion) { ++ public Component getVersionMessage(final String serverVersion) { + Bukkit.getLogger().warning("Version provider has not been set, cannot check for updates!"); + Bukkit.getLogger().info("Override the default implementation of org.bukkit.UnsafeValues#getVersionFetcher()"); + new Throwable().printStackTrace(); diff --git a/patches/api/0021-Add-exception-reporting-event.patch b/patches/api/0021-Add-exception-reporting-event.patch index 7d4694262..adf50a8c2 100644 --- a/patches/api/0021-Add-exception-reporting-event.patch +++ b/patches/api/0021-Add-exception-reporting-event.patch @@ -6,30 +6,31 @@ Subject: [PATCH] Add exception reporting event diff --git a/src/main/java/com/destroystokyo/paper/event/server/ServerExceptionEvent.java b/src/main/java/com/destroystokyo/paper/event/server/ServerExceptionEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..9377ee1c2368ce058397037952d17bc010f66957 +index 0000000000000000000000000000000000000000..95a5a59e6bd88345177fca0b12008ddd689cb448 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/server/ServerExceptionEvent.java -@@ -0,0 +1,45 @@ +@@ -0,0 +1,43 @@ +package com.destroystokyo.paper.event.server; + ++import com.destroystokyo.paper.exception.ServerException; +import org.bukkit.Bukkit; +import org.bukkit.event.Event; +import org.bukkit.event.HandlerList; -+import com.destroystokyo.paper.exception.ServerException; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called whenever an exception is thrown in a recoverable section of the server. + */ ++@NullMarked +public class ServerExceptionEvent extends Event { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final ServerException exception; ++ private final ServerException exception; + + @ApiStatus.Internal -+ public ServerExceptionEvent(@NotNull ServerException exception) { ++ public ServerExceptionEvent(final ServerException exception) { + super(!Bukkit.isPrimaryThread()); + this.exception = exception; + } @@ -39,18 +40,15 @@ index 0000000000000000000000000000000000000000..9377ee1c2368ce058397037952d17bc0 + * + * @return Exception thrown + */ -+ @NotNull + public ServerException getException() { + return this.exception; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0031-Entity-AddTo-RemoveFrom-World-Events.patch b/patches/api/0031-Entity-AddTo-RemoveFrom-World-Events.patch index 5748bb7aa..23dad970b 100644 --- a/patches/api/0031-Entity-AddTo-RemoveFrom-World-Events.patch +++ b/patches/api/0031-Entity-AddTo-RemoveFrom-World-Events.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Entity AddTo/RemoveFrom World Events diff --git a/src/main/java/com/destroystokyo/paper/event/entity/EntityAddToWorldEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/EntityAddToWorldEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..990b307801be996a4707d87e420b05ee25286d5b +index 0000000000000000000000000000000000000000..11f8540a4752cf4d2112eff48bcca3b935c9f8b1 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/EntityAddToWorldEvent.java -@@ -0,0 +1,43 @@ +@@ -0,0 +1,44 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.World; @@ -45,6 +45,7 @@ index 0000000000000000000000000000000000000000..990b307801be996a4707d87e420b05ee + return this.world; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } @@ -55,10 +56,10 @@ index 0000000000000000000000000000000000000000..990b307801be996a4707d87e420b05ee +} diff --git a/src/main/java/com/destroystokyo/paper/event/entity/EntityRemoveFromWorldEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/EntityRemoveFromWorldEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..b7776c1e65c8140a1e800df56bda5bec5717b50e +index 0000000000000000000000000000000000000000..5ad5632d4d47d8b42e4f2af19c0fe6cf94ac5643 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/EntityRemoveFromWorldEvent.java -@@ -0,0 +1,41 @@ +@@ -0,0 +1,42 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.World; @@ -92,6 +93,7 @@ index 0000000000000000000000000000000000000000..b7776c1e65c8140a1e800df56bda5bec + return this.world; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0032-EntityPathfindEvent.patch b/patches/api/0032-EntityPathfindEvent.patch index e6ee2e1f3..5a2e0c0ff 100644 --- a/patches/api/0032-EntityPathfindEvent.patch +++ b/patches/api/0032-EntityPathfindEvent.patch @@ -7,10 +7,10 @@ Fires when an Entity decides to start moving to a location. diff --git a/src/main/java/com/destroystokyo/paper/event/entity/EntityPathfindEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/EntityPathfindEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..2dd25136d81624025244a82de119fbecd0d7224c +index 0000000000000000000000000000000000000000..8624e0a528985c9b118f5e8a0f33d3286af2fc36 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/EntityPathfindEvent.java -@@ -0,0 +1,83 @@ +@@ -0,0 +1,84 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.Location; @@ -49,6 +49,7 @@ index 0000000000000000000000000000000000000000..2dd25136d81624025244a82de119fbec + * + * @return The Entity that is pathfinding. + */ ++ @Override + public Entity getEntity() { + return this.entity; + } diff --git a/patches/api/0035-Add-PlayerUseUnknownEntityEvent.patch b/patches/api/0035-Add-PlayerUseUnknownEntityEvent.patch index e0d410dc6..49715a525 100644 --- a/patches/api/0035-Add-PlayerUseUnknownEntityEvent.patch +++ b/patches/api/0035-Add-PlayerUseUnknownEntityEvent.patch @@ -10,10 +10,10 @@ Co-authored-by: Nassim Jahnke diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerUseUnknownEntityEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerUseUnknownEntityEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..dbb635686e9108b9d3df5d373e6972cca07c0621 +index 0000000000000000000000000000000000000000..9ff2bbf7f99df45cc626cad60bec4d14a8a04e3e --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerUseUnknownEntityEvent.java -@@ -0,0 +1,86 @@ +@@ -0,0 +1,85 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.entity.Player; @@ -23,8 +23,8 @@ index 0000000000000000000000000000000000000000..dbb635686e9108b9d3df5d373e6972cc +import org.bukkit.inventory.EquipmentSlot; +import org.bukkit.util.Vector; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Represents an event that is called when a player right-clicks an unknown entity. @@ -33,17 +33,18 @@ index 0000000000000000000000000000000000000000..dbb635686e9108b9d3df5d373e6972cc + * This event may be called multiple times per interaction with different interaction hands + * and with or without the clicked position. + */ ++@NullMarked +public class PlayerUseUnknownEntityEvent extends PlayerEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + private final int entityId; + private final boolean attack; -+ private final @NotNull EquipmentSlot hand; ++ private final EquipmentSlot hand; + private final @Nullable Vector clickedPosition; + + @ApiStatus.Internal -+ public PlayerUseUnknownEntityEvent(@NotNull Player player, int entityId, boolean attack, @NotNull EquipmentSlot hand, @Nullable Vector clickedPosition) { ++ public PlayerUseUnknownEntityEvent(final Player player, final int entityId, final boolean attack, final EquipmentSlot hand, final @Nullable Vector clickedPosition) { + super(player); + this.entityId = entityId; + this.attack = attack; @@ -74,7 +75,7 @@ index 0000000000000000000000000000000000000000..dbb635686e9108b9d3df5d373e6972cc + * + * @return the hand used to interact + */ -+ public @NotNull EquipmentSlot getHand() { ++ public EquipmentSlot getHand() { + return this.hand; + } + @@ -89,13 +90,11 @@ index 0000000000000000000000000000000000000000..dbb635686e9108b9d3df5d373e6972cc + return this.clickedPosition != null ? this.clickedPosition.clone() : null; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0039-LootTable-API.patch b/patches/api/0039-LootTable-API.patch index e1252ab84..40be416e9 100644 --- a/patches/api/0039-LootTable-API.patch +++ b/patches/api/0039-LootTable-API.patch @@ -12,96 +12,100 @@ Provides methods to determine players looted state for an object diff --git a/src/main/java/com/destroystokyo/paper/loottable/LootableBlockInventory.java b/src/main/java/com/destroystokyo/paper/loottable/LootableBlockInventory.java new file mode 100644 -index 0000000000000000000000000000000000000000..92d7b853a2ccaae5afa8ac141bead840942944ef +index 0000000000000000000000000000000000000000..08e82b9de34c5ce8c5e83631b1229e90e5aa9694 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/loottable/LootableBlockInventory.java -@@ -0,0 +1,17 @@ +@@ -0,0 +1,18 @@ +package com.destroystokyo.paper.loottable; + +import org.bukkit.block.Block; +import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Represents an Inventory that can generate loot, such as Chests inside of Fortresses and Mineshafts + */ ++@NullMarked +public interface LootableBlockInventory extends LootableInventory { + + /** + * Gets the block that is lootable + * @return The Block + */ -+ @NotNull + Block getBlock(); +} diff --git a/src/main/java/com/destroystokyo/paper/loottable/LootableEntityInventory.java b/src/main/java/com/destroystokyo/paper/loottable/LootableEntityInventory.java new file mode 100644 -index 0000000000000000000000000000000000000000..b387894fe8001edb41ad2ad2b70ebabe065b682e +index 0000000000000000000000000000000000000000..a1e1a0256010f293e7dfa63c6622e9125eb4cc73 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/loottable/LootableEntityInventory.java -@@ -0,0 +1,17 @@ +@@ -0,0 +1,18 @@ +package com.destroystokyo.paper.loottable; + +import org.bukkit.entity.Entity; +import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Represents an Inventory that can generate loot, such as Minecarts inside of Mineshafts + */ ++@NullMarked +public interface LootableEntityInventory extends LootableInventory { + + /** + * Gets the entity that is lootable + * @return The Entity + */ -+ @NotNull + Entity getEntity(); +} diff --git a/src/main/java/com/destroystokyo/paper/loottable/LootableInventory.java b/src/main/java/com/destroystokyo/paper/loottable/LootableInventory.java new file mode 100644 -index 0000000000000000000000000000000000000000..b18a0b50c12fe8d8c954e5c070f2ecd1854a2583 +index 0000000000000000000000000000000000000000..b085e1217838012e4f4c6bcce100d8282190cdbc --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/loottable/LootableInventory.java -@@ -0,0 +1,124 @@ +@@ -0,0 +1,129 @@ +package com.destroystokyo.paper.loottable; + ++import java.util.UUID; +import org.bukkit.entity.Player; +import org.bukkit.loot.Lootable; -+ -+import java.util.UUID; -+import org.jetbrains.annotations.NotNull; +import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; + +/** + * Represents an Inventory that contains a Loot Table associated to it that will + * automatically fill on first open. -+ * ++ *

+ * A new feature and API is provided to support automatically refreshing the contents + * of the inventory based on that Loot Table after a configurable amount of time has passed. -+ * ++ *

+ * The behavior of how the Inventory is filled based on the loot table may vary based + * on Minecraft versions and the Loot Table feature. + */ ++@NullMarked +public interface LootableInventory extends Lootable { + + /** -+ * Server owners have to enable whether or not an object in a world should refill ++ * Server owners have to enable whether an object in a world should refill + * + * @return If the world this inventory is currently in has Replenishable Lootables enabled + */ + boolean isRefillEnabled(); + + /** -+ * Whether or not this object has ever been filled ++ * Whether this object has ever been filled ++ * + * @return Has ever been filled + */ + boolean hasBeenFilled(); + + /** + * Has this player ever looted this block ++ * + * @param player The player to check -+ * @return Whether or not this player has looted this block ++ * @return Whether this player has looted this block + */ -+ default boolean hasPlayerLooted(final @NotNull Player player) { ++ default boolean hasPlayerLooted(final Player player) { + return this.hasPlayerLooted(player.getUniqueId()); + } + @@ -109,17 +113,17 @@ index 0000000000000000000000000000000000000000..b18a0b50c12fe8d8c954e5c070f2ecd1 + * Checks if this player can loot this block. Takes into account the "restrict player reloot" settings + * + * @param player the player to check -+ * + * @return Whether this player can loot this block + */ -+ boolean canPlayerLoot(@NotNull UUID player); ++ boolean canPlayerLoot(UUID player); + + /** + * Has this player ever looted this block ++ * + * @param player The player to check -+ * @return Whether or not this player has looted this block ++ * @return Whether this player has looted this block + */ -+ boolean hasPlayerLooted(@NotNull UUID player); ++ boolean hasPlayerLooted(UUID player); + + /** + * Gets the timestamp, in milliseconds, of when the player last looted this object @@ -127,7 +131,7 @@ index 0000000000000000000000000000000000000000..b18a0b50c12fe8d8c954e5c070f2ecd1 + * @param player The player to check + * @return Timestamp last looted, or null if player has not looted this object + */ -+ default @Nullable Long getLastLooted(final @NotNull Player player) { ++ default @Nullable Long getLastLooted(final Player player) { + return this.getLastLooted(player.getUniqueId()); + } + @@ -138,28 +142,31 @@ index 0000000000000000000000000000000000000000..b18a0b50c12fe8d8c954e5c070f2ecd1 + * @return Timestamp last looted, or null if player has not looted this object + */ + @Nullable -+ Long getLastLooted(@NotNull UUID player); ++ Long getLastLooted(UUID player); + + /** -+ * Change the state of whether or not a player has looted this block ++ * Change the state of whether a player has looted this block ++ * + * @param player The player to change state for + * @param looted true to add player to looted list, false to remove + * @return The previous state of whether the player had looted this or not + */ -+ default boolean setHasPlayerLooted(final @NotNull Player player, final boolean looted) { ++ default boolean setHasPlayerLooted(final Player player, final boolean looted) { + return this.setHasPlayerLooted(player.getUniqueId(), looted); + } + + /** -+ * Change the state of whether or not a player has looted this block ++ * Change the state of whether a player has looted this block ++ * + * @param player The player to change state for + * @param looted true to add player to looted list, false to remove + * @return The previous state of whether the player had looted this or not + */ -+ boolean setHasPlayerLooted(@NotNull UUID player, boolean looted); ++ boolean setHasPlayerLooted(UUID player, boolean looted); + + /** -+ * Returns Whether or not this object has been filled and now has a pending refill ++ * Returns Whether this object has been filled and now has a pending refill ++ * + * @return Has pending refill + */ + boolean hasPendingRefill(); @@ -188,10 +195,10 @@ index 0000000000000000000000000000000000000000..b18a0b50c12fe8d8c954e5c070f2ecd1 +} diff --git a/src/main/java/com/destroystokyo/paper/loottable/LootableInventoryReplenishEvent.java b/src/main/java/com/destroystokyo/paper/loottable/LootableInventoryReplenishEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..5ee1a04aaaa4ef09559f2cf757811e463e2a1be6 +index 0000000000000000000000000000000000000000..994c2183db89fc40d5991d5e1906e4bd04db6291 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/loottable/LootableInventoryReplenishEvent.java -@@ -0,0 +1,47 @@ +@@ -0,0 +1,46 @@ +package com.destroystokyo.paper.loottable; + +import org.bukkit.entity.Player; @@ -199,22 +206,22 @@ index 0000000000000000000000000000000000000000..5ee1a04aaaa4ef09559f2cf757811e46 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public class LootableInventoryReplenishEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final LootableInventory inventory; ++ private final LootableInventory inventory; + private boolean cancelled; + + @ApiStatus.Internal -+ public LootableInventoryReplenishEvent(@NotNull Player player, @NotNull LootableInventory inventory) { ++ public LootableInventoryReplenishEvent(final Player player, final LootableInventory inventory) { + super(player); + this.inventory = inventory; + } + -+ @NotNull + public LootableInventory getInventory() { + return this.inventory; + } @@ -225,16 +232,15 @@ index 0000000000000000000000000000000000000000..5ee1a04aaaa4ef09559f2cf757811e46 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0049-PlayerTeleportEndGatewayEvent.patch b/patches/api/0049-PlayerTeleportEndGatewayEvent.patch index b964a35e5..b52aaaead 100644 --- a/patches/api/0049-PlayerTeleportEndGatewayEvent.patch +++ b/patches/api/0049-PlayerTeleportEndGatewayEvent.patch @@ -7,7 +7,7 @@ Allows you to access the Gateway being used in a teleport event diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerTeleportEndGatewayEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerTeleportEndGatewayEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..40bd79fbe30f19bc93e34da52d2b2bf0768be974 +index 0000000000000000000000000000000000000000..4488154d3f99f4281b08eef8a44c13fd896e538f --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerTeleportEndGatewayEvent.java @@ -0,0 +1,32 @@ @@ -18,17 +18,18 @@ index 0000000000000000000000000000000000000000..40bd79fbe30f19bc93e34da52d2b2bf0 +import org.bukkit.entity.Player; +import org.bukkit.event.player.PlayerTeleportEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Fired when a teleport is triggered for an End Gateway + */ ++@NullMarked +public class PlayerTeleportEndGatewayEvent extends PlayerTeleportEvent { + -+ @NotNull private final EndGateway gateway; ++ private final EndGateway gateway; + + @ApiStatus.Internal -+ public PlayerTeleportEndGatewayEvent(@NotNull Player player, @NotNull Location from, @NotNull Location to, @NotNull EndGateway gateway) { ++ public PlayerTeleportEndGatewayEvent(final Player player, final Location from, final Location to, final EndGateway gateway) { + super(player, from, to, PlayerTeleportEvent.TeleportCause.END_GATEWAY); + this.gateway = gateway; + } @@ -38,7 +39,6 @@ index 0000000000000000000000000000000000000000..40bd79fbe30f19bc93e34da52d2b2bf0 + * + * @return EndGateway used + */ -+ @NotNull + public EndGateway getGateway() { + return this.gateway; + } diff --git a/patches/api/0057-Basic-PlayerProfile-API.patch b/patches/api/0057-Basic-PlayerProfile-API.patch index 1161dbaab..1e069d46b 100644 --- a/patches/api/0057-Basic-PlayerProfile-API.patch +++ b/patches/api/0057-Basic-PlayerProfile-API.patch @@ -247,7 +247,7 @@ index 0000000000000000000000000000000000000000..b4f9ffbebab8eef99dbd81c816c16c27 +} diff --git a/src/main/java/com/destroystokyo/paper/profile/ProfileProperty.java b/src/main/java/com/destroystokyo/paper/profile/ProfileProperty.java new file mode 100644 -index 0000000000000000000000000000000000000000..8f913a078dd692a9feafb98a6e6c9583f3253bd4 +index 0000000000000000000000000000000000000000..8f6240484d12f01bb555972feb0937bc74399a64 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/profile/ProfileProperty.java @@ -0,0 +1,75 @@ @@ -262,7 +262,7 @@ index 0000000000000000000000000000000000000000..8f913a078dd692a9feafb98a6e6c9583 +/** + * Represents a property on a {@link PlayerProfile} + */ -+public class ProfileProperty { ++public final class ProfileProperty { + private final String name; + private final String value; + private final String signature; diff --git a/patches/api/0066-ProfileWhitelistVerifyEvent.patch b/patches/api/0066-ProfileWhitelistVerifyEvent.patch index 8c653d95a..d0fac0687 100644 --- a/patches/api/0066-ProfileWhitelistVerifyEvent.patch +++ b/patches/api/0066-ProfileWhitelistVerifyEvent.patch @@ -9,10 +9,10 @@ Allows you to do dynamic whitelisting and change of kick message diff --git a/src/main/java/com/destroystokyo/paper/event/profile/ProfileWhitelistVerifyEvent.java b/src/main/java/com/destroystokyo/paper/event/profile/ProfileWhitelistVerifyEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..52959c2d19c5b73ccd85afce6b2ab8133478f7c6 +index 0000000000000000000000000000000000000000..31884c55d45931a313292df552b604d929a22586 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/profile/ProfileWhitelistVerifyEvent.java -@@ -0,0 +1,147 @@ +@@ -0,0 +1,144 @@ +/* + * Copyright (c) 2017 - Daniel Ennis (Aikar) - MIT License + * @@ -44,8 +44,8 @@ index 0000000000000000000000000000000000000000..52959c2d19c5b73ccd85afce6b2ab813 +import org.bukkit.event.Event; +import org.bukkit.event.HandlerList; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Fires when the server needs to verify if a player is whitelisted. @@ -53,24 +53,25 @@ index 0000000000000000000000000000000000000000..52959c2d19c5b73ccd85afce6b2ab813 + * Plugins may override/control the servers whitelist with this event, + * and dynamically change the kick message. + */ ++@NullMarked +public class ProfileWhitelistVerifyEvent extends Event { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final PlayerProfile profile; ++ private final PlayerProfile profile; + private final boolean whitelistEnabled; + private final boolean isOp; + private boolean whitelisted; -+ @Nullable private Component kickMessage; ++ private @Nullable Component kickMessage; + + @Deprecated + @ApiStatus.Internal -+ public ProfileWhitelistVerifyEvent(@NotNull final PlayerProfile profile, boolean whitelistEnabled, boolean whitelisted, boolean isOp, @Nullable String kickMessage) { ++ public ProfileWhitelistVerifyEvent(final PlayerProfile profile, final boolean whitelistEnabled, final boolean whitelisted, final boolean isOp, final @Nullable String kickMessage) { + this(profile, whitelistEnabled, whitelisted, isOp, kickMessage == null ? null : LegacyComponentSerializer.legacySection().deserialize(kickMessage)); + } + + @ApiStatus.Internal -+ public ProfileWhitelistVerifyEvent(@NotNull final PlayerProfile profile, boolean whitelistEnabled, boolean whitelisted, boolean isOp, @Nullable Component kickMessage) { ++ public ProfileWhitelistVerifyEvent(final PlayerProfile profile, final boolean whitelistEnabled, final boolean whitelisted, final boolean isOp, final @Nullable Component kickMessage) { + this.profile = profile; + this.whitelistEnabled = whitelistEnabled; + this.whitelisted = whitelisted; @@ -83,8 +84,7 @@ index 0000000000000000000000000000000000000000..52959c2d19c5b73ccd85afce6b2ab813 + * @deprecated use {@link #kickMessage()} + */ + @Deprecated -+ @Nullable -+ public String getKickMessage() { ++ public @Nullable String getKickMessage() { + return this.kickMessage == null ? null : LegacyComponentSerializer.legacySection().serialize(this.kickMessage); + } + @@ -93,35 +93,33 @@ index 0000000000000000000000000000000000000000..52959c2d19c5b73ccd85afce6b2ab813 + * @deprecated Use {@link #kickMessage(Component)} + */ + @Deprecated -+ public void setKickMessage(@Nullable String kickMessage) { ++ public void setKickMessage(final @Nullable String kickMessage) { + this.kickMessage(kickMessage == null ? null : LegacyComponentSerializer.legacySection().deserialize(kickMessage)); + } + + /** + * @return the currently planned message to send to the user if they are not whitelisted + */ -+ @Nullable -+ public Component kickMessage() { ++ public @Nullable Component kickMessage() { + return this.kickMessage; + } + + /** + * @param kickMessage The message to send to the player on kick if not whitelisted. May set to {@code null} to use the server configured default + */ -+ public void kickMessage(@Nullable Component kickMessage) { ++ public void kickMessage(final @Nullable Component kickMessage) { + this.kickMessage = kickMessage; + } + + /** + * @return The profile of the player trying to connect + */ -+ @NotNull + public PlayerProfile getPlayerProfile() { + return this.profile; + } + + /** -+ * @return Whether the player is whitelisted to play on this server (whitelist may be off is why its true) ++ * @return Whether the player is whitelisted to play on this server (whitelist may be off is why it's true) + */ + public boolean isWhitelisted() { + return this.whitelisted; @@ -129,9 +127,10 @@ index 0000000000000000000000000000000000000000..52959c2d19c5b73ccd85afce6b2ab813 + + /** + * Changes the players whitelisted state. {@code false} will deny the login ++ * + * @param whitelisted The new whitelisted state + */ -+ public void setWhitelisted(boolean whitelisted) { ++ public void setWhitelisted(final boolean whitelisted) { + this.whitelisted = whitelisted; + } + @@ -149,13 +148,11 @@ index 0000000000000000000000000000000000000000..52959c2d19c5b73ccd85afce6b2ab813 + return this.whitelistEnabled; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0067-Allow-plugins-to-use-SLF4J-for-logging.patch b/patches/api/0067-Allow-plugins-to-use-SLF4J-for-logging.patch index a76fe3bb2..1b451c151 100644 --- a/patches/api/0067-Allow-plugins-to-use-SLF4J-for-logging.patch +++ b/patches/api/0067-Allow-plugins-to-use-SLF4J-for-logging.patch @@ -14,7 +14,7 @@ it without having to shade it in the plugin and going through several layers of logging abstraction. diff --git a/build.gradle.kts b/build.gradle.kts -index b88bf39df6fb920b2c802e7057468c1476d63778..37ff4cb89dfb28eab6f836840ff1838d67895c1e 100644 +index 3c50362de25617d878ef58f14f67c240005ff624..76aa23da778b0fe8a093429c56cb29b044359b40 100644 --- a/build.gradle.kts +++ b/build.gradle.kts @@ -12,6 +12,8 @@ java { @@ -35,7 +35,7 @@ index b88bf39df6fb920b2c802e7057468c1476d63778..37ff4cb89dfb28eab6f836840ff1838d implementation("org.ow2.asm:asm:9.7") implementation("org.ow2.asm:asm-commons:9.7") -@@ -139,6 +143,8 @@ tasks.withType { +@@ -140,6 +144,8 @@ tasks.withType { "https://jd.advntr.dev/text-serializer-legacy/$adventureVersion/", "https://jd.advntr.dev/text-serializer-plain/$adventureVersion/", "https://jd.advntr.dev/text-logger-slf4j/$adventureVersion/", diff --git a/patches/api/0069-Add-PlayerJumpEvent.patch b/patches/api/0069-Add-PlayerJumpEvent.patch index fef1ccd34..f43b25a51 100644 --- a/patches/api/0069-Add-PlayerJumpEvent.patch +++ b/patches/api/0069-Add-PlayerJumpEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerJumpEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerJumpEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerJumpEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272ad3a67b6f +index 0000000000000000000000000000000000000000..1d07c3d6bf3b9283371ca45698178979113085fa --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerJumpEvent.java -@@ -0,0 +1,106 @@ +@@ -0,0 +1,105 @@ +package com.destroystokyo.paper.event.player; + +import com.google.common.base.Preconditions; @@ -20,7 +20,7 @@ index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272a +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.event.player.PlayerMoveEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when the server detects the player is jumping. @@ -29,17 +29,18 @@ index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272a + * when checking for jumps via {@link PlayerMoveEvent}, this event is fired whenever + * the server detects that the player is jumping. + */ ++@NullMarked +public class PlayerJumpEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final Location to; -+ @NotNull private Location from; ++ private final Location to; ++ private Location from; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerJumpEvent(@NotNull final Player player, @NotNull final Location from, @NotNull final Location to) { ++ public PlayerJumpEvent(final Player player, final Location from, final Location to) { + super(player); + this.from = from; + this.to = to; @@ -54,6 +55,7 @@ index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272a + * + * @return {@code true} if this event is cancelled + */ ++ @Override + public boolean isCancelled() { + return this.cancelled; + } @@ -67,7 +69,8 @@ index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272a + * + * @param cancel {@code true} if you wish to cancel this event + */ -+ public void setCancelled(boolean cancel) { ++ @Override ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + @@ -76,7 +79,6 @@ index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272a + * + * @return Location the player jumped from + */ -+ @NotNull + public Location getFrom() { + return this.from; + } @@ -86,7 +88,7 @@ index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272a + * + * @param from New location to mark as the players previous location + */ -+ public void setFrom(@NotNull Location from) { ++ public void setFrom(final Location from) { + Preconditions.checkArgument(from != null, "Cannot use null from location!"); + Preconditions.checkArgument(from.getWorld() != null, "Cannot use from location with null world!"); + this.from = from; @@ -100,18 +102,15 @@ index 0000000000000000000000000000000000000000..8c2fd2c1120d634052f9bc345365272a + * + * @return Location the player jumped to + */ -+ @NotNull + public Location getTo() { + return this.to.clone(); + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0070-Add-workaround-for-plugins-modifying-the-parent-of-t.patch b/patches/api/0070-Add-workaround-for-plugins-modifying-the-parent-of-t.patch index 12d008b48..9afdf0a36 100644 --- a/patches/api/0070-Add-workaround-for-plugins-modifying-the-parent-of-t.patch +++ b/patches/api/0070-Add-workaround-for-plugins-modifying-the-parent-of-t.patch @@ -14,33 +14,31 @@ parent of the plugin logger to avoid this. diff --git a/src/main/java/com/destroystokyo/paper/utils/PaperPluginLogger.java b/src/main/java/com/destroystokyo/paper/utils/PaperPluginLogger.java new file mode 100644 -index 0000000000000000000000000000000000000000..087ee57fe5485bc760fadd45a176d4d90a18f9f8 +index 0000000000000000000000000000000000000000..c78a359566a11904d2dd41098ced556a91a7fa36 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/utils/PaperPluginLogger.java -@@ -0,0 +1,48 @@ +@@ -0,0 +1,46 @@ +package com.destroystokyo.paper.utils; + +import io.papermc.paper.plugin.configuration.PluginMeta; -+import org.bukkit.plugin.PluginDescriptionFile; -+ +import java.util.logging.Level; +import java.util.logging.LogManager; +import java.util.logging.Logger; -+import org.jetbrains.annotations.NotNull; ++import org.bukkit.plugin.PluginDescriptionFile; ++import org.jspecify.annotations.NullMarked; + +/** + * Prevents plugins (e.g. Essentials) from changing the parent of the plugin logger. + */ ++@NullMarked +public class PaperPluginLogger extends Logger { + + @Deprecated(forRemoval = true) -+ @NotNull -+ public static Logger getLogger(@NotNull PluginDescriptionFile description) { ++ public static Logger getLogger(final PluginDescriptionFile description) { + return getLogger((PluginMeta) description); + } + -+ @NotNull -+ public static Logger getLogger(@NotNull PluginMeta meta) { ++ public static Logger getLogger(final PluginMeta meta) { + Logger logger = new PaperPluginLogger(meta); + if (!LogManager.getLogManager().addLogger(logger)) { + // Disable this if it's going to happen across reloads anyways... @@ -51,14 +49,14 @@ index 0000000000000000000000000000000000000000..087ee57fe5485bc760fadd45a176d4d9 + return logger; + } + -+ private PaperPluginLogger(@NotNull PluginMeta meta) { ++ private PaperPluginLogger(final PluginMeta meta) { + super(meta.getLoggerPrefix() != null ? meta.getLoggerPrefix() : meta.getName(), null); + } + + @Override -+ public void setParent(@NotNull Logger parent) { -+ if (getParent() != null) { -+ warning("Ignoring attempt to change parent of plugin logger"); ++ public void setParent(final Logger parent) { ++ if (this.getParent() != null) { ++ this.warning("Ignoring attempt to change parent of plugin logger"); + } else { + this.log(Level.FINE, "Setting plugin logger parent to {0}", parent); + super.setParent(parent); @@ -67,7 +65,7 @@ index 0000000000000000000000000000000000000000..087ee57fe5485bc760fadd45a176d4d9 + +} diff --git a/src/main/java/org/bukkit/plugin/java/JavaPlugin.java b/src/main/java/org/bukkit/plugin/java/JavaPlugin.java -index f81e335a4e533221529355bec2f5d588aa79e60c..d359ea9b02952f981b9cf9d778c56eb995454c60 100644 +index 801578de8599d6b546cde63b3f2655fab48eee03..2d64fc065d53dcd8c01d05215c3e63aaf4428177 100644 --- a/src/main/java/org/bukkit/plugin/java/JavaPlugin.java +++ b/src/main/java/org/bukkit/plugin/java/JavaPlugin.java @@ -292,10 +292,10 @@ public abstract class JavaPlugin extends PluginBase { diff --git a/patches/api/0071-Add-PlayerArmorChangeEvent.patch b/patches/api/0071-Add-PlayerArmorChangeEvent.patch index d0fc3edb3..9b30ad2ab 100644 --- a/patches/api/0071-Add-PlayerArmorChangeEvent.patch +++ b/patches/api/0071-Add-PlayerArmorChangeEvent.patch @@ -6,22 +6,21 @@ Subject: [PATCH] Add PlayerArmorChangeEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerArmorChangeEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerArmorChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180b335bf20 +index 0000000000000000000000000000000000000000..c7cc612ec81b0c7da6ee6676167e047e69347966 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerArmorChangeEvent.java -@@ -0,0 +1,127 @@ +@@ -0,0 +1,120 @@ +package com.destroystokyo.paper.event.player; + ++import java.util.Set; +import org.bukkit.Material; +import org.bukkit.entity.Player; +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.ItemStack; -+ -+import java.util.Set; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +import static org.bukkit.Material.*; + @@ -30,16 +29,17 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + *

+ * Not currently called for environmental factors though it MAY BE IN THE FUTURE + */ ++@NullMarked +public class PlayerArmorChangeEvent extends PlayerEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final SlotType slotType; -+ @NotNull private final ItemStack oldItem; -+ @NotNull private final ItemStack newItem; ++ private final SlotType slotType; ++ private final ItemStack oldItem; ++ private final ItemStack newItem; + + @ApiStatus.Internal -+ public PlayerArmorChangeEvent(@NotNull Player player, @NotNull SlotType slotType, @NotNull ItemStack oldItem, @NotNull ItemStack newItem) { ++ public PlayerArmorChangeEvent(final Player player, final SlotType slotType, final ItemStack oldItem, final ItemStack newItem) { + super(player); + this.slotType = slotType; + this.oldItem = oldItem; @@ -51,7 +51,6 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + * + * @return type of slot being altered + */ -+ @NotNull + public SlotType getSlotType() { + return this.slotType; + } @@ -61,7 +60,6 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + * + * @return old item + */ -+ @NotNull + public ItemStack getOldItem() { + return this.oldItem; + } @@ -71,18 +69,15 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + * + * @return new item + */ -+ @NotNull + public ItemStack getNewItem() { + return this.newItem; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } @@ -95,7 +90,7 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + + private final Set types; + -+ SlotType(Material... types) { ++ SlotType(final Material... types) { + this.types = Set.of(types); + } + @@ -105,7 +100,6 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + * + * @return immutable set of material types + */ -+ @NotNull + public Set getTypes() { + return this.types; + } @@ -116,9 +110,8 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + * @param material material to get slot by + * @return slot type the material will go in, or {@code null} if it won't + */ -+ @Nullable -+ public static SlotType getByMaterial(@NotNull Material material) { -+ for (SlotType slotType : values()) { ++ public static @Nullable SlotType getByMaterial(final Material material) { ++ for (final SlotType slotType : values()) { + if (slotType.getTypes().contains(material)) { + return slotType; + } @@ -132,7 +125,7 @@ index 0000000000000000000000000000000000000000..ab08219497f7e362f113321c4bcfd180 + * @param material material to check + * @return whether this material can be equipped + */ -+ public static boolean isEquipable(@NotNull Material material) { ++ public static boolean isEquipable(final Material material) { + return getByMaterial(material) != null; + } + } diff --git a/patches/api/0073-AsyncTabCompleteEvent.patch b/patches/api/0073-AsyncTabCompleteEvent.patch index b5de05345..2ad169a7c 100644 --- a/patches/api/0073-AsyncTabCompleteEvent.patch +++ b/patches/api/0073-AsyncTabCompleteEvent.patch @@ -17,10 +17,10 @@ Co-authored-by: Aikar diff --git a/src/main/java/com/destroystokyo/paper/event/server/AsyncTabCompleteEvent.java b/src/main/java/com/destroystokyo/paper/event/server/AsyncTabCompleteEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..e2bfd86c964ce5a75470fef1ea7e031a95735fb3 +index 0000000000000000000000000000000000000000..0482ecf5b84ba8e0260679049f384f3449bbe7b5 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/server/AsyncTabCompleteEvent.java -@@ -0,0 +1,332 @@ +@@ -0,0 +1,333 @@ +/* + * Copyright (c) 2017 Daniel Ennis (Aikar) MIT License + * @@ -244,6 +244,7 @@ index 0000000000000000000000000000000000000000..e2bfd86c964ce5a75470fef1ea7e031a + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } @@ -592,7 +593,7 @@ index 270e6d8ad4358baa256cee5f16cff281f063ce3b..6465e290c090d82986352d5ab7ba5dc6 @Override diff --git a/src/test/java/org/bukkit/AnnotationTest.java b/src/test/java/org/bukkit/AnnotationTest.java -index 65cca227207efb8177f3cdbcbff5fe0c3b8a563f..d3a2cb7cf1bc708002fa0b7a44c03ed53fc0c454 100644 +index 7ff939ea41417bad3a436a87c89d5efa7ecefe86..88d5db2995829cba919d78f988d5c735cf70cb1b 100644 --- a/src/test/java/org/bukkit/AnnotationTest.java +++ b/src/test/java/org/bukkit/AnnotationTest.java @@ -48,6 +48,8 @@ public class AnnotationTest { diff --git a/patches/api/0074-Expose-client-protocol-version-and-virtual-host.patch b/patches/api/0074-Expose-client-protocol-version-and-virtual-host.patch index c6ce0e987..0a078f013 100644 --- a/patches/api/0074-Expose-client-protocol-version-and-virtual-host.patch +++ b/patches/api/0074-Expose-client-protocol-version-and-virtual-host.patch @@ -11,20 +11,20 @@ Add a NetworkClient interface that provides access to: diff --git a/src/main/java/com/destroystokyo/paper/network/NetworkClient.java b/src/main/java/com/destroystokyo/paper/network/NetworkClient.java new file mode 100644 -index 0000000000000000000000000000000000000000..7b2af1bd72dfbcf4e962a982940fc49b851aa04f +index 0000000000000000000000000000000000000000..c84ce3fc874eea3d8f0b1cf5273996d9b4af6225 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/network/NetworkClient.java -@@ -0,0 +1,41 @@ +@@ -0,0 +1,39 @@ +package com.destroystokyo.paper.network; + +import java.net.InetSocketAddress; -+ -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Represents a client connected to the server. + */ ++@NullMarked +public interface NetworkClient { + + /** @@ -32,7 +32,6 @@ index 0000000000000000000000000000000000000000..7b2af1bd72dfbcf4e962a982940fc49b + * + * @return The client's socket address + */ -+ @NotNull + InetSocketAddress getAddress(); + + /** @@ -52,8 +51,7 @@ index 0000000000000000000000000000000000000000..7b2af1bd72dfbcf4e962a982940fc49b + * + * @return The client's virtual host, or {@code null} if unknown + */ -+ @Nullable -+ InetSocketAddress getVirtualHost(); ++ @Nullable InetSocketAddress getVirtualHost(); + +} diff --git a/src/main/java/org/bukkit/entity/Player.java b/src/main/java/org/bukkit/entity/Player.java diff --git a/patches/api/0076-PlayerPickupExperienceEvent.patch b/patches/api/0076-PlayerPickupExperienceEvent.patch index 9f4dfd145..0f6ff806c 100644 --- a/patches/api/0076-PlayerPickupExperienceEvent.patch +++ b/patches/api/0076-PlayerPickupExperienceEvent.patch @@ -7,10 +7,10 @@ Allows plugins to cancel a player picking up an experience orb diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerPickupExperienceEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerPickupExperienceEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..0ef10ac6bac990837e21520c800d89420a18e3d4 +index 0000000000000000000000000000000000000000..0c6ddf0724780245ad01a3b5a5b0e477c25fc62e --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerPickupExperienceEvent.java -@@ -0,0 +1,83 @@ +@@ -0,0 +1,81 @@ +/* + * Copyright (c) 2017 Daniel Ennis (Aikar) MIT License + * @@ -42,20 +42,21 @@ index 0000000000000000000000000000000000000000..0ef10ac6bac990837e21520c800d8942 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Fired when a player is attempting to pick up an experience orb + */ ++@NullMarked +public class PlayerPickupExperienceEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final ExperienceOrb experienceOrb; ++ private final ExperienceOrb experienceOrb; + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerPickupExperienceEvent(@NotNull Player player, @NotNull ExperienceOrb experienceOrb) { ++ public PlayerPickupExperienceEvent(final Player player, final ExperienceOrb experienceOrb) { + super(player); + this.experienceOrb = experienceOrb; + } @@ -63,7 +64,6 @@ index 0000000000000000000000000000000000000000..0ef10ac6bac990837e21520c800d8942 + /** + * @return Returns the Orb that the player is picking up + */ -+ @NotNull + public ExperienceOrb getExperienceOrb() { + return this.experienceOrb; + } @@ -79,17 +79,15 @@ index 0000000000000000000000000000000000000000..0ef10ac6bac990837e21520c800d8942 + * If {@code true}, cancels picking up the experience orb, leaving it in the world + */ + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0082-Add-PlayerAdvancementCriterionGrantEvent.patch b/patches/api/0082-Add-PlayerAdvancementCriterionGrantEvent.patch index acab81b45..852e4d9d1 100644 --- a/patches/api/0082-Add-PlayerAdvancementCriterionGrantEvent.patch +++ b/patches/api/0082-Add-PlayerAdvancementCriterionGrantEvent.patch @@ -7,10 +7,10 @@ Co-authored-by: The456gamer diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerAdvancementCriterionGrantEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerAdvancementCriterionGrantEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..9502f94b3567fc22c4b61fea5aa251d738dde7ae +index 0000000000000000000000000000000000000000..0fb316e34ec9728610237a08f37fffb61fd5afa8 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerAdvancementCriterionGrantEvent.java -@@ -0,0 +1,84 @@ +@@ -0,0 +1,80 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.advancement.Advancement; @@ -20,24 +20,25 @@ index 0000000000000000000000000000000000000000..9502f94b3567fc22c4b61fea5aa251d7 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called after a player is granted a criteria in an advancement. + * If cancelled the criteria will be revoked. + */ ++@NullMarked +public class PlayerAdvancementCriterionGrantEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final Advancement advancement; -+ @NotNull private final String criterion; -+ @NotNull private final AdvancementProgress advancementProgress; ++ private final Advancement advancement; ++ private final String criterion; ++ private final AdvancementProgress advancementProgress; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerAdvancementCriterionGrantEvent(@NotNull Player player, @NotNull Advancement advancement, @NotNull String criterion) { ++ public PlayerAdvancementCriterionGrantEvent(final Player player, final Advancement advancement, final String criterion) { + super(player); + this.advancement = advancement; + this.criterion = criterion; @@ -49,7 +50,6 @@ index 0000000000000000000000000000000000000000..9502f94b3567fc22c4b61fea5aa251d7 + * + * @return affected advancement + */ -+ @NotNull + public Advancement getAdvancement() { + return this.advancement; + } @@ -59,7 +59,6 @@ index 0000000000000000000000000000000000000000..9502f94b3567fc22c4b61fea5aa251d7 + * + * @return granted criterion + */ -+ @NotNull + public String getCriterion() { + return this.criterion; + } @@ -69,7 +68,6 @@ index 0000000000000000000000000000000000000000..9502f94b3567fc22c4b61fea5aa251d7 + * + * @return advancement progress + */ -+ @NotNull + public AdvancementProgress getAdvancementProgress() { + return this.advancementProgress; + } @@ -80,17 +78,15 @@ index 0000000000000000000000000000000000000000..9502f94b3567fc22c4b61fea5aa251d7 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0083-Fill-Profile-Property-Events.patch b/patches/api/0083-Fill-Profile-Property-Events.patch index 28d3b1fa0..137c383e9 100644 --- a/patches/api/0083-Fill-Profile-Property-Events.patch +++ b/patches/api/0083-Fill-Profile-Property-Events.patch @@ -12,10 +12,10 @@ This is useful for implementing a ProfileCache for Player Skulls diff --git a/src/main/java/com/destroystokyo/paper/event/profile/FillProfileEvent.java b/src/main/java/com/destroystokyo/paper/event/profile/FillProfileEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c97ded9f9ef1c550cca7d0a3a3b09a85e5999cdf +index 0000000000000000000000000000000000000000..8625d60eb822f39140152f2f74ec5bfe5ecd0039 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/profile/FillProfileEvent.java -@@ -0,0 +1,79 @@ +@@ -0,0 +1,75 @@ +/* + * Copyright (c) 2018 Daniel Ennis (Aikar) MIT License + * @@ -43,24 +43,24 @@ index 0000000000000000000000000000000000000000..c97ded9f9ef1c550cca7d0a3a3b09a85 + +import com.destroystokyo.paper.profile.PlayerProfile; +import com.destroystokyo.paper.profile.ProfileProperty; ++import java.util.Set; +import org.bukkit.event.Event; +import org.bukkit.event.HandlerList; -+ -+import java.util.Set; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Fired once a profiles additional properties (such as textures) has been filled + */ ++@NullMarked +public class FillProfileEvent extends Event { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final PlayerProfile profile; ++ private final PlayerProfile profile; + + @ApiStatus.Internal -+ public FillProfileEvent(@NotNull PlayerProfile profile) { ++ public FillProfileEvent(final PlayerProfile profile) { + super(!org.bukkit.Bukkit.isPrimaryThread()); + this.profile = profile; + } @@ -68,7 +68,6 @@ index 0000000000000000000000000000000000000000..c97ded9f9ef1c550cca7d0a3a3b09a85 + /** + * @return The Profile that had properties filled + */ -+ @NotNull + public PlayerProfile getPlayerProfile() { + return this.profile; + } @@ -76,31 +75,28 @@ index 0000000000000000000000000000000000000000..c97ded9f9ef1c550cca7d0a3a3b09a85 + /** + * Same as .getPlayerProfile().getProperties() + * -+ * @see PlayerProfile#getProperties() + * @return The new properties on the profile. ++ * @see PlayerProfile#getProperties() + */ -+ @NotNull + public Set getProperties() { + return this.profile.getProperties(); + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/src/main/java/com/destroystokyo/paper/event/profile/PreFillProfileEvent.java b/src/main/java/com/destroystokyo/paper/event/profile/PreFillProfileEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..e2a47c4af2c368a361e4a370a01111abe8e48062 +index 0000000000000000000000000000000000000000..177c23274d6dad709b05706117303b70ae8b4c7b --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/profile/PreFillProfileEvent.java -@@ -0,0 +1,81 @@ +@@ -0,0 +1,78 @@ +/* + * Copyright (c) 2018 Daniel Ennis (Aikar) MIT License + * @@ -128,26 +124,26 @@ index 0000000000000000000000000000000000000000..e2a47c4af2c368a361e4a370a01111ab + +import com.destroystokyo.paper.profile.PlayerProfile; +import com.destroystokyo.paper.profile.ProfileProperty; ++import java.util.Collection; +import org.bukkit.event.Event; +import org.bukkit.event.HandlerList; -+ -+import java.util.Collection; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Fired when the server is requesting to fill in properties of an incomplete profile, such as textures. + *

+ * Allows plugins to pre-populate cached properties and avoid a call to the Mojang API + */ ++@NullMarked +public class PreFillProfileEvent extends Event { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final PlayerProfile profile; ++ private final PlayerProfile profile; + + @ApiStatus.Internal -+ public PreFillProfileEvent(@NotNull PlayerProfile profile) { ++ public PreFillProfileEvent(final PlayerProfile profile) { + super(!org.bukkit.Bukkit.isPrimaryThread()); + this.profile = profile; + } @@ -155,7 +151,6 @@ index 0000000000000000000000000000000000000000..e2a47c4af2c368a361e4a370a01111ab + /** + * @return The profile that needs its properties filled + */ -+ @NotNull + public PlayerProfile getPlayerProfile() { + return this.profile; + } @@ -163,21 +158,19 @@ index 0000000000000000000000000000000000000000..e2a47c4af2c368a361e4a370a01111ab + /** + * Sets the properties on the profile, avoiding the call to the Mojang API + * Same as .getPlayerProfile().setProperties(properties); -+ * -+ * @see PlayerProfile#setProperties(Collection) ++ * + * @param properties The properties to set/append ++ * @see PlayerProfile#setProperties(Collection) + */ -+ public void setProperties(@NotNull Collection properties) { ++ public void setProperties(final Collection properties) { + this.profile.setProperties(properties); + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0091-Add-legacy-ping-support-to-PaperServerListPingEvent.patch b/patches/api/0091-Add-legacy-ping-support-to-PaperServerListPingEvent.patch index f21c76614..96ed5420a 100644 --- a/patches/api/0091-Add-legacy-ping-support-to-PaperServerListPingEvent.patch +++ b/patches/api/0091-Add-legacy-ping-support-to-PaperServerListPingEvent.patch @@ -8,7 +8,7 @@ client that does not support all of the features provided in the event. diff --git a/src/main/java/com/destroystokyo/paper/network/StatusClient.java b/src/main/java/com/destroystokyo/paper/network/StatusClient.java -index 517d15238ed117f38bbd39f570874014cecf7bb5..ffda9f6a8b094942009aa78b331d22d9dcca2802 100644 +index 517d15238ed117f38bbd39f570874014cecf7bb5..a8437bbd80b3a20772352a3b1797990ea13806ad 100644 --- a/src/main/java/com/destroystokyo/paper/network/StatusClient.java +++ b/src/main/java/com/destroystokyo/paper/network/StatusClient.java @@ -10,4 +10,16 @@ import com.destroystokyo.paper.event.server.PaperServerListPingEvent; @@ -17,7 +17,7 @@ index 517d15238ed117f38bbd39f570874014cecf7bb5..ffda9f6a8b094942009aa78b331d22d9 + /** + * Returns whether the client is using an older version that doesn't -+ * support all of the features in {@link PaperServerListPingEvent}. ++ * support all the features in {@link PaperServerListPingEvent}. + * + *

For Vanilla, this returns {@code true} for all clients older than 1.7.

+ * diff --git a/patches/api/0098-Expand-World.spawnParticle-API-and-add-Builder.patch b/patches/api/0098-Expand-World.spawnParticle-API-and-add-Builder.patch index 1ba1794b5..884983b69 100644 --- a/patches/api/0098-Expand-World.spawnParticle-API-and-add-Builder.patch +++ b/patches/api/0098-Expand-World.spawnParticle-API-and-add-Builder.patch @@ -10,46 +10,45 @@ This adds a new Builder API which is much friendlier to use. diff --git a/src/main/java/com/destroystokyo/paper/ParticleBuilder.java b/src/main/java/com/destroystokyo/paper/ParticleBuilder.java new file mode 100644 -index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c769aca67e +index 0000000000000000000000000000000000000000..6c405755f4507d6fbc6c3877c611a7191206f3ff --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/ParticleBuilder.java -@@ -0,0 +1,609 @@ +@@ -0,0 +1,582 @@ +package com.destroystokyo.paper; + +import com.google.common.base.Preconditions; +import com.google.common.collect.Lists; +import it.unimi.dsi.fastutil.objects.ObjectArrayList; ++import java.util.Collection; ++import java.util.List; +import org.bukkit.Color; +import org.bukkit.Location; +import org.bukkit.Particle; +import org.bukkit.World; +import org.bukkit.entity.Player; +import org.bukkit.util.NumberConversions; -+ -+import java.util.Collection; -+import java.util.List; -+import org.jetbrains.annotations.Contract; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Helps prepare a particle to be sent to players. -+ * ++ *

+ * Usage of the builder is preferred over the super long {@link World#spawnParticle(Particle, Location, int, double, double, double, double, Object)} API + */ ++@NullMarked +public class ParticleBuilder implements Cloneable { + + private Particle particle; -+ private List receivers; -+ private Player source; -+ private Location location; ++ private @Nullable List receivers; ++ private @Nullable Player source; ++ private @Nullable Location location; + private int count = 1; + private double offsetX = 0, offsetY = 0, offsetZ = 0; + private double extra = 1; -+ private Object data; ++ private @Nullable Object data; + private boolean force = true; + -+ public ParticleBuilder(@NotNull Particle particle) { ++ public ParticleBuilder(final Particle particle) { + this.particle = particle; + } + @@ -59,14 +58,14 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * + * @return a reference to this object. + */ -+ @NotNull + public ParticleBuilder spawn() { + if (this.location == null) { + throw new IllegalStateException("Please specify location for this particle"); + } -+ location.getWorld().spawnParticle(particle, receivers, source, -+ location.getX(), location.getY(), location.getZ(), -+ count, offsetX, offsetY, offsetZ, extra, data, force ++ this.location.getWorld().spawnParticle( ++ this.particle, this.receivers, this.source, ++ this.location.getX(), this.location.getY(), this.location.getZ(), ++ this.count, this.offsetX, this.offsetY, this.offsetZ, this.extra, this.data, this.force + ); + return this; + } @@ -74,9 +73,8 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + /** + * @return The particle going to be sent + */ -+ @NotNull + public Particle particle() { -+ return particle; ++ return this.particle; + } + + /** @@ -85,8 +83,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param particle The particle + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder particle(@NotNull Particle particle) { ++ public ParticleBuilder particle(final Particle particle) { + this.particle = particle; + return this; + } @@ -94,32 +91,30 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + /** + * @return List of players who will receive the particle, or null for all in world + */ -+ @Nullable -+ public List receivers() { -+ return receivers; ++ public @Nullable List receivers() { ++ return this.receivers; + } + + /** + * Example use: -+ * ++ *

+ * builder.receivers(16); if (builder.hasReceivers()) { sendParticleAsync(builder); } + * + * @return If this particle is going to be sent to someone + */ + public boolean hasReceivers() { -+ return (receivers == null && !location.getWorld().getPlayers().isEmpty()) || ( -+ receivers != null && !receivers.isEmpty()); ++ return (this.receivers == null && this.location != null && !this.location.getWorld().getPlayers().isEmpty()) || ( ++ this.receivers != null && !this.receivers.isEmpty()); + } + + /** -+ * Sends this particle to all players in the world. This is rather silly and you should likely not ++ * Sends this particle to all players in the world. This is rather silly, and you should likely not + * be doing this. -+ * ++ *

+ * Just be a logical person and use receivers by radius or collection. + * + * @return a reference to this object. + */ -+ @NotNull + public ParticleBuilder allPlayers() { + this.receivers = null; + return this; @@ -127,11 +122,10 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + + /** + * @param receivers List of players to receive this particle, or null for all players in the -+ * world ++ * world + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder receivers(@Nullable List receivers) { ++ public ParticleBuilder receivers(final @Nullable List receivers) { + // Had to keep this as we first made API List<> and not Collection, but removing this may break plugins compiled on older jars + // TODO: deprecate? + this.receivers = receivers != null ? Lists.newArrayList(receivers) : null; @@ -140,22 +134,20 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + + /** + * @param receivers List of players to receive this particle, or null for all players in the -+ * world ++ * world + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder receivers(@Nullable Collection receivers) { ++ public ParticleBuilder receivers(final @Nullable Collection receivers) { + this.receivers = receivers != null ? Lists.newArrayList(receivers) : null; + return this; + } + + /** -+ * @param receivers List of players to be receive this particle, or null for all players in the -+ * world ++ * @param receivers List of players to receive this particle, or null for all players in the ++ * world + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder receivers(@Nullable Player... receivers) { ++ public ParticleBuilder receivers(final Player @Nullable... receivers) { + this.receivers = receivers != null ? Lists.newArrayList(receivers) : null; + return this; + } @@ -168,9 +160,8 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param radius amount to add on all axis + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder receivers(int radius) { -+ return receivers(radius, radius); ++ public ParticleBuilder receivers(final int radius) { ++ return this.receivers(radius, radius); + } + + /** @@ -178,22 +169,24 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * false, behavior uses cuboid selection the same as {@link #receivers(int, int)} If byDistance is + * true, radius is tested by distance in a spherical shape + * -+ * @param radius amount to add on each axis ++ * @param radius amount to add on each axis + * @param byDistance true to use a spherical radius, false to use a cuboid + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder receivers(int radius, boolean byDistance) { ++ public ParticleBuilder receivers(final int radius, final boolean byDistance) { + if (!byDistance) { -+ return receivers(radius, radius, radius); ++ return this.receivers(radius, radius, radius); + } else { ++ if (this.location == null) { ++ throw new IllegalStateException("Please set location first"); ++ } + this.receivers = Lists.newArrayList(); -+ for (Player nearbyPlayer : location.getWorld() -+ .getNearbyPlayers(location, radius, radius, radius)) { -+ Location loc = nearbyPlayer.getLocation(); -+ double x = NumberConversions.square(location.getX() - loc.getX()); -+ double y = NumberConversions.square(location.getY() - loc.getY()); -+ double z = NumberConversions.square(location.getZ() - loc.getZ()); ++ for (final Player nearbyPlayer : this.location.getWorld() ++ .getNearbyPlayers(this.location, radius, radius, radius)) { ++ final Location loc = nearbyPlayer.getLocation(); ++ final double x = NumberConversions.square(this.location.getX() - loc.getX()); ++ final double y = NumberConversions.square(this.location.getY() - loc.getY()); ++ final double z = NumberConversions.square(this.location.getZ() - loc.getZ()); + if (Math.sqrt(x + y + z) > radius) { + continue; + } @@ -210,12 +203,11 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * see {@link #receivers(int, boolean)} + * + * @param xzRadius amount to add on the x/z axis -+ * @param yRadius amount to add on the y axis ++ * @param yRadius amount to add on the y axis + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder receivers(int xzRadius, int yRadius) { -+ return receivers(xzRadius, yRadius, xzRadius); ++ public ParticleBuilder receivers(final int xzRadius, final int yRadius) { ++ return this.receivers(xzRadius, yRadius, xzRadius); + } + + /** @@ -223,25 +215,28 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * false, behavior uses cuboid selection the same as {@link #receivers(int, int)} If byDistance is + * true, radius is tested by distance on the y plane and on the x/z plane, in a cylinder shape. + * -+ * @param xzRadius amount to add on the x/z axis -+ * @param yRadius amount to add on the y axis ++ * @param xzRadius amount to add on the x/z axis ++ * @param yRadius amount to add on the y axis + * @param byDistance true to use a cylinder shape, false to use cuboid + * @return a reference to this object. ++ * @throws IllegalStateException if a location hasn't been specified yet + */ -+ @NotNull -+ public ParticleBuilder receivers(int xzRadius, int yRadius, boolean byDistance) { ++ public ParticleBuilder receivers(final int xzRadius, final int yRadius, final boolean byDistance) { + if (!byDistance) { -+ return receivers(xzRadius, yRadius, xzRadius); ++ return this.receivers(xzRadius, yRadius, xzRadius); + } else { ++ if (this.location == null) { ++ throw new IllegalStateException("Please set location first"); ++ } + this.receivers = Lists.newArrayList(); -+ for (Player nearbyPlayer : location.getWorld() -+ .getNearbyPlayers(location, xzRadius, yRadius, xzRadius)) { -+ Location loc = nearbyPlayer.getLocation(); ++ for (final Player nearbyPlayer : this.location.getWorld() ++ .getNearbyPlayers(this.location, xzRadius, yRadius, xzRadius)) { ++ final Location loc = nearbyPlayer.getLocation(); + if (Math.abs(loc.getY() - this.location.getY()) > yRadius) { + continue; + } -+ double x = NumberConversions.square(location.getX() - loc.getX()); -+ double z = NumberConversions.square(location.getZ() - loc.getZ()); ++ final double x = NumberConversions.square(this.location.getX() - loc.getX()); ++ final double z = NumberConversions.square(this.location.getZ() - loc.getZ()); + if (x + z > NumberConversions.square(xzRadius)) { + continue; + } @@ -261,20 +256,18 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param zRadius amount to add on the z axis + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder receivers(int xRadius, int yRadius, int zRadius) { -+ if (location == null) { ++ public ParticleBuilder receivers(final int xRadius, final int yRadius, final int zRadius) { ++ if (this.location == null) { + throw new IllegalStateException("Please set location first"); + } -+ return receivers(location.getWorld().getNearbyPlayers(location, xRadius, yRadius, zRadius)); ++ return this.receivers(this.location.getWorld().getNearbyPlayers(this.location, xRadius, yRadius, zRadius)); + } + + /** + * @return The player considered the source of this particle (for Visibility concerns), or null + */ -+ @Nullable -+ public Player source() { -+ return source; ++ public @Nullable Player source() { ++ return this.source; + } + + /** @@ -283,8 +276,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param source The player who is considered the source + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder source(@Nullable Player source) { ++ public ParticleBuilder source(final @Nullable Player source) { + this.source = source; + return this; + } @@ -292,9 +284,8 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + /** + * @return Location of where the particle will spawn + */ -+ @Nullable -+ public Location location() { -+ return location; ++ public @Nullable Location location() { ++ return this.location; + } + + /** @@ -303,8 +294,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param location The location of the particle + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder location(@NotNull Location location) { ++ public ParticleBuilder location(final Location location) { + this.location = location.clone(); + return this; + } @@ -313,13 +303,12 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * Sets the location of where to spawn the particle + * + * @param world World to spawn particle in -+ * @param x X location -+ * @param y Y location -+ * @param z Z location ++ * @param x X location ++ * @param y Y location ++ * @param z Z location + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder location(@NotNull World world, double x, double y, double z) { ++ public ParticleBuilder location(final World world, final double x, final double y, final double z) { + this.location = new Location(world, x, y, z); + return this; + } @@ -328,7 +317,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @return Number of particles to spawn + */ + public int count() { -+ return count; ++ return this.count; + } + + /** @@ -337,8 +326,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param count Number of particles + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder count(int count) { ++ public ParticleBuilder count(final int count) { + this.count = count; + return this; + } @@ -349,7 +337,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @return Particle offset X. + */ + public double offsetX() { -+ return offsetX; ++ return this.offsetX; + } + + /** @@ -358,7 +346,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @return Particle offset Y. + */ + public double offsetY() { -+ return offsetY; ++ return this.offsetY; + } + + /** @@ -367,7 +355,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @return Particle offset Z. + */ + public double offsetZ() { -+ return offsetZ; ++ return this.offsetZ; + } + + /** @@ -378,8 +366,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param offsetZ Particle offset Z + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder offset(double offsetX, double offsetY, double offsetZ) { ++ public ParticleBuilder offset(final double offsetX, final double offsetY, final double offsetZ) { + this.offsetX = offsetX; + this.offsetY = offsetY; + this.offsetZ = offsetZ; @@ -392,7 +379,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @return the extra particle data + */ + public double extra() { -+ return extra; ++ return this.extra; + } + + /** @@ -401,8 +388,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param extra the extra particle data + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder extra(double extra) { ++ public ParticleBuilder extra(final double extra) { + this.extra = extra; + return this; + } @@ -413,21 +399,19 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param The Particle data type + * @return the ParticleData for this particle + */ -+ @Nullable -+ public T data() { ++ public @Nullable T data() { + //noinspection unchecked -+ return (T) data; ++ return (T) this.data; + } + + /** + * Sets the particle custom data. Varies by particle on how this is used + * + * @param data The new particle data -+ * @param The Particle data type ++ * @param The Particle data type + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder data(@Nullable T data) { ++ public ParticleBuilder data(final @Nullable T data) { + this.data = data; + return this; + } @@ -436,7 +420,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @return whether the particle is forcefully shown to players. + */ + public boolean force() { -+ return force; ++ return this.force; + } + + /** @@ -447,8 +431,7 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param force true to force, false for normal + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder force(boolean force) { ++ public ParticleBuilder force(final boolean force) { + this.force = force; + return this; + } @@ -460,12 +443,11 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param color the new particle color + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder color(@Nullable Color color) { -+ if (particle.getDataType() == Color.class) { -+ return data(color); ++ public ParticleBuilder color(final @Nullable Color color) { ++ if (this.particle.getDataType() == Color.class) { ++ return this.data(color); + } -+ return color(color, 1); ++ return this.color(color, 1); + } + + /** @@ -473,25 +455,24 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * Only valid for particles with a data type of {@link Particle.DustOptions}. + * + * @param color the new particle color -+ * @param size the size of the particle ++ * @param size the size of the particle + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder color(@Nullable Color color, float size) { -+ if (particle.getDataType() != Particle.DustOptions.class && color != null) { ++ public ParticleBuilder color(final @Nullable Color color, final float size) { ++ if (this.particle.getDataType() != Particle.DustOptions.class && color != null) { + throw new IllegalStateException("The combination of Color and size cannot be set on this particle type."); + } + + // We don't officially support reusing these objects, but here we go + if (color == null) { -+ if (data instanceof Particle.DustOptions) { -+ return data(null); ++ if (this.data instanceof Particle.DustOptions) { ++ return this.data(null); + } else { + return this; + } + } + -+ return data(new Particle.DustOptions(color, size)); ++ return this.data(new Particle.DustOptions(color, size)); + } + + /** @@ -503,9 +484,8 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param b blue color component + * @return a reference to this object. + */ -+ @NotNull -+ public ParticleBuilder color(int r, int g, int b) { -+ return color(Color.fromRGB(r, g, b)); ++ public ParticleBuilder color(final int r, final int g, final int b) { ++ return this.color(Color.fromRGB(r, g, b)); + } + + /** @@ -519,13 +499,12 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * the color is treated as RGB. Otherwise, it is treated as ARGB. + * @return a reference to this object. + */ -+ @NotNull + public ParticleBuilder color(final int color) { -+ int alpha = (color >> 24) & 0xFF; ++ final int alpha = (color >> 24) & 0xFF; + if (alpha == 0) { -+ return color(Color.fromRGB(color)); ++ return this.color(Color.fromRGB(color)); + } -+ return color(Color.fromARGB(color)); ++ return this.color(Color.fromARGB(color)); + } + + /** @@ -538,9 +517,8 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * @param b blue color component + * @return a reference to this object. + */ -+ @NotNull + public ParticleBuilder color(final int a, final int r, final int g, final int b) { -+ return color(Color.fromARGB(a, r, g, b)); ++ return this.color(Color.fromARGB(a, r, g, b)); + } + + /** @@ -548,69 +526,64 @@ index 0000000000000000000000000000000000000000..970084a788ab5547d16a5e08d4e9d9c7 + * Only valid for {@link Particle#DUST_COLOR_TRANSITION}. + * + * @param fromColor the new particle from color -+ * @param toColor the new particle to color ++ * @param toColor the new particle to color + * @return a reference to this object. + * @throws IllegalArgumentException if the particle builder's {@link #particle()} isn't {@link Particle#DUST_COLOR_TRANSITION}. + */ -+ @NotNull -+ public ParticleBuilder colorTransition(@NotNull final Color fromColor, @NotNull final Color toColor) { -+ return colorTransition(fromColor, toColor, 1); ++ public ParticleBuilder colorTransition(final Color fromColor, final Color toColor) { ++ return this.colorTransition(fromColor, toColor, 1); + } + + /** + * Sets the particle Color Transition. + * Only valid for {@link Particle#DUST_COLOR_TRANSITION}. + * -+ * @param fromRed red color component for the from color -+ * @param fromGreen green color component for the from color -+ * @param fromBlue blue color component for the from color -+ * @param toRed red color component for the to color -+ * @param toGreen green color component for the to color -+ * @param toBlue blue color component for the to color ++ * @param fromRed red color component for the "from" color ++ * @param fromGreen green color component for the "from" color ++ * @param fromBlue blue color component for the "from" color ++ * @param toRed red color component for the to color ++ * @param toGreen green color component for the to color ++ * @param toBlue blue color component for the to color + * @return a reference to this object. + * @throws IllegalArgumentException if the particle builder's {@link #particle()} isn't {@link Particle#DUST_COLOR_TRANSITION}. + */ -+ @NotNull -+ public ParticleBuilder colorTransition(final int fromRed, final int fromGreen, final int fromBlue, -+ final int toRed, final int toGreen, final int toBlue) { -+ return colorTransition(Color.fromRGB(fromRed, fromGreen, fromBlue), Color.fromRGB(toRed, toGreen, toBlue)); ++ public ParticleBuilder colorTransition( ++ final int fromRed, final int fromGreen, final int fromBlue, ++ final int toRed, final int toGreen, final int toBlue ++ ) { ++ return this.colorTransition(Color.fromRGB(fromRed, fromGreen, fromBlue), Color.fromRGB(toRed, toGreen, toBlue)); + } + + /** + * Sets the particle Color Transition. + * Only valid for {@link Particle#DUST_COLOR_TRANSITION}. + * -+ * @param fromRgb an integer representing the red, green, and blue color components for the from color -+ * @param toRgb an integer representing the red, green, and blue color components for the to color ++ * @param fromRgb an integer representing the red, green, and blue color components for the "from" color ++ * @param toRgb an integer representing the red, green, and blue color components for the "to" color + * @return a reference to this object. + * @throws IllegalArgumentException if the particle builder's {@link #particle()} isn't {@link Particle#DUST_COLOR_TRANSITION}. + */ -+ @NotNull + public ParticleBuilder colorTransition(final int fromRgb, final int toRgb) { -+ return colorTransition(Color.fromRGB(fromRgb), Color.fromRGB(toRgb)); ++ return this.colorTransition(Color.fromRGB(fromRgb), Color.fromRGB(toRgb)); + } + + /** + * Sets the particle Color Transition and size. + * Only valid for {@link Particle#DUST_COLOR_TRANSITION}. + * -+ * @param fromColor the new particle color for the from color. -+ * @param toColor the new particle color for the to color. -+ * @param size the size of the particle ++ * @param fromColor the new particle color for the "from" color. ++ * @param toColor the new particle color for the "to" color. ++ * @param size the size of the particle + * @return a reference to this object. + * @throws IllegalArgumentException if the particle builder's {@link #particle()} isn't {@link Particle#DUST_COLOR_TRANSITION}. + */ -+ @NotNull -+ public ParticleBuilder colorTransition(@NotNull final Color fromColor, -+ @NotNull final Color toColor, -+ final float size) { ++ public ParticleBuilder colorTransition(final Color fromColor, final Color toColor, final float size) { + Preconditions.checkArgument(fromColor != null, "Cannot define color transition with null fromColor."); + Preconditions.checkArgument(toColor != null, "Cannot define color transition with null toColor."); + Preconditions.checkArgument(this.particle() == Particle.DUST_COLOR_TRANSITION, "Can only define a color transition on particle DUST_COLOR_TRANSITION."); -+ return data(new Particle.DustTransition(fromColor, toColor, size)); ++ return this.data(new Particle.DustTransition(fromColor, toColor, size)); + } + -+ @NotNull + @Override + public ParticleBuilder clone() { + try { diff --git a/patches/api/0099-EndermanAttackPlayerEvent.patch b/patches/api/0099-EndermanAttackPlayerEvent.patch index 25dc5e0c3..f3abe83e8 100644 --- a/patches/api/0099-EndermanAttackPlayerEvent.patch +++ b/patches/api/0099-EndermanAttackPlayerEvent.patch @@ -9,10 +9,10 @@ This allows you to override/extend the pumpkin/stare logic. diff --git a/src/main/java/com/destroystokyo/paper/event/entity/EndermanAttackPlayerEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/EndermanAttackPlayerEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..b261e0420002da3f94862e664edc65536cd05fc8 +index 0000000000000000000000000000000000000000..34adc77de2d1f06b2b10cc26b60240c6a3ef259c --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/EndermanAttackPlayerEvent.java -@@ -0,0 +1,98 @@ +@@ -0,0 +1,99 @@ +/* + * Copyright (c) 2018 Daniel Ennis (Aikar) MIT License + * @@ -103,6 +103,7 @@ index 0000000000000000000000000000000000000000..b261e0420002da3f94862e664edc6553 + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0100-WitchConsumePotionEvent.patch b/patches/api/0100-WitchConsumePotionEvent.patch index 3d69f2e14..3dd9e13ca 100644 --- a/patches/api/0100-WitchConsumePotionEvent.patch +++ b/patches/api/0100-WitchConsumePotionEvent.patch @@ -7,10 +7,10 @@ Fires when a witch consumes the potion in their hand diff --git a/src/main/java/com/destroystokyo/paper/event/entity/WitchConsumePotionEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/WitchConsumePotionEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..6476501ff3299686a059bb75a8ff2424db0cc7f8 +index 0000000000000000000000000000000000000000..43ee765dedf5001fadf1af317b6ab323fde34851 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/WitchConsumePotionEvent.java -@@ -0,0 +1,70 @@ +@@ -0,0 +1,71 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.entity.Witch; @@ -73,6 +73,7 @@ index 0000000000000000000000000000000000000000..6476501ff3299686a059bb75a8ff2424 + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0110-PlayerReadyArrowEvent.patch b/patches/api/0110-PlayerReadyArrowEvent.patch index 95ee02ac1..3c432ede0 100644 --- a/patches/api/0110-PlayerReadyArrowEvent.patch +++ b/patches/api/0110-PlayerReadyArrowEvent.patch @@ -8,10 +8,10 @@ Plugins can skip selection of certain arrows and control which is used. diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerReadyArrowEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerReadyArrowEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..f30c4c372c92a79fb6c3fe80c4b51b5c8c0d4d3b +index 0000000000000000000000000000000000000000..3eadfae8860a4f6cde107cc3c7048368ade29d28 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerReadyArrowEvent.java -@@ -0,0 +1,94 @@ +@@ -0,0 +1,92 @@ +/* + * Copyright (c) 2018 Daniel Ennis (Aikar) MIT License + * @@ -42,21 +42,22 @@ index 0000000000000000000000000000000000000000..f30c4c372c92a79fb6c3fe80c4b51b5c +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.ItemStack; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player is firing a bow and the server is choosing an arrow to use. + */ ++@NullMarked +public class PlayerReadyArrowEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final ItemStack bow; -+ @NotNull private final ItemStack arrow; ++ private final ItemStack bow; ++ private final ItemStack arrow; + + private boolean cancelled; + -+ public PlayerReadyArrowEvent(@NotNull Player player, @NotNull ItemStack bow, @NotNull ItemStack arrow) { ++ public PlayerReadyArrowEvent(final Player player, final ItemStack bow, final ItemStack arrow) { + super(player); + this.bow = bow; + this.arrow = arrow; @@ -65,7 +66,6 @@ index 0000000000000000000000000000000000000000..f30c4c372c92a79fb6c3fe80c4b51b5c + /** + * @return the player is using to fire the arrow + */ -+ @NotNull + public ItemStack getBow() { + return this.bow; + } @@ -73,7 +73,6 @@ index 0000000000000000000000000000000000000000..f30c4c372c92a79fb6c3fe80c4b51b5c + /** + * @return the arrow that is attempting to be used + */ -+ @NotNull + public ItemStack getArrow() { + return this.arrow; + } @@ -92,16 +91,15 @@ index 0000000000000000000000000000000000000000..f30c4c372c92a79fb6c3fe80c4b51b5c + * Cancel use of this arrow. On cancel, the server will try the next arrow available and fire another event. + */ + @Override -+ public void setCancelled(boolean cancel) { -+ this.cancelled = cancel; ++ public void setCancelled(final boolean cancel) { ++ this.cancelled = cancel; + } + -+ @NotNull ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0115-RangedEntity-API.patch b/patches/api/0115-RangedEntity-API.patch index db1b32cc9..087c06057 100644 --- a/patches/api/0115-RangedEntity-API.patch +++ b/patches/api/0115-RangedEntity-API.patch @@ -8,16 +8,17 @@ and to perform an attack. diff --git a/src/main/java/com/destroystokyo/paper/entity/RangedEntity.java b/src/main/java/com/destroystokyo/paper/entity/RangedEntity.java new file mode 100644 -index 0000000000000000000000000000000000000000..46e0e62d620def237dab44ad24708f1b93a8a1a7 +index 0000000000000000000000000000000000000000..09c82908f63233febfe1e07fe756f1c39d23d44f --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/entity/RangedEntity.java -@@ -0,0 +1,35 @@ +@@ -0,0 +1,36 @@ +package com.destroystokyo.paper.entity; + +import org.bukkit.entity.LivingEntity; +import org.bukkit.entity.Mob; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public interface RangedEntity extends Mob { + /** + * Attack the specified entity using a ranged attack. @@ -26,7 +27,7 @@ index 0000000000000000000000000000000000000000..46e0e62d620def237dab44ad24708f1b + * @param charge How "charged" the attack is (how far back the bow was pulled for Bow attacks). + * This should be a value between 0 and 1, represented as targetDistance/maxDistance. + */ -+ void rangedAttack(@NotNull LivingEntity target, float charge); ++ void rangedAttack(LivingEntity target, float charge); + + /** + * Sets that the Entity is "charging" up an attack, by raising its hands @@ -44,7 +45,7 @@ index 0000000000000000000000000000000000000000..46e0e62d620def237dab44ad24708f1b + */ + @Deprecated(since = "1.19.2") + default boolean isChargingAttack() { -+ return isHandRaised(); ++ return this.isHandRaised(); + } +} diff --git a/src/main/java/org/bukkit/entity/AbstractSkeleton.java b/src/main/java/org/bukkit/entity/AbstractSkeleton.java diff --git a/patches/api/0120-EnderDragon-Events.patch b/patches/api/0120-EnderDragon-Events.patch index cb35387c0..510edc18b 100644 --- a/patches/api/0120-EnderDragon-Events.patch +++ b/patches/api/0120-EnderDragon-Events.patch @@ -86,10 +86,10 @@ index 0000000000000000000000000000000000000000..242eb9c07866365568c036819be2b4f8 +} diff --git a/src/main/java/com/destroystokyo/paper/event/entity/EnderDragonFlameEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/EnderDragonFlameEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..0d6409e3198e57dfa479abb6fee28d6028e13e2d +index 0000000000000000000000000000000000000000..47cf33ef97ce1b92bc13c4d3a6c49d050e344eb1 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/EnderDragonFlameEvent.java -@@ -0,0 +1,60 @@ +@@ -0,0 +1,61 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.entity.AreaEffectCloud; @@ -142,6 +142,7 @@ index 0000000000000000000000000000000000000000..0d6409e3198e57dfa479abb6fee28d60 + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0121-PlayerElytraBoostEvent.patch b/patches/api/0121-PlayerElytraBoostEvent.patch index fb24f9dbb..b17cf589a 100644 --- a/patches/api/0121-PlayerElytraBoostEvent.patch +++ b/patches/api/0121-PlayerElytraBoostEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] PlayerElytraBoostEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerElytraBoostEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerElytraBoostEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..9ebac41c22b8866df616020d409e5e1a49cddca5 +index 0000000000000000000000000000000000000000..7d41a5c2dc6ca659bfad41e70cbeac2349c2b0f3 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerElytraBoostEvent.java -@@ -0,0 +1,104 @@ +@@ -0,0 +1,99 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.entity.Firework; @@ -20,25 +20,25 @@ index 0000000000000000000000000000000000000000..9ebac41c22b8866df616020d409e5e1a +import org.bukkit.inventory.EquipmentSlot; +import org.bukkit.inventory.ItemStack; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Fired when a player boosts elytra flight with a firework + */ ++@NullMarked +public class PlayerElytraBoostEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final ItemStack itemStack; -+ @NotNull private final Firework firework; ++ private final ItemStack itemStack; ++ private final Firework firework; + private boolean consume = true; -+ @NotNull + private final EquipmentSlot hand; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerElytraBoostEvent(@NotNull Player player, @NotNull ItemStack itemStack, @NotNull Firework firework, @NotNull EquipmentSlot hand) { ++ public PlayerElytraBoostEvent(final Player player, final ItemStack itemStack, final Firework firework, final EquipmentSlot hand) { + super(player); + this.itemStack = itemStack; + this.firework = firework; @@ -50,7 +50,6 @@ index 0000000000000000000000000000000000000000..9ebac41c22b8866df616020d409e5e1a + * + * @return ItemStack of firework + */ -+ @NotNull + public ItemStack getItemStack() { + return this.itemStack; + } @@ -60,7 +59,6 @@ index 0000000000000000000000000000000000000000..9ebac41c22b8866df616020d409e5e1a + * + * @return Firework entity + */ -+ @NotNull + public Firework getFirework() { + return this.firework; + } @@ -79,7 +77,7 @@ index 0000000000000000000000000000000000000000..9ebac41c22b8866df616020d409e5e1a + * + * @param consume {@code true} to consume + */ -+ public void setShouldConsume(boolean consume) { ++ public void setShouldConsume(final boolean consume) { + this.consume = consume; + } + @@ -88,7 +86,6 @@ index 0000000000000000000000000000000000000000..9ebac41c22b8866df616020d409e5e1a + * + * @return interaction hand + */ -+ @NotNull + public EquipmentSlot getHand() { + return this.hand; + } @@ -99,17 +96,15 @@ index 0000000000000000000000000000000000000000..9ebac41c22b8866df616020d409e5e1a + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0122-PlayerLaunchProjectileEvent.patch b/patches/api/0122-PlayerLaunchProjectileEvent.patch index f284a611d..9078e566c 100644 --- a/patches/api/0122-PlayerLaunchProjectileEvent.patch +++ b/patches/api/0122-PlayerLaunchProjectileEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] PlayerLaunchProjectileEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerLaunchProjectileEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerLaunchProjectileEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..efd947eb0aa0633891d9c6a8bde66d33e29020d7 +index 0000000000000000000000000000000000000000..a6d483e6be8b8527d7cfd676f6056179e8e9bf33 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerLaunchProjectileEvent.java -@@ -0,0 +1,95 @@ +@@ -0,0 +1,92 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.entity.Player; @@ -20,7 +20,7 @@ index 0000000000000000000000000000000000000000..efd947eb0aa0633891d9c6a8bde66d33 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.ItemStack; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player shoots a projectile. @@ -29,18 +29,19 @@ index 0000000000000000000000000000000000000000..efd947eb0aa0633891d9c6a8bde66d33 + * of a bow or crossbow. A plugin may listen to {@link EntityShootBowEvent} + * for these actions instead. + */ ++@NullMarked +public class PlayerLaunchProjectileEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final Projectile projectile; -+ @NotNull private final ItemStack itemStack; ++ private final Projectile projectile; ++ private final ItemStack itemStack; + private boolean consumeItem = true; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerLaunchProjectileEvent(@NotNull Player shooter, @NotNull ItemStack itemStack, @NotNull Projectile projectile) { ++ public PlayerLaunchProjectileEvent(final Player shooter, final ItemStack itemStack, final Projectile projectile) { + super(shooter); + this.itemStack = itemStack; + this.projectile = projectile; @@ -51,7 +52,6 @@ index 0000000000000000000000000000000000000000..efd947eb0aa0633891d9c6a8bde66d33 + * + * @return the launched projectile + */ -+ @NotNull + public Projectile getProjectile() { + return this.projectile; + } @@ -61,7 +61,6 @@ index 0000000000000000000000000000000000000000..efd947eb0aa0633891d9c6a8bde66d33 + * + * @return The ItemStack used + */ -+ @NotNull + public ItemStack getItemStack() { + return this.itemStack; + } @@ -80,7 +79,7 @@ index 0000000000000000000000000000000000000000..efd947eb0aa0633891d9c6a8bde66d33 + * + * @param consumeItem {@code true} to consume + */ -+ public void setShouldConsume(boolean consumeItem) { ++ public void setShouldConsume(final boolean consumeItem) { + this.consumeItem = consumeItem; + } + @@ -90,17 +89,15 @@ index 0000000000000000000000000000000000000000..efd947eb0aa0633891d9c6a8bde66d33 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0127-AnvilDamageEvent.patch b/patches/api/0127-AnvilDamageEvent.patch index 303e7bd6f..2d984e06e 100644 --- a/patches/api/0127-AnvilDamageEvent.patch +++ b/patches/api/0127-AnvilDamageEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] AnvilDamageEvent diff --git a/src/main/java/com/destroystokyo/paper/event/block/AnvilDamagedEvent.java b/src/main/java/com/destroystokyo/paper/event/block/AnvilDamagedEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..456e2a638421b435ede4205d3eedfafeedb196c1 +index 0000000000000000000000000000000000000000..1472ecef11627d82f72911d86d579ad3bb365dca --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/block/AnvilDamagedEvent.java -@@ -0,0 +1,148 @@ +@@ -0,0 +1,149 @@ +package com.destroystokyo.paper.event.block; + +import org.bukkit.Material; @@ -95,6 +95,7 @@ index 0000000000000000000000000000000000000000..456e2a638421b435ede4205d3eedfafe + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0133-Slime-Pathfinder-Events.patch b/patches/api/0133-Slime-Pathfinder-Events.patch index d1b62510b..36e665a7d 100644 --- a/patches/api/0133-Slime-Pathfinder-Events.patch +++ b/patches/api/0133-Slime-Pathfinder-Events.patch @@ -53,10 +53,10 @@ index 0000000000000000000000000000000000000000..a5d4442b53c4bd70165c3240c7dbd3d5 +} diff --git a/src/main/java/com/destroystokyo/paper/event/entity/SlimePathfindEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/SlimePathfindEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..48963ce451c05f80ff13b4361e8aba196b629319 +index 0000000000000000000000000000000000000000..d481d116452fb5a702bc88a08da3c28cd0401a70 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/SlimePathfindEvent.java -@@ -0,0 +1,54 @@ +@@ -0,0 +1,56 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.entity.Slime; @@ -89,6 +89,7 @@ index 0000000000000000000000000000000000000000..48963ce451c05f80ff13b4361e8aba19 + * + * @return The Slime that is pathfinding. + */ ++ @Override + public Slime getEntity() { + return (Slime) super.getEntity(); + } @@ -103,6 +104,7 @@ index 0000000000000000000000000000000000000000..48963ce451c05f80ff13b4361e8aba19 + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0135-Add-More-Creeper-API.patch b/patches/api/0135-Add-More-Creeper-API.patch index 09a6c5d17..8e7c0d2ad 100644 --- a/patches/api/0135-Add-More-Creeper-API.patch +++ b/patches/api/0135-Add-More-Creeper-API.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add More Creeper API diff --git a/src/main/java/com/destroystokyo/paper/event/entity/CreeperIgniteEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/CreeperIgniteEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..0c2f4f257b03d00c0ef1c50fdba6beb790fc808d +index 0000000000000000000000000000000000000000..8b97cc830aa8bdb09dec3c4b8ebe4fb22d279f46 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/CreeperIgniteEvent.java -@@ -0,0 +1,58 @@ +@@ -0,0 +1,60 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.entity.Creeper; @@ -51,10 +51,12 @@ index 0000000000000000000000000000000000000000..0c2f4f257b03d00c0ef1c50fdba6beb7 + this.ignited = ignited; + } + ++ @Override + public boolean isCancelled() { + return this.cancelled; + } + ++ @Override + public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } diff --git a/patches/api/0143-Mob-Pathfinding-API.patch b/patches/api/0143-Mob-Pathfinding-API.patch index 1c0b6088a..63c4c6770 100644 --- a/patches/api/0143-Mob-Pathfinding-API.patch +++ b/patches/api/0143-Mob-Pathfinding-API.patch @@ -13,30 +13,28 @@ You can use EntityPathfindEvent to cancel new pathfinds from overriding your cur diff --git a/src/main/java/com/destroystokyo/paper/entity/Pathfinder.java b/src/main/java/com/destroystokyo/paper/entity/Pathfinder.java new file mode 100644 -index 0000000000000000000000000000000000000000..3c1e2c93d923a683cc0455af77c43784ef12270e +index 0000000000000000000000000000000000000000..5f6d6e222f9f1ac1648a11b6d4a240371c4f07e9 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/entity/Pathfinder.java -@@ -0,0 +1,220 @@ +@@ -0,0 +1,221 @@ +package com.destroystokyo.paper.entity; + ++import java.util.List; +import org.bukkit.Location; +import org.bukkit.entity.LivingEntity; +import org.bukkit.entity.Mob; -+ -+import java.util.List; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Handles pathfinding operations for an Entity + */ ++@NullMarked +public interface Pathfinder { + + /** -+ * + * @return The entity that is controlled by this pathfinder + */ -+ @NotNull + Mob getEntity(); + + /** @@ -46,6 +44,7 @@ index 0000000000000000000000000000000000000000..3c1e2c93d923a683cc0455af77c43784 + + /** + * If the entity is currently trying to navigate to a destination, this will return true ++ * + * @return true if the entity is navigating to a destination + */ + boolean hasPath(); @@ -53,86 +52,88 @@ index 0000000000000000000000000000000000000000..3c1e2c93d923a683cc0455af77c43784 + /** + * @return The location the entity is trying to navigate to, or null if there is no destination + */ -+ @Nullable -+ PathResult getCurrentPath(); ++ @Nullable PathResult getCurrentPath(); + + /** + * Calculates a destination for the Entity to navigate to, but does not set it + * as the current target. Useful for calculating what would happen before setting it. ++ * + * @param loc Location to navigate to + * @return The closest Location the Entity can get to for this navigation, or null if no path could be calculated + */ -+ @Nullable PathResult findPath(@NotNull Location loc); ++ @Nullable PathResult findPath(Location loc); + + /** + * Calculates a destination for the Entity to navigate to to reach the target entity, + * but does not set it as the current target. + * Useful for calculating what would happen before setting it. -+ * ++ *

+ * The behavior of this PathResult is subject to the games pathfinding rules, and may + * result in the pathfinding automatically updating to follow the target Entity. -+ * ++ *

+ * However, this behavior is not guaranteed, and is subject to the games behavior. + * + * @param target the Entity to navigate to + * @return The closest Location the Entity can get to for this navigation, or null if no path could be calculated + */ -+ @Nullable PathResult findPath(@NotNull LivingEntity target); ++ @Nullable PathResult findPath(LivingEntity target); + + /** + * Calculates a destination for the Entity to navigate to, and sets it with default speed + * as the current target. ++ * + * @param loc Location to navigate to + * @return If the pathfinding was successfully started + */ -+ default boolean moveTo(@NotNull Location loc) { -+ return moveTo(loc, 1); ++ default boolean moveTo(Location loc) { ++ return this.moveTo(loc, 1); + } + + /** + * Calculates a destination for the Entity to navigate to, with desired speed + * as the current target. -+ * @param loc Location to navigate to ++ * ++ * @param loc Location to navigate to + * @param speed Speed multiplier to navigate at, where 1 is 'normal' + * @return If the pathfinding was successfully started + */ -+ default boolean moveTo(@NotNull Location loc, double speed) { -+ PathResult path = findPath(loc); -+ return path != null && moveTo(path, speed); ++ default boolean moveTo(Location loc, double speed) { ++ PathResult path = this.findPath(loc); ++ return path != null && this.moveTo(path, speed); + } + + /** + * Calculates a destination for the Entity to navigate to to reach the target entity, + * and sets it with default speed. -+ * ++ *

+ * The behavior of this PathResult is subject to the games pathfinding rules, and may + * result in the pathfinding automatically updating to follow the target Entity. -+ * ++ *

+ * However, this behavior is not guaranteed, and is subject to the games behavior. + * + * @param target the Entity to navigate to + * @return If the pathfinding was successfully started + */ -+ default boolean moveTo(@NotNull LivingEntity target) { -+ return moveTo(target, 1); ++ default boolean moveTo(LivingEntity target) { ++ return this.moveTo(target, 1); + } + + /** + * Calculates a destination for the Entity to navigate to to reach the target entity, + * and sets it with specified speed. -+ * ++ *

+ * The behavior of this PathResult is subject to the games pathfinding rules, and may + * result in the pathfinding automatically updating to follow the target Entity. -+ * ++ *

+ * However, this behavior is not guaranteed, and is subject to the games behavior. + * + * @param target the Entity to navigate to -+ * @param speed Speed multiplier to navigate at, where 1 is 'normal' ++ * @param speed Speed multiplier to navigate at, where 1 is 'normal' + * @return If the pathfinding was successfully started + */ -+ default boolean moveTo(@NotNull LivingEntity target, double speed) { -+ PathResult path = findPath(target); -+ return path != null && moveTo(path, speed); ++ default boolean moveTo(LivingEntity target, double speed) { ++ PathResult path = this.findPath(target); ++ return path != null && this.moveTo(path, speed); + } + + /** @@ -142,19 +143,19 @@ index 0000000000000000000000000000000000000000..3c1e2c93d923a683cc0455af77c43784 + * @param path The Path to start following + * @return If the pathfinding was successfully started + */ -+ default boolean moveTo(@NotNull PathResult path) { -+ return moveTo(path, 1); ++ default boolean moveTo(PathResult path) { ++ return this.moveTo(path, 1); + } + + /** + * Takes the result of a previous pathfinding calculation and sets it + * as the active pathfinding, + * -+ * @param path The Path to start following ++ * @param path The Path to start following + * @param speed Speed multiplier to navigate at, where 1 is 'normal' + * @return If the pathfinding was successfully started + */ -+ boolean moveTo(@NotNull PathResult path, double speed); ++ boolean moveTo(PathResult path, double speed); + + /** + * Checks if this pathfinder allows passing through closed doors. @@ -205,11 +206,11 @@ index 0000000000000000000000000000000000000000..3c1e2c93d923a683cc0455af77c43784 + + /** + * All currently calculated points to follow along the path to reach the destination location -+ * ++ *

+ * Will return points the entity has already moved past, see {@link #getNextPointIndex()} ++ * + * @return List of points + */ -+ @NotNull + List getPoints(); + + /** diff --git a/patches/api/0151-Turtle-API.patch b/patches/api/0151-Turtle-API.patch index c15a3043f..1d29a1055 100644 --- a/patches/api/0151-Turtle-API.patch +++ b/patches/api/0151-Turtle-API.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Turtle API diff --git a/src/main/java/com/destroystokyo/paper/event/entity/TurtleGoHomeEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/TurtleGoHomeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..560b46b7b4fdd3394bc5e8fc917776a5838eba09 +index 0000000000000000000000000000000000000000..91cede0e53cf6f1089e549053ebc2e2b190a1aab --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/TurtleGoHomeEvent.java -@@ -0,0 +1,51 @@ +@@ -0,0 +1,53 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.entity.Turtle; @@ -39,6 +39,7 @@ index 0000000000000000000000000000000000000000..560b46b7b4fdd3394bc5e8fc917776a5 + * + * @return The turtle + */ ++ @Override + public Turtle getEntity() { + return (Turtle) super.getEntity(); + } @@ -53,6 +54,7 @@ index 0000000000000000000000000000000000000000..560b46b7b4fdd3394bc5e8fc917776a5 + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } @@ -63,10 +65,10 @@ index 0000000000000000000000000000000000000000..560b46b7b4fdd3394bc5e8fc917776a5 +} diff --git a/src/main/java/com/destroystokyo/paper/event/entity/TurtleLayEggEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/TurtleLayEggEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..d1b2bbb57280726690e704c5978d312d856243eb +index 0000000000000000000000000000000000000000..1492d168aa1dc538b732b0ff262074cc7c9900e6 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/TurtleLayEggEvent.java -@@ -0,0 +1,88 @@ +@@ -0,0 +1,90 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.Location; @@ -102,6 +104,7 @@ index 0000000000000000000000000000000000000000..d1b2bbb57280726690e704c5978d312d + * + * @return The turtle + */ ++ @Override + public Turtle getEntity() { + return (Turtle) super.getEntity(); + } @@ -147,6 +150,7 @@ index 0000000000000000000000000000000000000000..d1b2bbb57280726690e704c5978d312d + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } @@ -157,10 +161,10 @@ index 0000000000000000000000000000000000000000..d1b2bbb57280726690e704c5978d312d +} diff --git a/src/main/java/com/destroystokyo/paper/event/entity/TurtleStartDiggingEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/TurtleStartDiggingEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..4a53af5da307cd71e0e647917bec9be44136e6aa +index 0000000000000000000000000000000000000000..a84101fb1b478f3018f283bc47d3e73a7ae5bbc8 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/TurtleStartDiggingEvent.java -@@ -0,0 +1,63 @@ +@@ -0,0 +1,65 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.Location; @@ -193,6 +197,7 @@ index 0000000000000000000000000000000000000000..4a53af5da307cd71e0e647917bec9be4 + * + * @return The turtle + */ ++ @Override + public Turtle getEntity() { + return (Turtle) super.getEntity(); + } @@ -216,6 +221,7 @@ index 0000000000000000000000000000000000000000..4a53af5da307cd71e0e647917bec9be4 + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0152-Add-spectator-target-events.patch b/patches/api/0152-Add-spectator-target-events.patch index 90f65b5fc..ea32c2a4b 100644 --- a/patches/api/0152-Add-spectator-target-events.patch +++ b/patches/api/0152-Add-spectator-target-events.patch @@ -8,10 +8,10 @@ Subject: [PATCH] Add spectator target events diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerStartSpectatingEntityEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerStartSpectatingEntityEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..a70a64d2273414d95d77e601a41a208cce78e345 +index 0000000000000000000000000000000000000000..5ce2f30c094608cc547d2f2517f0ac2546bab85a --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerStartSpectatingEntityEvent.java -@@ -0,0 +1,71 @@ +@@ -0,0 +1,68 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.entity.Entity; @@ -20,22 +20,23 @@ index 0000000000000000000000000000000000000000..a70a64d2273414d95d77e601a41a208c +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Triggered when a player starts spectating an entity in spectator mode. + */ ++@NullMarked +public class PlayerStartSpectatingEntityEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final Entity currentSpectatorTarget; -+ @NotNull private final Entity newSpectatorTarget; ++ private final Entity currentSpectatorTarget; ++ private final Entity newSpectatorTarget; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerStartSpectatingEntityEvent(@NotNull Player player, @NotNull Entity currentSpectatorTarget, @NotNull Entity newSpectatorTarget) { ++ public PlayerStartSpectatingEntityEvent(final Player player, final Entity currentSpectatorTarget, final Entity newSpectatorTarget) { + super(player); + this.currentSpectatorTarget = currentSpectatorTarget; + this.newSpectatorTarget = newSpectatorTarget; @@ -46,7 +47,6 @@ index 0000000000000000000000000000000000000000..a70a64d2273414d95d77e601a41a208c + * + * @return The entity the player is currently spectating (before they start spectating the new target). + */ -+ @NotNull + public Entity getCurrentSpectatorTarget() { + return this.currentSpectatorTarget; + } @@ -56,7 +56,6 @@ index 0000000000000000000000000000000000000000..a70a64d2273414d95d77e601a41a208c + * + * @return The entity the player is now going to be spectating. + */ -+ @NotNull + public Entity getNewSpectatorTarget() { + return this.newSpectatorTarget; + } @@ -67,17 +66,15 @@ index 0000000000000000000000000000000000000000..a70a64d2273414d95d77e601a41a208c + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } @@ -85,10 +82,10 @@ index 0000000000000000000000000000000000000000..a70a64d2273414d95d77e601a41a208c + diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerStopSpectatingEntityEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerStopSpectatingEntityEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..a6a5ebc534cc380740ba42790149c8b85f52aabb +index 0000000000000000000000000000000000000000..ebda87b7914995a28abce844654ee4f5089c416e --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerStopSpectatingEntityEvent.java -@@ -0,0 +1,57 @@ +@@ -0,0 +1,55 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.entity.Entity; @@ -97,20 +94,21 @@ index 0000000000000000000000000000000000000000..a6a5ebc534cc380740ba42790149c8b8 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Triggered when a player stops spectating an entity in spectator mode. + */ ++@NullMarked +public class PlayerStopSpectatingEntityEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final Entity spectatorTarget; ++ private final Entity spectatorTarget; + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerStopSpectatingEntityEvent(@NotNull Player player, @NotNull Entity spectatorTarget) { ++ public PlayerStopSpectatingEntityEvent(final Player player, final Entity spectatorTarget) { + super(player); + this.spectatorTarget = spectatorTarget; + } @@ -120,7 +118,6 @@ index 0000000000000000000000000000000000000000..a6a5ebc534cc380740ba42790149c8b8 + * + * @return The entity the player is currently spectating (before they will stop). + */ -+ @NotNull + public Entity getSpectatorTarget() { + return this.spectatorTarget; + } @@ -131,17 +128,15 @@ index 0000000000000000000000000000000000000000..a6a5ebc534cc380740ba42790149c8b8 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0164-Add-PlayerPostRespawnEvent.patch b/patches/api/0164-Add-PlayerPostRespawnEvent.patch index c261fc737..90bb07b46 100644 --- a/patches/api/0164-Add-PlayerPostRespawnEvent.patch +++ b/patches/api/0164-Add-PlayerPostRespawnEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerPostRespawnEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerPostRespawnEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerPostRespawnEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..16961aac061e78fb84029f8435ab5f7c493b1362 +index 0000000000000000000000000000000000000000..e82446ec3d706c47ac9a544f70d0c19b658665d5 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerPostRespawnEvent.java -@@ -0,0 +1,56 @@ +@@ -0,0 +1,54 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.Location; @@ -17,20 +17,21 @@ index 0000000000000000000000000000000000000000..16961aac061e78fb84029f8435ab5f7c +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Fired after a player has respawned + */ ++@NullMarked +public class PlayerPostRespawnEvent extends PlayerEvent { + -+ private final static HandlerList HANDLER_LIST = new HandlerList(); ++ private static final HandlerList HANDLER_LIST = new HandlerList(); + + private final Location respawnedLocation; + private final boolean isBedSpawn; + + @ApiStatus.Internal -+ public PlayerPostRespawnEvent(@NotNull final Player respawnPlayer, @NotNull final Location respawnedLocation, final boolean isBedSpawn) { ++ public PlayerPostRespawnEvent(final Player respawnPlayer, final Location respawnedLocation, final boolean isBedSpawn) { + super(respawnPlayer); + this.respawnedLocation = respawnedLocation; + this.isBedSpawn = isBedSpawn; @@ -41,7 +42,6 @@ index 0000000000000000000000000000000000000000..16961aac061e78fb84029f8435ab5f7c + * + * @return location of the respawned player + */ -+ @NotNull + public Location getRespawnedLocation() { + return this.respawnedLocation.clone(); + } @@ -56,12 +56,10 @@ index 0000000000000000000000000000000000000000..16961aac061e78fb84029f8435ab5f7c + } + + @Override -+ @NotNull + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0167-Server-Tick-Events.patch b/patches/api/0167-Server-Tick-Events.patch index fc84bb269..dd0e4b3de 100644 --- a/patches/api/0167-Server-Tick-Events.patch +++ b/patches/api/0167-Server-Tick-Events.patch @@ -7,10 +7,10 @@ Fires event at start and end of a server tick diff --git a/src/main/java/com/destroystokyo/paper/event/server/ServerTickEndEvent.java b/src/main/java/com/destroystokyo/paper/event/server/ServerTickEndEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..15a177ce555ed329988d97a9f0b5d9c71aea18fb +index 0000000000000000000000000000000000000000..c879588693c930226049e60393f2f23aad1588b9 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/server/ServerTickEndEvent.java -@@ -0,0 +1,61 @@ +@@ -0,0 +1,62 @@ +package com.destroystokyo.paper.event.server; + +import org.bukkit.event.Event; @@ -64,6 +64,7 @@ index 0000000000000000000000000000000000000000..15a177ce555ed329988d97a9f0b5d9c7 + return this.timeEnd - System.nanoTime(); + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } @@ -74,10 +75,10 @@ index 0000000000000000000000000000000000000000..15a177ce555ed329988d97a9f0b5d9c7 +} diff --git a/src/main/java/com/destroystokyo/paper/event/server/ServerTickStartEvent.java b/src/main/java/com/destroystokyo/paper/event/server/ServerTickStartEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..7c15e6487e17b3255e2428d73aef344ee32a43fd +index 0000000000000000000000000000000000000000..890153657ea5b756a8a3a038d6b53857e0d17fea --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/server/ServerTickStartEvent.java -@@ -0,0 +1,34 @@ +@@ -0,0 +1,35 @@ +package com.destroystokyo.paper.event.server; + +import org.bukkit.event.Event; @@ -104,6 +105,7 @@ index 0000000000000000000000000000000000000000..7c15e6487e17b3255e2428d73aef344e + return this.tickNumber; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0178-Entity-Jump-API.patch b/patches/api/0178-Entity-Jump-API.patch index 5fd295056..6cd58f786 100644 --- a/patches/api/0178-Entity-Jump-API.patch +++ b/patches/api/0178-Entity-Jump-API.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Entity Jump API diff --git a/src/main/java/com/destroystokyo/paper/event/entity/EntityJumpEvent.java b/src/main/java/com/destroystokyo/paper/event/entity/EntityJumpEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..1f1c159db2095733a585e102f34c2b657ca82dc2 +index 0000000000000000000000000000000000000000..b49b72608573ad5b98fc6e0070f6ef105bf177e4 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/entity/EntityJumpEvent.java -@@ -0,0 +1,48 @@ +@@ -0,0 +1,50 @@ +package com.destroystokyo.paper.event.entity; + +import org.bukkit.entity.LivingEntity; @@ -41,10 +41,12 @@ index 0000000000000000000000000000000000000000..1f1c159db2095733a585e102f34c2b65 + return (LivingEntity) super.getEntity(); + } + ++ @Override + public boolean isCancelled() { + return this.cancelled; + } + ++ @Override + public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } diff --git a/patches/api/0183-Add-Player-Client-Options-API.patch b/patches/api/0183-Add-Player-Client-Options-API.patch index 485335d7e..56be6b483 100644 --- a/patches/api/0183-Add-Player-Client-Options-API.patch +++ b/patches/api/0183-Add-Player-Client-Options-API.patch @@ -6,18 +6,18 @@ Subject: [PATCH] Add Player Client Options API diff --git a/src/main/java/com/destroystokyo/paper/ClientOption.java b/src/main/java/com/destroystokyo/paper/ClientOption.java new file mode 100644 -index 0000000000000000000000000000000000000000..f89bfeba29e6988db849957a508ca97ff5322242 +index 0000000000000000000000000000000000000000..ed08f823e0620289392f7fc2ff0ac721cff60478 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/ClientOption.java -@@ -0,0 +1,52 @@ +@@ -0,0 +1,51 @@ +package com.destroystokyo.paper; + +import net.kyori.adventure.translation.Translatable; +import net.kyori.adventure.util.Index; -+import org.jetbrains.annotations.NotNull; -+ +import org.bukkit.inventory.MainHand; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public final class ClientOption { + + public static final ClientOption SKIN_PARTS = new ClientOption<>(SkinParts.class); @@ -31,13 +31,12 @@ index 0000000000000000000000000000000000000000..f89bfeba29e6988db849957a508ca97f + + private final Class type; + -+ private ClientOption(@NotNull Class type) { ++ private ClientOption(final Class type) { + this.type = type; + } + -+ @NotNull + public Class getType() { -+ return type; ++ return this.type; + } + + public enum ChatVisibility implements Translatable { @@ -46,15 +45,15 @@ index 0000000000000000000000000000000000000000..f89bfeba29e6988db849957a508ca97f + HIDDEN("hidden"), + UNKNOWN("unknown"); + -+ public static Index NAMES = Index.create(ChatVisibility.class, chatVisibility -> chatVisibility.name); ++ public static final Index NAMES = Index.create(ChatVisibility.class, chatVisibility -> chatVisibility.name); + private final String name; + -+ ChatVisibility(String name) { ++ ChatVisibility(final String name) { + this.name = name; + } + + @Override -+ public @NotNull String translationKey() { ++ public String translationKey() { + if (this == UNKNOWN) { + throw new UnsupportedOperationException(this.name + " doesn't have a translation key"); + } @@ -90,27 +89,27 @@ index 0000000000000000000000000000000000000000..4a0c39405d4fbed457787e3c6ded4cc6 +} diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerClientOptionsChangeEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerClientOptionsChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6aea591ae5 +index 0000000000000000000000000000000000000000..6cf6aa876278d0d3e75148608951fc5865ad5aee --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerClientOptionsChangeEvent.java -@@ -0,0 +1,136 @@ +@@ -0,0 +1,130 @@ +package com.destroystokyo.paper.event.player; + +import com.destroystokyo.paper.ClientOption; +import com.destroystokyo.paper.ClientOption.ChatVisibility; +import com.destroystokyo.paper.SkinParts; ++import java.util.Map; +import org.bukkit.entity.Player; +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.MainHand; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+ -+import java.util.Map; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when the player changes their client settings + */ ++@NullMarked +public class PlayerClientOptionsChangeEvent extends PlayerEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -125,7 +124,7 @@ index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6a + private final boolean textFilteringEnabled; + + @Deprecated -+ public PlayerClientOptionsChangeEvent(@NotNull Player player, @NotNull String locale, int viewDistance, @NotNull ChatVisibility chatVisibility, boolean chatColors, @NotNull SkinParts skinParts, @NotNull MainHand mainHand) { ++ public PlayerClientOptionsChangeEvent(final Player player, final String locale, final int viewDistance, final ChatVisibility chatVisibility, final boolean chatColors, final SkinParts skinParts, final MainHand mainHand) { + super(player); + this.locale = locale; + this.viewDistance = viewDistance; @@ -138,7 +137,7 @@ index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6a + } + + @ApiStatus.Internal -+ public PlayerClientOptionsChangeEvent(@NotNull Player player, @NotNull Map, ?> options) { ++ public PlayerClientOptionsChangeEvent(final Player player, final Map, ?> options) { + super(player); + + this.locale = (String) options.get(ClientOption.LOCALE); @@ -151,7 +150,6 @@ index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6a + this.textFilteringEnabled = (boolean) options.get(ClientOption.TEXT_FILTERING_ENABLED); + } + -+ @NotNull + public String getLocale() { + return this.locale; + } @@ -168,7 +166,6 @@ index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6a + return this.viewDistance != this.player.getClientOption(ClientOption.VIEW_DISTANCE); + } + -+ @NotNull + public ChatVisibility getChatVisibility() { + return this.chatVisibility; + } @@ -185,7 +182,6 @@ index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6a + return this.chatColors != this.player.getClientOption(ClientOption.CHAT_COLORS_ENABLED); + } + -+ @NotNull + public SkinParts getSkinParts() { + return this.skinparts; + } @@ -194,7 +190,6 @@ index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6a + return this.skinparts.getRaw() != this.player.getClientOption(ClientOption.SKIN_PARTS).getRaw(); + } + -+ @NotNull + public MainHand getMainHand() { + return this.mainHand; + } @@ -220,12 +215,10 @@ index 0000000000000000000000000000000000000000..1757055d821d9ec7c728aa6c1b52fa6a + } + + @Override -+ @NotNull + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0184-Add-PlayerAttackEntityCooldownResetEvent.patch b/patches/api/0184-Add-PlayerAttackEntityCooldownResetEvent.patch index c3cfd0642..3d2999a70 100644 --- a/patches/api/0184-Add-PlayerAttackEntityCooldownResetEvent.patch +++ b/patches/api/0184-Add-PlayerAttackEntityCooldownResetEvent.patch @@ -6,7 +6,7 @@ Subject: [PATCH] Add PlayerAttackEntityCooldownResetEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerAttackEntityCooldownResetEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerAttackEntityCooldownResetEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..5ceaff1a499d08575ddcdcbead8e2cef6cfbea47 +index 0000000000000000000000000000000000000000..2cd5c9c344cacbabe64dae8ec87babb506b5fb09 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerAttackEntityCooldownResetEvent.java @@ -0,0 +1,77 @@ @@ -18,22 +18,23 @@ index 0000000000000000000000000000000000000000..5ceaff1a499d08575ddcdcbead8e2cef +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when processing a player's attack on an entity when the player's attack strength cooldown is reset + */ ++@NullMarked +public class PlayerAttackEntityCooldownResetEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final Entity attackedEntity; ++ private final Entity attackedEntity; + private final float cooledAttackStrength; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerAttackEntityCooldownResetEvent(@NotNull Player player, @NotNull Entity attackedEntity, float cooledAttackStrength) { ++ public PlayerAttackEntityCooldownResetEvent(final Player player, final Entity attackedEntity, final float cooledAttackStrength) { + super(player); + this.attackedEntity = attackedEntity; + this.cooledAttackStrength = cooledAttackStrength; @@ -53,7 +54,6 @@ index 0000000000000000000000000000000000000000..5ceaff1a499d08575ddcdcbead8e2cef + * + * @return the entity attacked by the player + */ -+ @NotNull + public Entity getAttackedEntity() { + return this.attackedEntity; + } @@ -74,16 +74,16 @@ index 0000000000000000000000000000000000000000..5ceaff1a499d08575ddcdcbead8e2cef + * Cancelling this event will prevent the target player from having their cooldown reset from attacking this entity + */ + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + + @Override -+ public @NotNull HandlerList getHandlers() { ++ public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ public static @NotNull HandlerList getHandlerList() { ++ public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/patches/api/0187-Add-Mob-Goal-API.patch b/patches/api/0187-Add-Mob-Goal-API.patch index 4cc271dda..142c4e4f7 100644 --- a/patches/api/0187-Add-Mob-Goal-API.patch +++ b/patches/api/0187-Add-Mob-Goal-API.patch @@ -6,21 +6,20 @@ Subject: [PATCH] Add Mob Goal API diff --git a/src/main/java/com/destroystokyo/paper/entity/ai/Goal.java b/src/main/java/com/destroystokyo/paper/entity/ai/Goal.java new file mode 100644 -index 0000000000000000000000000000000000000000..c57c5416c88e2070a082403ab0dda9d7f08d2a57 +index 0000000000000000000000000000000000000000..88f64a84c6b81246a4936e37c9f0410eefc847fd --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/entity/ai/Goal.java -@@ -0,0 +1,66 @@ +@@ -0,0 +1,63 @@ +package com.destroystokyo.paper.entity.ai; + -+import org.jetbrains.annotations.NotNull; -+ +import java.util.EnumSet; -+ +import org.bukkit.entity.Mob; ++import org.jspecify.annotations.NullMarked; + +/** + * Represents an AI goal of an entity + */ ++@NullMarked +public interface Goal { + + /** @@ -36,7 +35,7 @@ index 0000000000000000000000000000000000000000..c57c5416c88e2070a082403ab0dda9d7 + * @return if this goal should stay active + */ + default boolean shouldStayActive() { -+ return shouldActivate(); ++ return this.shouldActivate(); + } + + /** @@ -63,86 +62,79 @@ index 0000000000000000000000000000000000000000..c57c5416c88e2070a082403ab0dda9d7 + * + * @return the goal key + */ -+ @NotNull + GoalKey getKey(); + + /** + * Returns a list of all applicable flags for this goal.
-+ * ++ *

+ * This method is only called on construction. + * + * @return the subtypes. + */ -+ @NotNull + EnumSet getTypes(); +} diff --git a/src/main/java/com/destroystokyo/paper/entity/ai/GoalKey.java b/src/main/java/com/destroystokyo/paper/entity/ai/GoalKey.java new file mode 100644 -index 0000000000000000000000000000000000000000..9cd98c6fcfa3eb439d9013ef76ef4661175a0e5a +index 0000000000000000000000000000000000000000..fb626065c642a3f43075f2ae751419e23431763c --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/entity/ai/GoalKey.java -@@ -0,0 +1,64 @@ +@@ -0,0 +1,59 @@ +package com.destroystokyo.paper.entity.ai; + +import com.google.common.base.Objects; -+ -+import org.jetbrains.annotations.NotNull; -+ +import java.util.StringJoiner; -+ +import org.bukkit.NamespacedKey; +import org.bukkit.entity.Mob; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** -+ * + * Used to identify a Goal. Consists of a {@link NamespacedKey} and the type of mob the goal can be applied to + * + * @param the type of mob the goal can be applied to + */ -+public class GoalKey { ++@NullMarked ++public final class GoalKey { + + private final Class entityClass; + private final NamespacedKey namespacedKey; + -+ private GoalKey(@NotNull Class entityClass, @NotNull NamespacedKey namespacedKey) { ++ private GoalKey(Class entityClass, NamespacedKey namespacedKey) { + this.entityClass = entityClass; + this.namespacedKey = namespacedKey; + } + -+ @NotNull + public Class getEntityClass() { -+ return entityClass; ++ return this.entityClass; + } + -+ @NotNull + public NamespacedKey getNamespacedKey() { -+ return namespacedKey; ++ return this.namespacedKey; + } + + @Override -+ public boolean equals(Object o) { ++ public boolean equals(@Nullable Object o) { + if (this == o) return true; -+ if (o == null || getClass() != o.getClass()) return false; ++ if (o == null || this.getClass() != o.getClass()) return false; + GoalKey goalKey = (GoalKey) o; -+ return Objects.equal(entityClass, goalKey.entityClass) && -+ Objects.equal(namespacedKey, goalKey.namespacedKey); ++ return Objects.equal(this.entityClass, goalKey.entityClass) && ++ Objects.equal(this.namespacedKey, goalKey.namespacedKey); + } + + @Override + public int hashCode() { -+ return Objects.hashCode(entityClass, namespacedKey); ++ return Objects.hashCode(this.entityClass, this.namespacedKey); + } + + @Override + public String toString() { + return new StringJoiner(", ", GoalKey.class.getSimpleName() + "[", "]") -+ .add("entityClass=" + entityClass) -+ .add("namespacedKey=" + namespacedKey) ++ .add("entityClass=" + this.entityClass) ++ .add("namespacedKey=" + this.namespacedKey) + .toString(); + } + -+ @NotNull -+ public static GoalKey of(@NotNull Class entityClass, @NotNull NamespacedKey namespacedKey) { ++ public static GoalKey of(Class entityClass, NamespacedKey namespacedKey) { + return new GoalKey<>(entityClass, namespacedKey); + } +} @@ -171,59 +163,51 @@ index 0000000000000000000000000000000000000000..7024c8f484d2460abf3abfe65a29771d +} diff --git a/src/main/java/com/destroystokyo/paper/entity/ai/MobGoals.java b/src/main/java/com/destroystokyo/paper/entity/ai/MobGoals.java new file mode 100644 -index 0000000000000000000000000000000000000000..e21f7574763dd4f13794f91bbef192ef66a8f5e9 +index 0000000000000000000000000000000000000000..0203e7efbb8c729ed378c53c2630a523b697314f --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/entity/ai/MobGoals.java -@@ -0,0 +1,50 @@ +@@ -0,0 +1,42 @@ +package com.destroystokyo.paper.entity.ai; + -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; + +import java.util.Collection; -+ +import org.bukkit.entity.Mob; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Represents a part of the "brain" of a mob. It tracks all tasks (running or not), allows adding and removing goals + */ ++@NullMarked +public interface MobGoals { + -+ void addGoal(@NotNull T mob, int priority, @NotNull Goal goal); ++ void addGoal(T mob, int priority, Goal goal); + -+ void removeGoal(@NotNull T mob, @NotNull Goal goal); ++ void removeGoal(T mob, Goal goal); + -+ void removeAllGoals(@NotNull T mob); ++ void removeAllGoals(T mob); + -+ void removeAllGoals(@NotNull T mob, @NotNull GoalType type); ++ void removeAllGoals(T mob, GoalType type); + -+ void removeGoal(@NotNull T mob, @NotNull GoalKey key); ++ void removeGoal(T mob, GoalKey key); + -+ boolean hasGoal(@NotNull T mob, @NotNull GoalKey key); ++ boolean hasGoal(T mob, GoalKey key); + -+ @Nullable -+ Goal getGoal(@NotNull T mob, @NotNull GoalKey key); ++ @Nullable Goal getGoal(T mob, GoalKey key); + -+ @NotNull -+ Collection> getGoals(@NotNull T mob, @NotNull GoalKey key); ++ Collection> getGoals(T mob, GoalKey key); + -+ @NotNull -+ Collection> getAllGoals(@NotNull T mob); ++ Collection> getAllGoals(T mob); + -+ @NotNull -+ Collection> getAllGoals(@NotNull T mob, @NotNull GoalType type); ++ Collection> getAllGoals(T mob, GoalType type); + -+ @NotNull -+ Collection> getAllGoalsWithout(@NotNull T mob, @NotNull GoalType type); ++ Collection> getAllGoalsWithout(T mob, GoalType type); + -+ @NotNull -+ Collection> getRunningGoals(@NotNull T mob); ++ Collection> getRunningGoals(T mob); + -+ @NotNull -+ Collection> getRunningGoals(@NotNull T mob, @NotNull GoalType type); ++ Collection> getRunningGoals(T mob, GoalType type); + -+ @NotNull -+ Collection> getRunningGoalsWithout(@NotNull T mob, @NotNull GoalType type); ++ Collection> getRunningGoalsWithout(T mob, GoalType type); +} diff --git a/src/main/java/org/bukkit/Bukkit.java b/src/main/java/org/bukkit/Bukkit.java index 54626b927444ab3fc6b7d9ac9e326ff368b0cd25..1a671331ec4ab21430d7d52e9a4f45510ef39944 100644 diff --git a/patches/api/0188-Add-villager-reputation-API.patch b/patches/api/0188-Add-villager-reputation-API.patch index 407a8007a..fc368610e 100644 --- a/patches/api/0188-Add-villager-reputation-API.patch +++ b/patches/api/0188-Add-villager-reputation-API.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add villager reputation API diff --git a/src/main/java/com/destroystokyo/paper/entity/villager/Reputation.java b/src/main/java/com/destroystokyo/paper/entity/villager/Reputation.java new file mode 100644 -index 0000000000000000000000000000000000000000..0a69e21b0b3001c9cc50951b4b8bd593f6fa74be +index 0000000000000000000000000000000000000000..f16294ef3148f8671389fa097e3e369a046e48cf --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/entity/villager/Reputation.java -@@ -0,0 +1,57 @@ +@@ -0,0 +1,58 @@ +package com.destroystokyo.paper.entity.villager; + +import com.google.common.base.Preconditions; @@ -17,20 +17,21 @@ index 0000000000000000000000000000000000000000..0a69e21b0b3001c9cc50951b4b8bd593 +import java.util.EnumMap; +import java.util.Map; +import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * A reputation score for a player on a villager. + */ ++@NullMarked +public final class Reputation { + -+ @NotNull + private final Map reputation; + + public Reputation() { + this(new EnumMap<>(ReputationType.class)); + } + -+ public Reputation(@NotNull Map reputation) { ++ public Reputation(Map reputation) { + Preconditions.checkNotNull(reputation, "reputation cannot be null"); + this.reputation = reputation; + } @@ -41,7 +42,7 @@ index 0000000000000000000000000000000000000000..0a69e21b0b3001c9cc50951b4b8bd593 + * @param type The {@link ReputationType type} of reputation to get. + * @return The value of the {@link ReputationType type}. + */ -+ public int getReputation(@NotNull ReputationType type) { ++ public int getReputation(ReputationType type) { + Preconditions.checkNotNull(type, "the reputation type cannot be null"); + return this.reputation.getOrDefault(type, 0); + } @@ -52,7 +53,7 @@ index 0000000000000000000000000000000000000000..0a69e21b0b3001c9cc50951b4b8bd593 + * @param type The {@link ReputationType type} of reputation to set. + * @param value The value of the {@link ReputationType type}. + */ -+ public void setReputation(@NotNull ReputationType type, int value) { ++ public void setReputation(ReputationType type, int value) { + Preconditions.checkNotNull(type, "the reputation type cannot be null"); + this.reputation.put(type, value); + } @@ -63,7 +64,7 @@ index 0000000000000000000000000000000000000000..0a69e21b0b3001c9cc50951b4b8bd593 + * @param type The {@link ReputationType type} to check + * @return If there is a value for this {@link ReputationType type} set. + */ -+ public boolean hasReputationSet(@NotNull ReputationType type) { ++ public boolean hasReputationSet(ReputationType type) { + return this.reputation.containsKey(type); + } +} diff --git a/patches/api/0192-Add-and-implement-PlayerRecipeBookClickEvent.patch b/patches/api/0192-Add-and-implement-PlayerRecipeBookClickEvent.patch index 4fe75c486..f0a90f120 100644 --- a/patches/api/0192-Add-and-implement-PlayerRecipeBookClickEvent.patch +++ b/patches/api/0192-Add-and-implement-PlayerRecipeBookClickEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add and implement PlayerRecipeBookClickEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerRecipeBookClickEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerRecipeBookClickEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c38ac6d0e0ac4ecbdc73d2bedd7731ff34c9d192 +index 0000000000000000000000000000000000000000..a7becccb2cf3b72744fcac4efa52d7c61e607765 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerRecipeBookClickEvent.java -@@ -0,0 +1,89 @@ +@@ -0,0 +1,87 @@ +package com.destroystokyo.paper.event.player; + +import org.bukkit.NamespacedKey; @@ -18,22 +18,23 @@ index 0000000000000000000000000000000000000000..c38ac6d0e0ac4ecbdc73d2bedd7731ff +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player clicks a recipe in the recipe book + */ ++@NullMarked +public class PlayerRecipeBookClickEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private NamespacedKey recipe; ++ private NamespacedKey recipe; + private boolean makeAll; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerRecipeBookClickEvent(@NotNull Player player, @NotNull NamespacedKey recipe, boolean makeAll) { ++ public PlayerRecipeBookClickEvent(final Player player, final NamespacedKey recipe, final boolean makeAll) { + super(player); + this.recipe = recipe; + this.makeAll = makeAll; @@ -44,7 +45,6 @@ index 0000000000000000000000000000000000000000..c38ac6d0e0ac4ecbdc73d2bedd7731ff + * + * @return The namespaced key of the recipe + */ -+ @NotNull + public NamespacedKey getRecipe() { + return this.recipe; + } @@ -54,7 +54,7 @@ index 0000000000000000000000000000000000000000..c38ac6d0e0ac4ecbdc73d2bedd7731ff + * + * @param recipe The key of the recipe that should be requested + */ -+ public void setRecipe(@NotNull NamespacedKey recipe) { ++ public void setRecipe(final NamespacedKey recipe) { + this.recipe = recipe; + } + @@ -74,7 +74,7 @@ index 0000000000000000000000000000000000000000..c38ac6d0e0ac4ecbdc73d2bedd7731ff + * + * @param makeAll {@code true} if the request should attempt to make the maximum amount of results + */ -+ public void setMakeAll(boolean makeAll) { ++ public void setMakeAll(final boolean makeAll) { + this.makeAll = makeAll; + } + @@ -84,17 +84,15 @@ index 0000000000000000000000000000000000000000..c38ac6d0e0ac4ecbdc73d2bedd7731ff + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0196-Add-PrepareResultEvent-PrepareGrindstoneEvent.patch b/patches/api/0196-Add-PrepareResultEvent-PrepareGrindstoneEvent.patch index c16892f58..5bcc9f3d0 100644 --- a/patches/api/0196-Add-PrepareResultEvent-PrepareGrindstoneEvent.patch +++ b/patches/api/0196-Add-PrepareResultEvent-PrepareGrindstoneEvent.patch @@ -48,10 +48,10 @@ index 0000000000000000000000000000000000000000..f75933948cdf0aa0c9bb2f06da5418f1 +} diff --git a/src/main/java/com/destroystokyo/paper/event/inventory/PrepareResultEvent.java b/src/main/java/com/destroystokyo/paper/event/inventory/PrepareResultEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..5ae8b843f78b22e300de0202fb800fcae6ff49b0 +index 0000000000000000000000000000000000000000..8ca7858613bb78ee1f9453b55fc38e00414fefb5 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/inventory/PrepareResultEvent.java -@@ -0,0 +1,40 @@ +@@ -0,0 +1,42 @@ +package com.destroystokyo.paper.event.inventory; + +import org.bukkit.event.inventory.PrepareInventoryResultEvent; @@ -79,6 +79,7 @@ index 0000000000000000000000000000000000000000..5ae8b843f78b22e300de0202fb800fca + * + * @return result item + */ ++ @Override + public @Nullable ItemStack getResult() { + return super.getResult(); + } @@ -88,6 +89,7 @@ index 0000000000000000000000000000000000000000..5ae8b843f78b22e300de0202fb800fca + * + * @param result result item + */ ++ @Override + public void setResult(final @Nullable ItemStack result) { + super.setResult(result); + } diff --git a/patches/api/0216-Add-PlayerItemCooldownEvent.patch b/patches/api/0216-Add-PlayerItemCooldownEvent.patch index ae5118c7d..32321693b 100644 --- a/patches/api/0216-Add-PlayerItemCooldownEvent.patch +++ b/patches/api/0216-Add-PlayerItemCooldownEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerItemCooldownEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerItemCooldownEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerItemCooldownEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c2764ffd51831351b934568e1301b2e4073dc0c4 +index 0000000000000000000000000000000000000000..07b3a93ea09f0ae7d0e7a5af3633a0c669d36fcf --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerItemCooldownEvent.java -@@ -0,0 +1,82 @@ +@@ -0,0 +1,79 @@ +package io.papermc.paper.event.player; + +import com.google.common.base.Preconditions; @@ -19,23 +19,23 @@ index 0000000000000000000000000000000000000000..c2764ffd51831351b934568e1301b2e4 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Fired when a player receives an item cooldown. + */ ++@NullMarked +public class PlayerItemCooldownEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull + private final Material type; + private int cooldown; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerItemCooldownEvent(@NotNull Player player, @NotNull Material type, int cooldown) { ++ public PlayerItemCooldownEvent(final Player player, final Material type, final int cooldown) { + super(player); + this.type = type; + this.cooldown = cooldown; @@ -46,7 +46,6 @@ index 0000000000000000000000000000000000000000..c2764ffd51831351b934568e1301b2e4 + * + * @return material affected by the cooldown + */ -+ @NotNull + public Material getType() { + return this.type; + } @@ -66,7 +65,7 @@ index 0000000000000000000000000000000000000000..c2764ffd51831351b934568e1301b2e4 + * + * @param cooldown cooldown in ticks, has to be a positive number + */ -+ public void setCooldown(int cooldown) { ++ public void setCooldown(final int cooldown) { + Preconditions.checkArgument(cooldown >= 0, "The cooldown has to be equal to or greater than 0!"); + this.cooldown = cooldown; + } @@ -77,17 +76,15 @@ index 0000000000000000000000000000000000000000..c2764ffd51831351b934568e1301b2e4 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0219-Player-Chunk-Load-Unload-Events.patch b/patches/api/0219-Player-Chunk-Load-Unload-Events.patch index c1779bb84..bbfe5bf16 100644 --- a/patches/api/0219-Player-Chunk-Load-Unload-Events.patch +++ b/patches/api/0219-Player-Chunk-Load-Unload-Events.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Player Chunk Load/Unload Events diff --git a/src/main/java/io/papermc/paper/event/packet/PlayerChunkLoadEvent.java b/src/main/java/io/papermc/paper/event/packet/PlayerChunkLoadEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..3ddbc099a13df939b3912f30b54e7635840ba5a4 +index 0000000000000000000000000000000000000000..2815c5802eb38e5a48f9db42b9247e24c27db134 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/packet/PlayerChunkLoadEvent.java -@@ -0,0 +1,45 @@ +@@ -0,0 +1,43 @@ +package io.papermc.paper.event.packet; + +import org.bukkit.Chunk; @@ -17,7 +17,7 @@ index 0000000000000000000000000000000000000000..3ddbc099a13df939b3912f30b54e7635 +import org.bukkit.event.HandlerList; +import org.bukkit.event.world.ChunkEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Is called when a {@link Player} receives a {@link Chunk} @@ -27,6 +27,7 @@ index 0000000000000000000000000000000000000000..3ddbc099a13df939b3912f30b54e7635 + * Should only be used for packet/clientside related stuff. + * Not intended for modifying server side state. + */ ++@NullMarked +public class PlayerChunkLoadEvent extends ChunkEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -34,33 +35,30 @@ index 0000000000000000000000000000000000000000..3ddbc099a13df939b3912f30b54e7635 + private final Player player; + + @ApiStatus.Internal -+ public PlayerChunkLoadEvent(@NotNull Chunk chunk, @NotNull Player player) { ++ public PlayerChunkLoadEvent(final Chunk chunk, final Player player) { + super(chunk); + this.player = player; + } + -+ @NotNull + public Player getPlayer() { + return this.player; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/src/main/java/io/papermc/paper/event/packet/PlayerChunkUnloadEvent.java b/src/main/java/io/papermc/paper/event/packet/PlayerChunkUnloadEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..2cac7e27991c04a9ced261f2dd8ad8657ccddf6b +index 0000000000000000000000000000000000000000..3ebb35b680193109cc751398675e935eed746750 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/packet/PlayerChunkUnloadEvent.java -@@ -0,0 +1,43 @@ +@@ -0,0 +1,41 @@ +package io.papermc.paper.event.packet; + +import org.bukkit.Chunk; @@ -68,7 +66,7 @@ index 0000000000000000000000000000000000000000..2cac7e27991c04a9ced261f2dd8ad865 +import org.bukkit.event.HandlerList; +import org.bukkit.event.world.ChunkEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Is called when a {@link Player} receives a chunk unload packet. @@ -76,6 +74,7 @@ index 0000000000000000000000000000000000000000..2cac7e27991c04a9ced261f2dd8ad865 + * Should only be used for packet/clientside related stuff. + * Not intended for modifying server side. + */ ++@NullMarked +public class PlayerChunkUnloadEvent extends ChunkEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -83,23 +82,20 @@ index 0000000000000000000000000000000000000000..2cac7e27991c04a9ced261f2dd8ad865 + private final Player player; + + @ApiStatus.Internal -+ public PlayerChunkUnloadEvent(@NotNull Chunk chunk, @NotNull Player player) { ++ public PlayerChunkUnloadEvent(final Chunk chunk, final Player player) { + super(chunk); + this.player = player; + } + -+ @NotNull + public Player getPlayer() { + return this.player; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0222-Added-PlayerTradeEvent.patch b/patches/api/0222-Added-PlayerTradeEvent.patch index 11ad01902..92c8312a0 100644 --- a/patches/api/0222-Added-PlayerTradeEvent.patch +++ b/patches/api/0222-Added-PlayerTradeEvent.patch @@ -13,10 +13,10 @@ event being about villager trades. diff --git a/src/main/java/io/papermc/paper/event/player/PlayerPurchaseEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerPurchaseEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43e9b50bfc +index 0000000000000000000000000000000000000000..1691b53f157f17117116e841cbfc769ea0e14364 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerPurchaseEvent.java -@@ -0,0 +1,109 @@ +@@ -0,0 +1,104 @@ +package io.papermc.paper.event.player; + +import com.google.common.base.Preconditions; @@ -26,11 +26,12 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.MerchantRecipe; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player trades with a standalone merchant GUI. + */ ++@NullMarked +public class PlayerPurchaseEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -42,12 +43,9 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerPurchaseEvent(@NotNull Player player, -+ @NotNull MerchantRecipe trade, -+ boolean rewardExp, -+ boolean increaseTradeUses) { ++ public PlayerPurchaseEvent(final Player player, final MerchantRecipe trade, final boolean rewardExp, final boolean increaseTradeUses) { + super(player); -+ setTrade(trade); ++ this.trade = trade; + this.rewardExp = rewardExp; + this.increaseTradeUses = increaseTradeUses; + } @@ -57,7 +55,6 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 + * + * @return the trade + */ -+ @NotNull + public MerchantRecipe getTrade() { + return this.trade; + } @@ -67,7 +64,7 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 + * + * @param trade the trade to use + */ -+ public void setTrade(@NotNull MerchantRecipe trade) { ++ public void setTrade(final MerchantRecipe trade) { + Preconditions.checkArgument(trade != null, "Trade cannot be null!"); + this.trade = trade; + } @@ -84,7 +81,7 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 + * + * @param rewardExp try to reward exp + */ -+ public void setRewardExp(boolean rewardExp) { ++ public void setRewardExp(final boolean rewardExp) { + this.rewardExp = rewardExp; + } + @@ -100,7 +97,7 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 + * + * @param increaseTradeUses {@code true} to count, {@code false} otherwise + */ -+ public void setIncreaseTradeUses(boolean increaseTradeUses) { ++ public void setIncreaseTradeUses(final boolean increaseTradeUses) { + this.increaseTradeUses = increaseTradeUses; + } + @@ -110,17 +107,15 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } @@ -128,7 +123,7 @@ index 0000000000000000000000000000000000000000..61c62877c38e27eacc20aa43ef02dc43 +} diff --git a/src/main/java/io/papermc/paper/event/player/PlayerTradeEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerTradeEvent.java new file mode 100755 -index 0000000000000000000000000000000000000000..559d1a3c783e6c726f48d1c88b2ff8c0888890ac +index 0000000000000000000000000000000000000000..46bdc178c19feb7dbb71eebee6d0774cf16c1042 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerTradeEvent.java @@ -0,0 +1,32 @@ @@ -138,17 +133,18 @@ index 0000000000000000000000000000000000000000..559d1a3c783e6c726f48d1c88b2ff8c0 +import org.bukkit.entity.Player; +import org.bukkit.inventory.MerchantRecipe; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player trades with a villager or wandering trader + */ ++@NullMarked +public class PlayerTradeEvent extends PlayerPurchaseEvent { + + private final AbstractVillager villager; + + @ApiStatus.Internal -+ public PlayerTradeEvent(@NotNull Player player, @NotNull AbstractVillager villager, @NotNull MerchantRecipe trade, boolean rewardExp, boolean increaseTradeUses) { ++ public PlayerTradeEvent(final Player player, final AbstractVillager villager, final MerchantRecipe trade, final boolean rewardExp, final boolean increaseTradeUses) { + super(player, trade, rewardExp, increaseTradeUses); + this.villager = villager; + } @@ -158,7 +154,6 @@ index 0000000000000000000000000000000000000000..559d1a3c783e6c726f48d1c88b2ff8c0 + * + * @return the villager or wandering trader + */ -+ @NotNull + public AbstractVillager getVillager() { + return this.villager; + } diff --git a/patches/api/0226-Add-PlayerFlowerPotManipulateEvent.patch b/patches/api/0226-Add-PlayerFlowerPotManipulateEvent.patch index cb08fd140..70a0b6ec3 100644 --- a/patches/api/0226-Add-PlayerFlowerPotManipulateEvent.patch +++ b/patches/api/0226-Add-PlayerFlowerPotManipulateEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerFlowerPotManipulateEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerFlowerPotManipulateEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerFlowerPotManipulateEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..373a6ec68fb575b82b06bf250768c1a6909efe38 +index 0000000000000000000000000000000000000000..03881ae56b3dd68a0aa600382b4689f213ec05f3 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerFlowerPotManipulateEvent.java -@@ -0,0 +1,85 @@ +@@ -0,0 +1,80 @@ +package io.papermc.paper.event.player; + +import org.bukkit.block.Block; @@ -19,25 +19,24 @@ index 0000000000000000000000000000000000000000..373a6ec68fb575b82b06bf250768c1a6 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.ItemStack; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player places an item in or takes an item out of a flowerpot. + */ ++@NullMarked +public class PlayerFlowerPotManipulateEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull + private final Block flowerpot; -+ @NotNull + private final ItemStack item; + private final boolean placing; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerFlowerPotManipulateEvent(@NotNull final Player player, @NotNull final Block flowerpot, @NotNull final ItemStack item, final boolean placing) { ++ public PlayerFlowerPotManipulateEvent(final Player player, final Block flowerpot, final ItemStack item, final boolean placing) { + super(player); + this.flowerpot = flowerpot; + this.item = item; @@ -49,7 +48,6 @@ index 0000000000000000000000000000000000000000..373a6ec68fb575b82b06bf250768c1a6 + * + * @return the flowerpot that is involved with this event + */ -+ @NotNull + public Block getFlowerpot() { + return this.flowerpot; + } @@ -60,7 +58,6 @@ index 0000000000000000000000000000000000000000..373a6ec68fb575b82b06bf250768c1a6 + * + * @return the item placed, or taken from, the flowerpot + */ -+ @NotNull + public ItemStack getItem() { + return this.item; + } @@ -80,17 +77,15 @@ index 0000000000000000000000000000000000000000..373a6ec68fb575b82b06bf250768c1a6 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0229-Added-WorldGameRuleChangeEvent.patch b/patches/api/0229-Added-WorldGameRuleChangeEvent.patch index 348efda0c..92d081900 100644 --- a/patches/api/0229-Added-WorldGameRuleChangeEvent.patch +++ b/patches/api/0229-Added-WorldGameRuleChangeEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Added WorldGameRuleChangeEvent diff --git a/src/main/java/io/papermc/paper/event/world/WorldGameRuleChangeEvent.java b/src/main/java/io/papermc/paper/event/world/WorldGameRuleChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..2831fb8ad22e457f85523f65be9cba2432109f01 +index 0000000000000000000000000000000000000000..4d259e31c4b1bb01318c727d8e340b6b23084067 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/world/WorldGameRuleChangeEvent.java -@@ -0,0 +1,92 @@ +@@ -0,0 +1,88 @@ +package io.papermc.paper.event.world; + +import org.bukkit.GameRule; @@ -19,23 +19,24 @@ index 0000000000000000000000000000000000000000..2831fb8ad22e457f85523f65be9cba24 +import org.bukkit.event.HandlerList; +import org.bukkit.event.world.WorldEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Called when a world's gamerule is changed, either by command or by api. + */ ++@NullMarked +public class WorldGameRuleChangeEvent extends WorldEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ private final CommandSender commandSender; ++ private final @Nullable CommandSender commandSender; + private final GameRule gameRule; + private String value; + private boolean cancelled; + + @ApiStatus.Internal -+ public WorldGameRuleChangeEvent(@NotNull World world, @Nullable CommandSender commandSender, @NotNull GameRule gameRule, @NotNull String value) { ++ public WorldGameRuleChangeEvent(final World world, final @Nullable CommandSender commandSender, final GameRule gameRule, final String value) { + super(world); + this.commandSender = commandSender; + this.gameRule = gameRule; @@ -47,8 +48,7 @@ index 0000000000000000000000000000000000000000..2831fb8ad22e457f85523f65be9cba24 + * + * @return {@code null} if the gamerule was changed via api, otherwise the {@link CommandSender}. + */ -+ @Nullable -+ public CommandSender getCommandSender() { ++ public @Nullable CommandSender getCommandSender() { + return this.commandSender; + } + @@ -57,7 +57,6 @@ index 0000000000000000000000000000000000000000..2831fb8ad22e457f85523f65be9cba24 + * + * @return the gamerule being changed. + */ -+ @NotNull + public GameRule getGameRule() { + return this.gameRule; + } @@ -67,7 +66,6 @@ index 0000000000000000000000000000000000000000..2831fb8ad22e457f85523f65be9cba24 + * + * @return the new value of the gamerule. + */ -+ @NotNull + public String getValue() { + return this.value; + } @@ -77,7 +75,7 @@ index 0000000000000000000000000000000000000000..2831fb8ad22e457f85523f65be9cba24 + * + * @param value the new value of the gamerule. + */ -+ public void setValue(@NotNull String value) { ++ public void setValue(final String value) { + this.value = value; + } + @@ -87,17 +85,15 @@ index 0000000000000000000000000000000000000000..2831fb8ad22e457f85523f65be9cba24 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0231-Add-BlockFailedDispenseEvent.patch b/patches/api/0231-Add-BlockFailedDispenseEvent.patch index 5b27cc552..738d2b32c 100644 --- a/patches/api/0231-Add-BlockFailedDispenseEvent.patch +++ b/patches/api/0231-Add-BlockFailedDispenseEvent.patch @@ -6,16 +6,15 @@ Subject: [PATCH] Add BlockFailedDispenseEvent diff --git a/src/main/java/io/papermc/paper/event/block/BlockFailedDispenseEvent.java b/src/main/java/io/papermc/paper/event/block/BlockFailedDispenseEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..03f91644189e2d1c615f0a22ab0a7c38c803f6c4 +index 0000000000000000000000000000000000000000..483139950f80588ae13204a624b9d60c44fac730 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/block/BlockFailedDispenseEvent.java -@@ -0,0 +1,58 @@ +@@ -0,0 +1,57 @@ +package io.papermc.paper.event.block; + +import org.bukkit.block.Block; +import org.bukkit.event.HandlerList; +import org.bukkit.event.block.BlockEvent; -+import org.checkerframework.checker.nullness.qual.NonNull; +import org.jetbrains.annotations.ApiStatus; +import org.jspecify.annotations.NullMarked; + diff --git a/patches/api/0232-Added-PlayerLecternPageChangeEvent.patch b/patches/api/0232-Added-PlayerLecternPageChangeEvent.patch index 3c9f223aa..43e273dba 100644 --- a/patches/api/0232-Added-PlayerLecternPageChangeEvent.patch +++ b/patches/api/0232-Added-PlayerLecternPageChangeEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Added PlayerLecternPageChangeEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerLecternPageChangeEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerLecternPageChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b8112a98bb3 +index 0000000000000000000000000000000000000000..6126182db48dab1286924f9642fb259087efabb3 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerLecternPageChangeEvent.java -@@ -0,0 +1,117 @@ +@@ -0,0 +1,113 @@ +package io.papermc.paper.event.player; + +import org.bukkit.block.Lectern; @@ -19,8 +19,9 @@ index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b81 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.ItemStack; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public class PlayerLecternPageChangeEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -34,7 +35,7 @@ index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b81 + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerLecternPageChangeEvent(@NotNull Player player, @NotNull Lectern lectern, @NotNull ItemStack book, @NotNull PageChangeDirection pageChangeDirection, int oldPage, int newPage) { ++ public PlayerLecternPageChangeEvent(final Player player, final Lectern lectern, final ItemStack book, final PageChangeDirection pageChangeDirection, final int oldPage, final int newPage) { + super(player); + this.lectern = lectern; + this.book = book; @@ -48,7 +49,6 @@ index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b81 + * + * @return the Lectern + */ -+ @NotNull + public Lectern getLectern() { + return this.lectern; + } @@ -58,7 +58,6 @@ index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b81 + * + * @return the ItemStack on the Lectern + */ -+ @NotNull + public ItemStack getBook() { + return this.book; + } @@ -68,7 +67,6 @@ index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b81 + * + * @return the page change direction + */ -+ @NotNull + public PageChangeDirection getPageChangeDirection() { + return this.pageChangeDirection; + } @@ -97,7 +95,7 @@ index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b81 + * + * @param newPage the new paged changed to + */ -+ public void setNewPage(int newPage) { ++ public void setNewPage(final int newPage) { + this.newPage = newPage; + } + @@ -107,17 +105,15 @@ index 0000000000000000000000000000000000000000..6ed2a6c8c033937d933b6d4834953b81 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0233-Added-PlayerLoomPatternSelectEvent.patch b/patches/api/0233-Added-PlayerLoomPatternSelectEvent.patch index 766e838ec..e5f19ed92 100644 --- a/patches/api/0233-Added-PlayerLoomPatternSelectEvent.patch +++ b/patches/api/0233-Added-PlayerLoomPatternSelectEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Added PlayerLoomPatternSelectEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerLoomPatternSelectEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerLoomPatternSelectEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c614bd1a725adee0c434a9331099d0c35d7411f6 +index 0000000000000000000000000000000000000000..5d4a334ba97cc0c17db8a157f2e2fd99dafbdbcc --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerLoomPatternSelectEvent.java -@@ -0,0 +1,80 @@ +@@ -0,0 +1,77 @@ +package io.papermc.paper.event.player; + +import org.bukkit.block.banner.PatternType; @@ -19,11 +19,12 @@ index 0000000000000000000000000000000000000000..c614bd1a725adee0c434a9331099d0c3 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.LoomInventory; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player selects a banner patten in a loom inventory. + */ ++@NullMarked +public class PlayerLoomPatternSelectEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -34,7 +35,7 @@ index 0000000000000000000000000000000000000000..c614bd1a725adee0c434a9331099d0c3 + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerLoomPatternSelectEvent(@NotNull Player player, @NotNull LoomInventory loomInventory, @NotNull PatternType patternType) { ++ public PlayerLoomPatternSelectEvent(final Player player, final LoomInventory loomInventory, final PatternType patternType) { + super(player); + this.loomInventory = loomInventory; + this.patternType = patternType; @@ -45,7 +46,6 @@ index 0000000000000000000000000000000000000000..c614bd1a725adee0c434a9331099d0c3 + * + * @return the loom inventory + */ -+ @NotNull + public LoomInventory getLoomInventory() { + return this.loomInventory; + } @@ -55,7 +55,6 @@ index 0000000000000000000000000000000000000000..c614bd1a725adee0c434a9331099d0c3 + * + * @return the pattern type + */ -+ @NotNull + public PatternType getPatternType() { + return this.patternType; + } @@ -65,7 +64,7 @@ index 0000000000000000000000000000000000000000..c614bd1a725adee0c434a9331099d0c3 + * + * @param patternType the pattern type + */ -+ public void setPatternType(@NotNull PatternType patternType) { ++ public void setPatternType(final PatternType patternType) { + this.patternType = patternType; + } + @@ -75,17 +74,15 @@ index 0000000000000000000000000000000000000000..c614bd1a725adee0c434a9331099d0c3 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0237-Add-StructuresLocateEvent.patch b/patches/api/0237-Add-StructuresLocateEvent.patch index 4f5120e85..de27ef547 100644 --- a/patches/api/0237-Add-StructuresLocateEvent.patch +++ b/patches/api/0237-Add-StructuresLocateEvent.patch @@ -7,10 +7,10 @@ Co-authored-by: Jake Potrebic diff --git a/src/main/java/io/papermc/paper/event/world/StructuresLocateEvent.java b/src/main/java/io/papermc/paper/event/world/StructuresLocateEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7e8d1edf7 +index 0000000000000000000000000000000000000000..d39b3dc48079fc83f1fd8e7ecde0d4ae77b635ce --- /dev/null +++ b/src/main/java/io/papermc/paper/event/world/StructuresLocateEvent.java -@@ -0,0 +1,176 @@ +@@ -0,0 +1,177 @@ +package io.papermc.paper.event.world; + +import io.papermc.paper.math.Position; @@ -24,9 +24,9 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 +import org.bukkit.generator.structure.Structure; +import org.bukkit.generator.structure.StructureType; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; +import org.jetbrains.annotations.UnmodifiableView; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Called before a set of configured structures is located. @@ -41,12 +41,13 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + *

  • {@link World#locateNearestStructure(Location, Structure, int, boolean)} is invoked.
  • + * + */ ++@NullMarked +public class StructuresLocateEvent extends WorldEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + private final Location origin; -+ private Result result; ++ private @Nullable Result result; + private List structures; + private int radius; + private boolean findUnexplored; @@ -54,7 +55,7 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + private boolean cancelled; + + @ApiStatus.Internal -+ public StructuresLocateEvent(@NotNull World world, @NotNull Location origin, @NotNull List structures, int radius, boolean findUnexplored) { ++ public StructuresLocateEvent(final World world, final Location origin, final List structures, final int radius, final boolean findUnexplored) { + super(world); + this.origin = origin; + this.structures = structures; @@ -67,7 +68,7 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + * + * @return {@link Location} where search begins + */ -+ public @NotNull Location getOrigin() { ++ public Location getOrigin() { + return this.origin.clone(); + } + @@ -90,7 +91,7 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + * + * @param result the {@link Location} and {@link Structure} of the search. + */ -+ public void setResult(@Nullable Result result) { ++ public void setResult(final @Nullable Result result) { + this.result = result; + } + @@ -99,7 +100,7 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + * + * @return an unmodifiable list of Structures + */ -+ public @NotNull @UnmodifiableView List getStructures() { ++ public @UnmodifiableView List getStructures() { + return Collections.unmodifiableList(this.structures); + } + @@ -108,7 +109,7 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + * + * @param structures a list of Structures targets + */ -+ public void setStructures(final @NotNull List structures) { ++ public void setStructures(final List structures) { + this.structures = structures; + } + @@ -130,7 +131,7 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + * + * @param radius the search radius (in chunks) + */ -+ public void setRadius(int radius) { ++ public void setRadius(final int radius) { + this.radius = radius; + } + @@ -152,7 +153,7 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + * + * @param findUnexplored Whether to search for only unexplored structures. + */ -+ public void setFindUnexplored(boolean findUnexplored) { ++ public void setFindUnexplored(final boolean findUnexplored) { + this.findUnexplored = findUnexplored; + } + @@ -162,26 +163,26 @@ index 0000000000000000000000000000000000000000..41ea65c9ecf6339bb50864a6d28e53c7 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + + @Override -+ public @NotNull HandlerList getHandlers() { ++ public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ public static @NotNull HandlerList getHandlerList() { ++ public static HandlerList getHandlerList() { + return HANDLER_LIST; + } + + /** + * Result for {@link StructuresLocateEvent}. + */ -+ public record Result(@NotNull Position pos, @NotNull Structure structure) { ++ public record Result(Position pos, Structure structure) { + + @Deprecated(forRemoval = true) -+ public @NotNull Location position() { ++ public Location position() { + //noinspection DataFlowIssue + return this.pos.toLocation(null); + } diff --git a/patches/api/0238-Add-BlockPreDispenseEvent.patch b/patches/api/0238-Add-BlockPreDispenseEvent.patch index 44fccdf61..0467ecd66 100644 --- a/patches/api/0238-Add-BlockPreDispenseEvent.patch +++ b/patches/api/0238-Add-BlockPreDispenseEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add BlockPreDispenseEvent diff --git a/src/main/java/io/papermc/paper/event/block/BlockPreDispenseEvent.java b/src/main/java/io/papermc/paper/event/block/BlockPreDispenseEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..fd10a34ec4e0731574cc7d69620e0b353ce8a21b +index 0000000000000000000000000000000000000000..2e13e18e2b8411dfb7886663de7125330a65fa62 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/block/BlockPreDispenseEvent.java -@@ -0,0 +1,63 @@ +@@ -0,0 +1,64 @@ +package io.papermc.paper.event.block; + +import org.bukkit.block.Block; @@ -65,6 +65,7 @@ index 0000000000000000000000000000000000000000..fd10a34ec4e0731574cc7d69620e0b35 + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } diff --git a/patches/api/0239-Added-PlayerChangeBeaconEffectEvent.patch b/patches/api/0239-Added-PlayerChangeBeaconEffectEvent.patch index 4d84c9e1b..64504b129 100644 --- a/patches/api/0239-Added-PlayerChangeBeaconEffectEvent.patch +++ b/patches/api/0239-Added-PlayerChangeBeaconEffectEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Added PlayerChangeBeaconEffectEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerChangeBeaconEffectEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerChangeBeaconEffectEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..1cc5dfb6d31f312f07acb1d5fb4719d6f4c2c4ff +index 0000000000000000000000000000000000000000..580f01754ce082c926240b9bf4842cde1320f987 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerChangeBeaconEffectEvent.java -@@ -0,0 +1,137 @@ +@@ -0,0 +1,136 @@ +package io.papermc.paper.event.player; + +import org.bukkit.block.Block; @@ -19,25 +19,26 @@ index 0000000000000000000000000000000000000000..1cc5dfb6d31f312f07acb1d5fb4719d6 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.potion.PotionEffectType; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Called when a player sets the effect for a beacon + */ ++@NullMarked +public class PlayerChangeBeaconEffectEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + private final Block beacon; -+ private PotionEffectType primary; -+ private PotionEffectType secondary; ++ private @Nullable PotionEffectType primary; ++ private @Nullable PotionEffectType secondary; + private boolean consumeItem = true; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerChangeBeaconEffectEvent(@NotNull Player player, @Nullable PotionEffectType primary, @Nullable PotionEffectType secondary, @NotNull Block beacon) { ++ public PlayerChangeBeaconEffectEvent(final Player player, final @Nullable PotionEffectType primary, final @Nullable PotionEffectType secondary, final Block beacon) { + super(player); + this.primary = primary; + this.secondary = secondary; @@ -47,7 +48,7 @@ index 0000000000000000000000000000000000000000..1cc5dfb6d31f312f07acb1d5fb4719d6 + /** + * @return the primary effect + */ -+ @Nullable public PotionEffectType getPrimary() { ++ public @Nullable PotionEffectType getPrimary() { + return this.primary; + } + @@ -58,14 +59,14 @@ index 0000000000000000000000000000000000000000..1cc5dfb6d31f312f07acb1d5fb4719d6 + * + * @param primary the primary effect + */ -+ public void setPrimary(@Nullable PotionEffectType primary) { ++ public void setPrimary(final @Nullable PotionEffectType primary) { + this.primary = primary; + } + + /** + * @return the secondary effect + */ -+ @Nullable public PotionEffectType getSecondary() { ++ public @Nullable PotionEffectType getSecondary() { + return this.secondary; + } + @@ -77,14 +78,13 @@ index 0000000000000000000000000000000000000000..1cc5dfb6d31f312f07acb1d5fb4719d6 + * + * @param secondary the secondary effect + */ -+ public void setSecondary(@Nullable PotionEffectType secondary) { ++ public void setSecondary(final @Nullable PotionEffectType secondary) { + this.secondary = secondary; + } + + /** + * @return the beacon block associated with this event + */ -+ @NotNull + public Block getBeacon() { + return this.beacon; + } @@ -109,7 +109,7 @@ index 0000000000000000000000000000000000000000..1cc5dfb6d31f312f07acb1d5fb4719d6 + * + * @param consumeItem {@code true} if item should be consumed + */ -+ public void setConsumeItem(boolean consumeItem) { ++ public void setConsumeItem(final boolean consumeItem) { + this.consumeItem = consumeItem; + } + @@ -133,16 +133,15 @@ index 0000000000000000000000000000000000000000..1cc5dfb6d31f312f07acb1d5fb4719d6 + * or saved. + */ + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + + @Override -+ public @NotNull HandlerList getHandlers() { ++ public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0240-Added-PlayerStonecutterRecipeSelectEvent.patch b/patches/api/0240-Added-PlayerStonecutterRecipeSelectEvent.patch index 46377a679..ad3896986 100644 --- a/patches/api/0240-Added-PlayerStonecutterRecipeSelectEvent.patch +++ b/patches/api/0240-Added-PlayerStonecutterRecipeSelectEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Added PlayerStonecutterRecipeSelectEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerStonecutterRecipeSelectEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerStonecutterRecipeSelectEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..8a7e1cb49ace104af3f9571fbc36b80687141736 +index 0000000000000000000000000000000000000000..7f603310bff54b1c58334f21a6975bfe20812d72 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerStonecutterRecipeSelectEvent.java -@@ -0,0 +1,60 @@ +@@ -0,0 +1,57 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.Player; @@ -18,8 +18,9 @@ index 0000000000000000000000000000000000000000..8a7e1cb49ace104af3f9571fbc36b806 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.StonecutterInventory; +import org.bukkit.inventory.StonecuttingRecipe; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public class PlayerStonecutterRecipeSelectEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -29,23 +30,21 @@ index 0000000000000000000000000000000000000000..8a7e1cb49ace104af3f9571fbc36b806 + + private boolean cancelled; + -+ public PlayerStonecutterRecipeSelectEvent(@NotNull Player player, @NotNull StonecutterInventory stonecutterInventory, @NotNull StonecuttingRecipe stonecuttingRecipe) { ++ public PlayerStonecutterRecipeSelectEvent(final Player player, final StonecutterInventory stonecutterInventory, final StonecuttingRecipe stonecuttingRecipe) { + super(player); + this.stonecutterInventory = stonecutterInventory; + this.stonecuttingRecipe = stonecuttingRecipe; + } + -+ @NotNull + public StonecutterInventory getStonecutterInventory() { + return this.stonecutterInventory; + } + -+ @NotNull + public StonecuttingRecipe getStonecuttingRecipe() { + return this.stonecuttingRecipe; + } + -+ public void setStonecuttingRecipe(@NotNull StonecuttingRecipe stonecuttingRecipe) { ++ public void setStonecuttingRecipe(final StonecuttingRecipe stonecuttingRecipe) { + this.stonecuttingRecipe = stonecuttingRecipe; + } + @@ -55,17 +54,15 @@ index 0000000000000000000000000000000000000000..8a7e1cb49ace104af3f9571fbc36b806 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0249-Add-worldborder-events.patch b/patches/api/0249-Add-worldborder-events.patch index 9f3ae7043..f67333262 100644 --- a/patches/api/0249-Add-worldborder-events.patch +++ b/patches/api/0249-Add-worldborder-events.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add worldborder events diff --git a/src/main/java/io/papermc/paper/event/world/border/WorldBorderBoundsChangeEvent.java b/src/main/java/io/papermc/paper/event/world/border/WorldBorderBoundsChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5a5d62928 +index 0000000000000000000000000000000000000000..3c168b3522c538c1576238738d48eaef6559450d --- /dev/null +++ b/src/main/java/io/papermc/paper/event/world/border/WorldBorderBoundsChangeEvent.java -@@ -0,0 +1,117 @@ +@@ -0,0 +1,115 @@ +package io.papermc.paper.event.world.border; + +import org.bukkit.World; @@ -17,11 +17,12 @@ index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5 +import org.bukkit.event.Cancellable; +import org.bukkit.event.HandlerList; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a world border changes its bounds, either over time, or instantly. + */ ++@NullMarked +public class WorldBorderBoundsChangeEvent extends WorldBorderEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -33,7 +34,7 @@ index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5 + private boolean cancelled; + + @ApiStatus.Internal -+ public WorldBorderBoundsChangeEvent(@NotNull World world, @NotNull WorldBorder worldBorder, @NotNull Type type, double oldSize, double newSize, long duration) { ++ public WorldBorderBoundsChangeEvent(final World world, final WorldBorder worldBorder, final Type type, final double oldSize, final double newSize, final long duration) { + super(world, worldBorder); + this.type = type; + this.oldSize = oldSize; @@ -46,7 +47,6 @@ index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5 + * + * @return the change type + */ -+ @NotNull + public Type getType() { + return this.type; + } @@ -74,7 +74,7 @@ index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5 + * + * @param newSize the new size + */ -+ public void setNewSize(double newSize) { ++ public void setNewSize(final double newSize) { + this.newSize = Math.min(this.worldBorder.getMaxSize(), Math.max(1.0D, newSize)); + } + @@ -93,7 +93,7 @@ index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5 + * + * @param duration the time in milliseconds for the change + */ -+ public void setDuration(long duration) { ++ public void setDuration(final long duration) { + // PAIL: TODO: Magic Values + this.duration = Math.min(9223372036854775L, Math.max(0L, duration)); + if (duration >= 0 && this.type == Type.INSTANT_MOVE) { @@ -107,17 +107,15 @@ index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } @@ -129,21 +127,22 @@ index 0000000000000000000000000000000000000000..02ac479840c137ca5afcec149ef884e5 +} diff --git a/src/main/java/io/papermc/paper/event/world/border/WorldBorderBoundsChangeFinishEvent.java b/src/main/java/io/papermc/paper/event/world/border/WorldBorderBoundsChangeFinishEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..a44964593b7f78c5086dc4928e75ad892e624671 +index 0000000000000000000000000000000000000000..6a264660897f0b621e3fb112e6056d98bb510f52 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/world/border/WorldBorderBoundsChangeFinishEvent.java -@@ -0,0 +1,67 @@ +@@ -0,0 +1,66 @@ +package io.papermc.paper.event.world.border; + +import org.bukkit.World; +import org.bukkit.WorldBorder; +import org.bukkit.event.HandlerList; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a moving world border has finished its move. + */ ++@NullMarked +public class WorldBorderBoundsChangeFinishEvent extends WorldBorderEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -153,7 +152,7 @@ index 0000000000000000000000000000000000000000..a44964593b7f78c5086dc4928e75ad89 + private final double duration; + + @ApiStatus.Internal -+ public WorldBorderBoundsChangeFinishEvent(@NotNull World world, @NotNull WorldBorder worldBorder, double oldSize, double newSize, double duration) { ++ public WorldBorderBoundsChangeFinishEvent(final World world, final WorldBorder worldBorder, final double oldSize, final double newSize, final double duration) { + super(world, worldBorder); + this.oldSize = oldSize; + this.newSize = newSize; @@ -189,23 +188,21 @@ index 0000000000000000000000000000000000000000..a44964593b7f78c5086dc4928e75ad89 + return this.duration; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/src/main/java/io/papermc/paper/event/world/border/WorldBorderCenterChangeEvent.java b/src/main/java/io/papermc/paper/event/world/border/WorldBorderCenterChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..dd96dcc0dd68d71bf27c758ed496153d434fb386 +index 0000000000000000000000000000000000000000..74fe5ad50517374631fa3009249833e2b99a55f0 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/world/border/WorldBorderCenterChangeEvent.java -@@ -0,0 +1,79 @@ +@@ -0,0 +1,76 @@ +package io.papermc.paper.event.world.border; + +import org.bukkit.Location; @@ -214,11 +211,12 @@ index 0000000000000000000000000000000000000000..dd96dcc0dd68d71bf27c758ed496153d +import org.bukkit.event.Cancellable; +import org.bukkit.event.HandlerList; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a world border's center is changed. + */ ++@NullMarked +public class WorldBorderCenterChangeEvent extends WorldBorderEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -229,7 +227,7 @@ index 0000000000000000000000000000000000000000..dd96dcc0dd68d71bf27c758ed496153d + private boolean cancelled; + + @ApiStatus.Internal -+ public WorldBorderCenterChangeEvent(@NotNull World world, @NotNull WorldBorder worldBorder, @NotNull Location oldCenter, @NotNull Location newCenter) { ++ public WorldBorderCenterChangeEvent(final World world, final WorldBorder worldBorder, final Location oldCenter, final Location newCenter) { + super(world, worldBorder); + this.oldCenter = oldCenter; + this.newCenter = newCenter; @@ -240,7 +238,6 @@ index 0000000000000000000000000000000000000000..dd96dcc0dd68d71bf27c758ed496153d + * + * @return the old center + */ -+ @NotNull + public Location getOldCenter() { + return this.oldCenter.clone(); + } @@ -250,7 +247,6 @@ index 0000000000000000000000000000000000000000..dd96dcc0dd68d71bf27c758ed496153d + * + * @return the new center + */ -+ @NotNull + public Location getNewCenter() { + return this.newCenter; + } @@ -260,7 +256,7 @@ index 0000000000000000000000000000000000000000..dd96dcc0dd68d71bf27c758ed496153d + * + * @param newCenter the new center + */ -+ public void setNewCenter(@NotNull Location newCenter) { ++ public void setNewCenter(final Location newCenter) { + this.newCenter = newCenter; + } + @@ -270,24 +266,22 @@ index 0000000000000000000000000000000000000000..dd96dcc0dd68d71bf27c758ed496153d + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } +} diff --git a/src/main/java/io/papermc/paper/event/world/border/WorldBorderEvent.java b/src/main/java/io/papermc/paper/event/world/border/WorldBorderEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..adb244f9be35c43ff99dbc3a771e1fdfb21da68c +index 0000000000000000000000000000000000000000..1f260e4d693903361d54c0af42144faa66adf4ea --- /dev/null +++ b/src/main/java/io/papermc/paper/event/world/border/WorldBorderEvent.java @@ -0,0 +1,23 @@ @@ -297,19 +291,19 @@ index 0000000000000000000000000000000000000000..adb244f9be35c43ff99dbc3a771e1fdf +import org.bukkit.WorldBorder; +import org.bukkit.event.world.WorldEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public abstract class WorldBorderEvent extends WorldEvent { + + protected final WorldBorder worldBorder; + + @ApiStatus.Internal -+ protected WorldBorderEvent(@NotNull World world, @NotNull WorldBorder worldBorder) { ++ protected WorldBorderEvent(final World world, final WorldBorder worldBorder) { + super(world); + this.worldBorder = worldBorder; + } + -+ @NotNull + public WorldBorder getWorldBorder() { + return this.worldBorder; + } diff --git a/patches/api/0250-added-PlayerNameEntityEvent.patch b/patches/api/0250-added-PlayerNameEntityEvent.patch index 69bd20d13..d7b2294c6 100644 --- a/patches/api/0250-added-PlayerNameEntityEvent.patch +++ b/patches/api/0250-added-PlayerNameEntityEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] added PlayerNameEntityEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerNameEntityEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerNameEntityEvent.java new file mode 100755 -index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b741cc39b61 +index 0000000000000000000000000000000000000000..fb990180d9958fe2bbe44e86aa360102f37be9ed --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerNameEntityEvent.java -@@ -0,0 +1,110 @@ +@@ -0,0 +1,107 @@ +package io.papermc.paper.event.player; + +import net.kyori.adventure.text.Component; @@ -19,24 +19,25 @@ index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b74 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Called when the player is attempting to rename a mob + */ ++@NullMarked +public class PlayerNameEntityEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + private LivingEntity entity; -+ private Component name; ++ private @Nullable Component name; + private boolean persistent; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerNameEntityEvent(@NotNull Player player, @NotNull LivingEntity entity, @NotNull Component name, boolean persistent) { ++ public PlayerNameEntityEvent(final Player player, final LivingEntity entity, final Component name, final boolean persistent) { + super(player); + this.entity = entity; + this.name = name; @@ -48,8 +49,7 @@ index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b74 + * + * @return the name + */ -+ @Nullable -+ public Component getName() { ++ public @Nullable Component getName() { + return this.name; + } + @@ -58,7 +58,7 @@ index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b74 + * + * @param name the name + */ -+ public void setName(@Nullable Component name) { ++ public void setName(final @Nullable Component name) { + this.name = name; + } + @@ -67,7 +67,6 @@ index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b74 + * + * @return the entity + */ -+ @NotNull + public LivingEntity getEntity() { + return this.entity; + } @@ -77,7 +76,7 @@ index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b74 + * + * @param entity the entity + */ -+ public void setEntity(@NotNull LivingEntity entity) { ++ public void setEntity(final LivingEntity entity) { + this.entity = entity; + } + @@ -95,7 +94,7 @@ index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b74 + * + * @param persistent persistent + */ -+ public void setPersistent(boolean persistent) { ++ public void setPersistent(final boolean persistent) { + this.persistent = persistent; + } + @@ -105,17 +104,15 @@ index 0000000000000000000000000000000000000000..84736d4a438e9023fbdeac1aea4d8b74 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0259-Added-PlayerDeepSleepEvent.patch b/patches/api/0259-Added-PlayerDeepSleepEvent.patch index b33389478..73c3ea900 100644 --- a/patches/api/0259-Added-PlayerDeepSleepEvent.patch +++ b/patches/api/0259-Added-PlayerDeepSleepEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Added PlayerDeepSleepEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerDeepSleepEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerDeepSleepEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..54cf2ec5e025fac9a0c8f151ff4f8c83a62b8405 +index 0000000000000000000000000000000000000000..2d4b15ded1e9aa00f21ca0b412e6b6ac333e5e02 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerDeepSleepEvent.java -@@ -0,0 +1,48 @@ +@@ -0,0 +1,47 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.Player; @@ -17,7 +17,7 @@ index 0000000000000000000000000000000000000000..54cf2ec5e025fac9a0c8f151ff4f8c83 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player has slept long enough @@ -26,6 +26,7 @@ index 0000000000000000000000000000000000000000..54cf2ec5e025fac9a0c8f151ff4f8c83 + * Cancelling this event will prevent the player from being counted as deeply sleeping + * unless they exit and re-enter the bed. + */ ++@NullMarked +public class PlayerDeepSleepEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -33,7 +34,7 @@ index 0000000000000000000000000000000000000000..54cf2ec5e025fac9a0c8f151ff4f8c83 + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerDeepSleepEvent(@NotNull Player player) { ++ public PlayerDeepSleepEvent(final Player player) { + super(player); + } + @@ -43,17 +44,15 @@ index 0000000000000000000000000000000000000000..54cf2ec5e025fac9a0c8f151ff4f8c83 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0261-Added-PlayerBedFailEnterEvent.patch b/patches/api/0261-Added-PlayerBedFailEnterEvent.patch index 6f9decf5f..c324a7202 100644 --- a/patches/api/0261-Added-PlayerBedFailEnterEvent.patch +++ b/patches/api/0261-Added-PlayerBedFailEnterEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Added PlayerBedFailEnterEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerBedFailEnterEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerBedFailEnterEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..6cd803e108dc2e6c0b8afda123123450403ef729 +index 0000000000000000000000000000000000000000..393d127463a6b396f6bd953f538828da23572f33 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerBedFailEnterEvent.java -@@ -0,0 +1,119 @@ +@@ -0,0 +1,115 @@ +package io.papermc.paper.event.player; + +import net.kyori.adventure.text.Component; @@ -19,9 +19,10 @@ index 0000000000000000000000000000000000000000..6cd803e108dc2e6c0b8afda123123450 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + ++@NullMarked +public class PlayerBedFailEnterEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -29,12 +30,12 @@ index 0000000000000000000000000000000000000000..6cd803e108dc2e6c0b8afda123123450 + private final FailReason failReason; + private final Block bed; + private boolean willExplode; -+ private Component message; ++ private @Nullable Component message; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerBedFailEnterEvent(@NotNull Player player, @NotNull FailReason failReason, @NotNull Block bed, boolean willExplode, @Nullable Component message) { ++ public PlayerBedFailEnterEvent(final Player player, final FailReason failReason, final Block bed, final boolean willExplode, final @Nullable Component message) { + super(player); + this.failReason = failReason; + this.bed = bed; @@ -42,12 +43,10 @@ index 0000000000000000000000000000000000000000..6cd803e108dc2e6c0b8afda123123450 + this.message = message; + } + -+ @NotNull + public FailReason getFailReason() { + return this.failReason; + } + -+ @NotNull + public Block getBed() { + return this.bed; + } @@ -56,16 +55,15 @@ index 0000000000000000000000000000000000000000..6cd803e108dc2e6c0b8afda123123450 + return this.willExplode; + } + -+ public void setWillExplode(boolean willExplode) { ++ public void setWillExplode(final boolean willExplode) { + this.willExplode = willExplode; + } + -+ @Nullable -+ public Component getMessage() { ++ public @Nullable Component getMessage() { + return this.message; + } + -+ public void setMessage(@Nullable Component message) { ++ public void setMessage(final @Nullable Component message) { + this.message = message; + } + @@ -81,17 +79,15 @@ index 0000000000000000000000000000000000000000..6cd803e108dc2e6c0b8afda123123450 + * that may occur because of the interaction. + */ + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0283-Add-ElderGuardianAppearanceEvent.patch b/patches/api/0283-Add-ElderGuardianAppearanceEvent.patch index b2a5a1754..ae955211a 100644 --- a/patches/api/0283-Add-ElderGuardianAppearanceEvent.patch +++ b/patches/api/0283-Add-ElderGuardianAppearanceEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add ElderGuardianAppearanceEvent diff --git a/src/main/java/io/papermc/paper/event/entity/ElderGuardianAppearanceEvent.java b/src/main/java/io/papermc/paper/event/entity/ElderGuardianAppearanceEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..272a4a06e766291aeee4f9e19a1ed26aa62e569a +index 0000000000000000000000000000000000000000..027e70a1085a84669af0bb10e7f11ad3ca1ad299 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/entity/ElderGuardianAppearanceEvent.java -@@ -0,0 +1,64 @@ +@@ -0,0 +1,65 @@ +package io.papermc.paper.event.entity; + +import org.bukkit.entity.ElderGuardian; @@ -51,6 +51,7 @@ index 0000000000000000000000000000000000000000..272a4a06e766291aeee4f9e19a1ed26a + * + * @return The elder guardian + */ ++ @Override + public ElderGuardian getEntity() { + return (ElderGuardian) super.getEntity(); + } diff --git a/patches/api/0288-Adds-PlayerArmSwingEvent.patch b/patches/api/0288-Adds-PlayerArmSwingEvent.patch index 48e43517e..5fb447f69 100644 --- a/patches/api/0288-Adds-PlayerArmSwingEvent.patch +++ b/patches/api/0288-Adds-PlayerArmSwingEvent.patch @@ -6,7 +6,7 @@ Subject: [PATCH] Adds PlayerArmSwingEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerArmSwingEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerArmSwingEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..3e8cbd13eb16e0926130bb8b07e2101602b19565 +index 0000000000000000000000000000000000000000..84dfb8da90c5f21d0f8899eca57bcb8b58614ca9 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerArmSwingEvent.java @@ -0,0 +1,29 @@ @@ -17,14 +17,15 @@ index 0000000000000000000000000000000000000000..3e8cbd13eb16e0926130bb8b07e21016 +import org.bukkit.event.player.PlayerAnimationType; +import org.bukkit.inventory.EquipmentSlot; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public class PlayerArmSwingEvent extends PlayerAnimationEvent { + + private final EquipmentSlot equipmentSlot; + + @ApiStatus.Internal -+ public PlayerArmSwingEvent(@NotNull Player player, @NotNull EquipmentSlot equipmentSlot) { ++ public PlayerArmSwingEvent(final Player player, final EquipmentSlot equipmentSlot) { + super(player, equipmentSlot == EquipmentSlot.HAND ? PlayerAnimationType.ARM_SWING : PlayerAnimationType.OFF_ARM_SWING); + this.equipmentSlot = equipmentSlot; + } @@ -34,7 +35,6 @@ index 0000000000000000000000000000000000000000..3e8cbd13eb16e0926130bb8b07e21016 + * + * @return the hand + */ -+ @NotNull + public EquipmentSlot getHand() { + return this.equipmentSlot; + } diff --git a/patches/api/0289-Add-PlayerSignCommandPreprocessEvent.patch b/patches/api/0289-Add-PlayerSignCommandPreprocessEvent.patch index 8882c3533..730b7af65 100644 --- a/patches/api/0289-Add-PlayerSignCommandPreprocessEvent.patch +++ b/patches/api/0289-Add-PlayerSignCommandPreprocessEvent.patch @@ -6,20 +6,19 @@ Subject: [PATCH] Add PlayerSignCommandPreprocessEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerSignCommandPreprocessEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerSignCommandPreprocessEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..dc774403749633a1bf8e8088b8c7b402b0e43863 +index 0000000000000000000000000000000000000000..220f950ab804d756e89760c341aafe868b2b6ad0 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerSignCommandPreprocessEvent.java @@ -0,0 +1,47 @@ +package io.papermc.paper.event.player; + ++import java.util.Set; +import org.bukkit.block.Sign; +import org.bukkit.block.sign.Side; +import org.bukkit.entity.Player; +import org.bukkit.event.player.PlayerCommandPreprocessEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+ -+import java.util.Set; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a {@link Player} clicks a side on a sign that causes a command to run. @@ -27,13 +26,14 @@ index 0000000000000000000000000000000000000000..dc774403749633a1bf8e8088b8c7b402 + * This command is run with elevated permissions which allows players to access commands on signs they wouldn't + * normally be able to run. + */ ++@NullMarked +public class PlayerSignCommandPreprocessEvent extends PlayerCommandPreprocessEvent { + + private final Sign sign; + private final Side side; + + @ApiStatus.Internal -+ public PlayerSignCommandPreprocessEvent(@NotNull Player player, @NotNull String message, @NotNull Set recipients, @NotNull Sign sign, @NotNull Side side) { ++ public PlayerSignCommandPreprocessEvent(final Player player, final String message, final Set recipients, final Sign sign, final Side side) { + super(player, message, recipients); + this.sign = sign; + this.side = side; @@ -44,7 +44,7 @@ index 0000000000000000000000000000000000000000..dc774403749633a1bf8e8088b8c7b402 + * + * @return the sign + */ -+ public @NotNull Sign getSign() { ++ public Sign getSign() { + return this.sign; + } + @@ -53,7 +53,7 @@ index 0000000000000000000000000000000000000000..dc774403749633a1bf8e8088b8c7b402 + * + * @return the sign side + */ -+ public @NotNull Side getSide() { ++ public Side getSide() { + return this.side; + } +} diff --git a/patches/api/0293-Add-PlayerSetSpawnEvent.patch b/patches/api/0293-Add-PlayerSetSpawnEvent.patch index 69443add9..a979a6b7f 100644 --- a/patches/api/0293-Add-PlayerSetSpawnEvent.patch +++ b/patches/api/0293-Add-PlayerSetSpawnEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerSetSpawnEvent diff --git a/src/main/java/com/destroystokyo/paper/event/player/PlayerSetSpawnEvent.java b/src/main/java/com/destroystokyo/paper/event/player/PlayerSetSpawnEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c15525acce +index 0000000000000000000000000000000000000000..41d42d73cf65e9b8acac9d0b2dfd6537b532be74 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/player/PlayerSetSpawnEvent.java -@@ -0,0 +1,178 @@ +@@ -0,0 +1,175 @@ +package com.destroystokyo.paper.event.player; + +import net.kyori.adventure.text.Component; @@ -19,28 +19,29 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Called when a player's spawn is set, either by themselves or otherwise. + *
    + * Cancelling this event will prevent the spawn from being set. + */ ++@NullMarked +public class PlayerSetSpawnEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + + private final Cause cause; -+ private Location location; ++ private @Nullable Location location; + private boolean forced; + private boolean notifyPlayer; -+ private Component notification; ++ private @Nullable Component notification; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerSetSpawnEvent(@NotNull Player player, @NotNull Cause cause, @Nullable Location location, boolean forced, boolean notifyPlayer, @Nullable Component notification) { ++ public PlayerSetSpawnEvent(final Player player, final Cause cause, final @Nullable Location location, final boolean forced, final boolean notifyPlayer, final @Nullable Component notification) { + super(player); + this.cause = cause; + this.location = location; @@ -54,7 +55,6 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + * + * @return the cause + */ -+ @NotNull + public Cause getCause() { + return this.cause; + } @@ -67,8 +67,7 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + * + * @return the spawn location, or {@code null} if removing the location + */ -+ @Nullable -+ public Location getLocation() { ++ public @Nullable Location getLocation() { + return this.location; + } + @@ -78,7 +77,7 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + * + * @param location the spawn location, or {@code null} to remove the spawn location + */ -+ public void setLocation(@Nullable Location location) { ++ public void setLocation(final @Nullable Location location) { + this.location = location; + } + @@ -96,7 +95,7 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + * + * @param forced {@code true} to force + */ -+ public void setForced(boolean forced) { ++ public void setForced(final boolean forced) { + this.forced = forced; + } + @@ -116,7 +115,7 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + * + * @param notifyPlayer {@code true} to notify + */ -+ public void setNotifyPlayer(boolean notifyPlayer) { ++ public void setNotifyPlayer(final boolean notifyPlayer) { + this.notifyPlayer = notifyPlayer; + } + @@ -126,8 +125,7 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + * + * @return {@code null} if no notification + */ -+ @Nullable -+ public Component getNotification() { ++ public @Nullable Component getNotification() { + return this.notification; + } + @@ -136,7 +134,7 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + * + * @param notification {@code null} to send no message + */ -+ public void setNotification(@Nullable Component notification) { ++ public void setNotification(final @Nullable Component notification) { + this.notification = notification; + } + @@ -146,16 +144,15 @@ index 0000000000000000000000000000000000000000..6a823008deaf26f751e598bc967f19c1 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + + @Override -+ public @NotNull HandlerList getHandlers() { ++ public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0313-Add-PlayerItemFrameChangeEvent.patch b/patches/api/0313-Add-PlayerItemFrameChangeEvent.patch index b5d6cf7bd..2231459fb 100644 --- a/patches/api/0313-Add-PlayerItemFrameChangeEvent.patch +++ b/patches/api/0313-Add-PlayerItemFrameChangeEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerItemFrameChangeEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerItemFrameChangeEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerItemFrameChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f563552414488079e +index 0000000000000000000000000000000000000000..f387477da45a44cc7788ed5342104f535cf3cb98 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerItemFrameChangeEvent.java -@@ -0,0 +1,104 @@ +@@ -0,0 +1,99 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.ItemFrame; @@ -19,12 +19,13 @@ index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f56355241 +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.ItemStack; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; -+import org.jetbrains.annotations.Nullable; ++import org.jspecify.annotations.NullMarked; ++import org.jspecify.annotations.Nullable; + +/** + * Called when an {@link ItemFrame} is having an item rotated, added, or removed from it. + */ ++@NullMarked +public class PlayerItemFrameChangeEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -36,8 +37,7 @@ index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f56355241 + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerItemFrameChangeEvent(@NotNull Player player, @NotNull ItemFrame itemFrame, -+ @NotNull ItemStack itemStack, @NotNull ItemFrameChangeAction action) { ++ public PlayerItemFrameChangeEvent(final Player player, final ItemFrame itemFrame, final ItemStack itemStack, final ItemFrameChangeAction action) { + super(player); + this.itemFrame = itemFrame; + this.itemStack = itemStack; @@ -49,7 +49,6 @@ index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f56355241 + * + * @return the {@link ItemFrame} + */ -+ @NotNull + public ItemFrame getItemFrame() { + return this.itemFrame; + } @@ -62,7 +61,6 @@ index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f56355241 + * + * @return the {@link ItemStack} being added, rotated, or removed + */ -+ @NotNull + public ItemStack getItemStack() { + return this.itemStack; + } @@ -73,7 +71,7 @@ index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f56355241 + * + * @param itemStack {@link ItemFrame} item + */ -+ public void setItemStack(@Nullable ItemStack itemStack) { ++ public void setItemStack(final @Nullable ItemStack itemStack) { + this.itemStack = itemStack == null ? ItemStack.empty() : itemStack; + } + @@ -82,7 +80,6 @@ index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f56355241 + * + * @return action performed on the item frame in this event + */ -+ @NotNull + public ItemFrameChangeAction getAction() { + return this.action; + } @@ -93,17 +90,15 @@ index 0000000000000000000000000000000000000000..7bd61b66db42ecc8c9a3a16f56355241 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + + @Override -+ @NotNull + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0347-Add-PlayerStopUsingItemEvent.patch b/patches/api/0347-Add-PlayerStopUsingItemEvent.patch index c8de1f6ed..c4f27c292 100644 --- a/patches/api/0347-Add-PlayerStopUsingItemEvent.patch +++ b/patches/api/0347-Add-PlayerStopUsingItemEvent.patch @@ -6,30 +6,31 @@ Subject: [PATCH] Add PlayerStopUsingItemEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerStopUsingItemEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerStopUsingItemEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..bbe5f0543a567f1484ab700b1b2ceeb4a22b411b +index 0000000000000000000000000000000000000000..d79b995292799853a0874d4e113e68b494167242 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerStopUsingItemEvent.java -@@ -0,0 +1,55 @@ +@@ -0,0 +1,53 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.Player; +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.ItemStack; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when the server detects a player stopping using an item. + * Examples of this are letting go of the interact button when holding a bow, an edible item, or a spyglass. + */ ++@NullMarked +public class PlayerStopUsingItemEvent extends PlayerEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull private final ItemStack item; ++ private final ItemStack item; + private final int ticksHeldFor; + -+ public PlayerStopUsingItemEvent(@NotNull final Player player, @NotNull final ItemStack item, final int ticksHeldFor) { ++ public PlayerStopUsingItemEvent(final Player player, final ItemStack item, final int ticksHeldFor) { + super(player); + this.item = item; + this.ticksHeldFor = ticksHeldFor; @@ -40,7 +41,6 @@ index 0000000000000000000000000000000000000000..bbe5f0543a567f1484ab700b1b2ceeb4 + * + * @return ItemStack the exact item the player released + */ -+ @NotNull + public ItemStack getItem() { + return this.item; + } @@ -54,13 +54,11 @@ index 0000000000000000000000000000000000000000..bbe5f0543a567f1484ab700b1b2ceeb4 + return this.ticksHeldFor; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0363-Add-PlayerInventorySlotChangeEvent.patch b/patches/api/0363-Add-PlayerInventorySlotChangeEvent.patch index d76df6d87..d0cadabce 100644 --- a/patches/api/0363-Add-PlayerInventorySlotChangeEvent.patch +++ b/patches/api/0363-Add-PlayerInventorySlotChangeEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerInventorySlotChangeEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerInventorySlotChangeEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerInventorySlotChangeEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..0be9708dbf84fa51a754474834406f9fa7457dbe +index 0000000000000000000000000000000000000000..f3a54ed7efabaa0f6413e1598f14e2770a46440d --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerInventorySlotChangeEvent.java -@@ -0,0 +1,101 @@ +@@ -0,0 +1,98 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.Player; @@ -17,11 +17,12 @@ index 0000000000000000000000000000000000000000..0be9708dbf84fa51a754474834406f9f +import org.bukkit.event.player.PlayerEvent; +import org.bukkit.inventory.Inventory; +import org.bukkit.inventory.ItemStack; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a slot contents change in a player's inventory. + */ ++@NullMarked +public class PlayerInventorySlotChangeEvent extends PlayerEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -32,7 +33,7 @@ index 0000000000000000000000000000000000000000..0be9708dbf84fa51a754474834406f9f + private final ItemStack newItemStack; + private boolean triggerAdvancements = true; + -+ public PlayerInventorySlotChangeEvent(@NotNull Player player, int rawSlot, @NotNull ItemStack oldItemStack, @NotNull ItemStack newItemStack) { ++ public PlayerInventorySlotChangeEvent(final Player player, final int rawSlot, final ItemStack oldItemStack, final ItemStack newItemStack) { + super(player); + this.rawSlot = rawSlot; + this.slot = player.getOpenInventory().convertSlot(rawSlot); @@ -67,7 +68,6 @@ index 0000000000000000000000000000000000000000..0be9708dbf84fa51a754474834406f9f + * + * @return The old ItemStack in the slot. + */ -+ @NotNull + public ItemStack getOldItemStack() { + return this.oldItemStack; + } @@ -77,7 +77,6 @@ index 0000000000000000000000000000000000000000..0be9708dbf84fa51a754474834406f9f + * + * @return The new ItemStack in the slot. + */ -+ @NotNull + public ItemStack getNewItemStack() { + return this.newItemStack; + } @@ -96,17 +95,15 @@ index 0000000000000000000000000000000000000000..0be9708dbf84fa51a754474834406f9f + * + * @param triggerAdvancements Whether the slot change advancements will be triggered. + */ -+ public void setShouldTriggerAdvancements(boolean triggerAdvancements) { ++ public void setShouldTriggerAdvancements(final boolean triggerAdvancements) { + this.triggerAdvancements = triggerAdvancements; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0370-Add-PrePlayerAttackEntityEvent.patch b/patches/api/0370-Add-PrePlayerAttackEntityEvent.patch index ac0ebedde..1caf6f769 100644 --- a/patches/api/0370-Add-PrePlayerAttackEntityEvent.patch +++ b/patches/api/0370-Add-PrePlayerAttackEntityEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PrePlayerAttackEntityEvent diff --git a/src/main/java/io/papermc/paper/event/player/PrePlayerAttackEntityEvent.java b/src/main/java/io/papermc/paper/event/player/PrePlayerAttackEntityEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..148f46f4572a778f090b461808b53cf9cad10e11 +index 0000000000000000000000000000000000000000..a6c5818bcdd8de5f2d0e9bf72d1e3816652e0199 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PrePlayerAttackEntityEvent.java -@@ -0,0 +1,93 @@ +@@ -0,0 +1,90 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.Entity; @@ -18,7 +18,7 @@ index 0000000000000000000000000000000000000000..148f46f4572a778f090b461808b53cf9 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when the player tries to attack an entity. @@ -31,18 +31,18 @@ index 0000000000000000000000000000000000000000..148f46f4572a778f090b461808b53cf9 + *

    + * Note: there may be other factors (invulnerability, etc.) that will prevent this entity from being attacked that this event will not cover + */ ++@NullMarked +public class PrePlayerAttackEntityEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); + -+ @NotNull + private final Entity attacked; + private final boolean willAttack; + + private boolean cancelled; + + @ApiStatus.Internal -+ public PrePlayerAttackEntityEvent(@NotNull Player player, @NotNull Entity attacked, boolean willAttack) { ++ public PrePlayerAttackEntityEvent(final Player player, final Entity attacked, final boolean willAttack) { + super(player); + this.attacked = attacked; + this.willAttack = willAttack; @@ -54,7 +54,6 @@ index 0000000000000000000000000000000000000000..148f46f4572a778f090b461808b53cf9 + * + * @return entity that was attacked + */ -+ @NotNull + public Entity getAttacked() { + return this.attacked; + } @@ -84,7 +83,7 @@ index 0000000000000000000000000000000000000000..148f46f4572a778f090b461808b53cf9 + * @param cancel {@code true} if you wish to cancel this event + */ + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + if (!this.willAttack) { + return; + } @@ -92,13 +91,11 @@ index 0000000000000000000000000000000000000000..148f46f4572a778f090b461808b53cf9 + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0373-Add-paper-dumplisteners-command.patch b/patches/api/0373-Add-paper-dumplisteners-command.patch index 43d59a5c3..8ad550e4e 100644 --- a/patches/api/0373-Add-paper-dumplisteners-command.patch +++ b/patches/api/0373-Add-paper-dumplisteners-command.patch @@ -20,68 +20,66 @@ index a3ad690691eb5537a565d7ba684354acfec5ee2d..157617933a772451f6c073d97afaf305 + } } diff --git a/src/main/java/com/destroystokyo/paper/event/executor/MethodHandleEventExecutor.java b/src/main/java/com/destroystokyo/paper/event/executor/MethodHandleEventExecutor.java -index 5b28e9b1daba7834af67dbc193dd656bedd9a994..fbebf649e893cf872be9b27091146a7c2f451aca 100644 +index 5a702481d28d90cb503faad0d9b9c3231bbff940..2a169d2f6fdada6c361ee4291abb38446d45d654 100644 --- a/src/main/java/com/destroystokyo/paper/event/executor/MethodHandleEventExecutor.java +++ b/src/main/java/com/destroystokyo/paper/event/executor/MethodHandleEventExecutor.java -@@ -14,10 +14,12 @@ import org.jetbrains.annotations.NotNull; - public class MethodHandleEventExecutor implements EventExecutor { +@@ -18,10 +18,12 @@ public class MethodHandleEventExecutor implements EventExecutor { + private final Class eventClass; private final MethodHandle handle; -+ private final Method method; ++ private final @Nullable Method method; - public MethodHandleEventExecutor(@NotNull Class eventClass, @NotNull MethodHandle handle) { + public MethodHandleEventExecutor(final Class eventClass, final MethodHandle handle) { this.eventClass = eventClass; this.handle = handle; + this.method = null; } - public MethodHandleEventExecutor(@NotNull Class eventClass, @NotNull Method m) { -@@ -28,6 +30,7 @@ public class MethodHandleEventExecutor implements EventExecutor { - } catch (IllegalAccessException e) { + public MethodHandleEventExecutor(final Class eventClass, final Method m) { +@@ -32,6 +34,7 @@ public class MethodHandleEventExecutor implements EventExecutor { + } catch (final IllegalAccessException e) { throw new AssertionError("Unable to set accessible", e); } + this.method = m; } @Override -@@ -39,4 +42,10 @@ public class MethodHandleEventExecutor implements EventExecutor { +@@ -43,4 +46,9 @@ public class MethodHandleEventExecutor implements EventExecutor { SneakyThrow.sneaky(t); } } + + @Override -+ @NotNull + public String toString() { + return "MethodHandleEventExecutor['" + this.method + "']"; + } } diff --git a/src/main/java/com/destroystokyo/paper/event/executor/StaticMethodHandleEventExecutor.java b/src/main/java/com/destroystokyo/paper/event/executor/StaticMethodHandleEventExecutor.java -index 827f2b27f70a7ec0bc11d039305c3e58c02a4ef4..52da2d040e3b335f9e47bc5dc26e17d9c06d9569 100644 +index bbdb5b472df116b71c459bdc6cc4b74267ea0f5e..e98962b6c6651c580684d8580484de87b5ad65a5 100644 --- a/src/main/java/com/destroystokyo/paper/event/executor/StaticMethodHandleEventExecutor.java +++ b/src/main/java/com/destroystokyo/paper/event/executor/StaticMethodHandleEventExecutor.java -@@ -17,6 +17,7 @@ import org.jetbrains.annotations.NotNull; - public class StaticMethodHandleEventExecutor implements EventExecutor { +@@ -19,6 +19,7 @@ public class StaticMethodHandleEventExecutor implements EventExecutor { + private final Class eventClass; private final MethodHandle handle; + private final Method method; - public StaticMethodHandleEventExecutor(@NotNull Class eventClass, @NotNull Method m) { + public StaticMethodHandleEventExecutor(final Class eventClass, final Method m) { Preconditions.checkArgument(Modifier.isStatic(m.getModifiers()), "Not a static method: %s", m); -@@ -28,6 +29,7 @@ public class StaticMethodHandleEventExecutor implements EventExecutor { - } catch (IllegalAccessException e) { +@@ -30,6 +31,7 @@ public class StaticMethodHandleEventExecutor implements EventExecutor { + } catch (final IllegalAccessException e) { throw new AssertionError("Unable to set accessible", e); } + this.method = m; } @Override -@@ -39,4 +41,10 @@ public class StaticMethodHandleEventExecutor implements EventExecutor { +@@ -41,4 +43,9 @@ public class StaticMethodHandleEventExecutor implements EventExecutor { SneakyThrow.sneaky(throwable); } } + + @Override -+ @NotNull + public String toString() { + return "StaticMethodHandleEventExecutor['" + this.method + "']"; + } diff --git a/patches/api/0377-Player-Entity-Tracking-Events.patch b/patches/api/0377-Player-Entity-Tracking-Events.patch index 3dfa72c92..ff550d451 100644 --- a/patches/api/0377-Player-Entity-Tracking-Events.patch +++ b/patches/api/0377-Player-Entity-Tracking-Events.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Player Entity Tracking Events diff --git a/src/main/java/io/papermc/paper/event/player/PlayerTrackEntityEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerTrackEntityEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..356f8933a7715b4fc123e3a4879bb2cd085835c5 +index 0000000000000000000000000000000000000000..0e37c8c94a77f6f1c2c4f5290722ca02d76ab924 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerTrackEntityEvent.java -@@ -0,0 +1,62 @@ +@@ -0,0 +1,60 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.Entity; @@ -18,7 +18,7 @@ index 0000000000000000000000000000000000000000..356f8933a7715b4fc123e3a4879bb2cd +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Is called when a {@link Player} tracks an {@link Entity}. @@ -28,6 +28,7 @@ index 0000000000000000000000000000000000000000..356f8933a7715b4fc123e3a4879bb2cd + * Adding or removing entities from the world at the point in time this event is called is completely + * unsupported and should be avoided. + */ ++@NullMarked +public class PlayerTrackEntityEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -36,7 +37,7 @@ index 0000000000000000000000000000000000000000..356f8933a7715b4fc123e3a4879bb2cd + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerTrackEntityEvent(@NotNull Player player, @NotNull Entity entity) { ++ public PlayerTrackEntityEvent(final Player player, final Entity entity) { + super(player); + this.entity = entity; + } @@ -46,7 +47,6 @@ index 0000000000000000000000000000000000000000..356f8933a7715b4fc123e3a4879bb2cd + * + * @return the entity tracked + */ -+ @NotNull + public Entity getEntity() { + return this.entity; + } @@ -57,16 +57,14 @@ index 0000000000000000000000000000000000000000..356f8933a7715b4fc123e3a4879bb2cd + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; @@ -74,10 +72,10 @@ index 0000000000000000000000000000000000000000..356f8933a7715b4fc123e3a4879bb2cd +} diff --git a/src/main/java/io/papermc/paper/event/player/PlayerUntrackEntityEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerUntrackEntityEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c573eeaeb599ca717b09f9fd3f106a4800e9c386 +index 0000000000000000000000000000000000000000..30e01ffc8b0d4a8e43a046d85f1903cc20e0e84d --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerUntrackEntityEvent.java -@@ -0,0 +1,48 @@ +@@ -0,0 +1,46 @@ +package io.papermc.paper.event.player; + +import org.bukkit.entity.Entity; @@ -85,7 +83,7 @@ index 0000000000000000000000000000000000000000..c573eeaeb599ca717b09f9fd3f106a48 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Is called when a {@link Player} untracks an {@link Entity}. @@ -93,6 +91,7 @@ index 0000000000000000000000000000000000000000..c573eeaeb599ca717b09f9fd3f106a48 + * Adding or removing entities from the world at the point in time this event is called is completely + * unsupported and should be avoided. + */ ++@NullMarked +public class PlayerUntrackEntityEvent extends PlayerEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -100,7 +99,7 @@ index 0000000000000000000000000000000000000000..c573eeaeb599ca717b09f9fd3f106a48 + private final Entity entity; + + @ApiStatus.Internal -+ public PlayerUntrackEntityEvent(@NotNull Player player, @NotNull Entity entity) { ++ public PlayerUntrackEntityEvent(final Player player, final Entity entity) { + super(player); + this.entity = entity; + } @@ -110,17 +109,14 @@ index 0000000000000000000000000000000000000000..c573eeaeb599ca717b09f9fd3f106a48 + * + * @return the entity untracked + */ -+ @NotNull + public Entity getEntity() { + return this.entity; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; diff --git a/patches/api/0396-Add-event-for-player-editing-sign.patch b/patches/api/0396-Add-event-for-player-editing-sign.patch index ec38bf008..c0b95f9d5 100644 --- a/patches/api/0396-Add-event-for-player-editing-sign.patch +++ b/patches/api/0396-Add-event-for-player-editing-sign.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add event for player editing sign diff --git a/src/main/java/io/papermc/paper/event/player/PlayerOpenSignEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerOpenSignEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c38c32ae349e094ffef84386607f4b9d5fe361f5 +index 0000000000000000000000000000000000000000..0b905aafe5b228993944af1850c93c797f6eaf47 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerOpenSignEvent.java -@@ -0,0 +1,108 @@ +@@ -0,0 +1,105 @@ +package io.papermc.paper.event.player; + +import org.bukkit.block.Sign; @@ -20,13 +20,14 @@ index 0000000000000000000000000000000000000000..c38c32ae349e094ffef84386607f4b9d +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when a player begins editing a sign's text. + *

    + * Cancelling this event stops the sign editing menu from opening. + */ ++@NullMarked +public class PlayerOpenSignEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -38,7 +39,7 @@ index 0000000000000000000000000000000000000000..c38c32ae349e094ffef84386607f4b9d + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerOpenSignEvent(final @NotNull Player editor, final @NotNull Sign sign, final @NotNull Side side, final @NotNull Cause cause) { ++ public PlayerOpenSignEvent(final Player editor, final Sign sign, final Side side, final Cause cause) { + super(editor); + this.sign = sign; + this.side = side; @@ -50,7 +51,6 @@ index 0000000000000000000000000000000000000000..c38c32ae349e094ffef84386607f4b9d + * + * @return {@link Sign} that was clicked + */ -+ @NotNull + public Sign getSign() { + return this.sign; + } @@ -61,7 +61,6 @@ index 0000000000000000000000000000000000000000..c38c32ae349e094ffef84386607f4b9d + * @return {@link Side} that was clicked + * @see Sign#getSide(Side) + */ -+ @NotNull + public Side getSide() { + return this.side; + } @@ -71,7 +70,7 @@ index 0000000000000000000000000000000000000000..c38c32ae349e094ffef84386607f4b9d + * + * @return the cause + */ -+ public @NotNull Cause getCause() { ++ public Cause getCause() { + return this.cause; + } + @@ -81,17 +80,15 @@ index 0000000000000000000000000000000000000000..c38c32ae349e094ffef84386607f4b9d + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0401-Add-PlayerFailMoveEvent.patch b/patches/api/0401-Add-PlayerFailMoveEvent.patch index c0687e2ae..e6903a2b5 100644 --- a/patches/api/0401-Add-PlayerFailMoveEvent.patch +++ b/patches/api/0401-Add-PlayerFailMoveEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerFailMoveEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerFailMoveEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerFailMoveEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc2596b90aed +index 0000000000000000000000000000000000000000..c7380874f99cd2aa28a24bbb0dd3375e8842dd0d --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerFailMoveEvent.java -@@ -0,0 +1,118 @@ +@@ -0,0 +1,113 @@ +package io.papermc.paper.event.player; + +import org.bukkit.Location; @@ -17,11 +17,12 @@ index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc25 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Runs when a player attempts to move, but is prevented from doing so by the server + */ ++@NullMarked +public class PlayerFailMoveEvent extends PlayerEvent { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -33,8 +34,7 @@ index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc25 + private boolean logWarning; + + @ApiStatus.Internal -+ public PlayerFailMoveEvent(@NotNull Player player, @NotNull FailReason failReason, boolean allowed, -+ boolean logWarning, @NotNull Location from, @NotNull Location to) { ++ public PlayerFailMoveEvent(final Player player, final FailReason failReason, final boolean allowed, final boolean logWarning, final Location from, final Location to) { + super(player); + this.failReason = failReason; + this.allowed = allowed; @@ -48,7 +48,6 @@ index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc25 + * + * @return The reason the movement was prevented + */ -+ @NotNull + public FailReason getFailReason() { + return this.failReason; + } @@ -58,7 +57,6 @@ index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc25 + * + * @return Location the player moved from + */ -+ @NotNull + public Location getFrom() { + return this.from.clone(); + } @@ -68,7 +66,6 @@ index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc25 + * + * @return Location the player tried to move to + */ -+ @NotNull + public Location getTo() { + return this.to.clone(); + } @@ -87,7 +84,7 @@ index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc25 + * + * @param allowed whether to bypass the check + */ -+ public void setAllowed(boolean allowed) { ++ public void setAllowed(final boolean allowed) { + this.allowed = allowed; + } + @@ -105,17 +102,15 @@ index 0000000000000000000000000000000000000000..c848fa029bac07f80eef870c98eebc25 + * + * @param logWarning whether to log warnings + */ -+ public void setLogWarning(boolean logWarning) { ++ public void setLogWarning(final boolean logWarning) { + this.logWarning = logWarning; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0412-Add-PlayerPickItemEvent.patch b/patches/api/0412-Add-PlayerPickItemEvent.patch index 6dd0be80a..053244756 100644 --- a/patches/api/0412-Add-PlayerPickItemEvent.patch +++ b/patches/api/0412-Add-PlayerPickItemEvent.patch @@ -6,10 +6,10 @@ Subject: [PATCH] Add PlayerPickItemEvent diff --git a/src/main/java/io/papermc/paper/event/player/PlayerPickItemEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerPickItemEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad1533b7b0ca6 +index 0000000000000000000000000000000000000000..d7e10652918e453838a3a983f089ef4727d0bfe2 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerPickItemEvent.java -@@ -0,0 +1,96 @@ +@@ -0,0 +1,93 @@ +package io.papermc.paper.event.player; + +import com.google.common.base.Preconditions; @@ -18,8 +18,8 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; +import org.jetbrains.annotations.Range; ++import org.jspecify.annotations.NullMarked; + +/** + * Event that is fired when a player uses the pick item functionality (middle-clicking a block to get the appropriate @@ -29,6 +29,7 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 + *

    + * Note: This event will not be fired for players in creative mode. + */ ++@NullMarked +public class PlayerPickItemEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -39,7 +40,7 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerPickItemEvent(@NotNull Player player, int targetSlot, int sourceSlot) { ++ public PlayerPickItemEvent(final Player player, final int targetSlot, final int sourceSlot) { + super(player); + this.targetSlot = targetSlot; + this.sourceSlot = sourceSlot; @@ -50,8 +51,7 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 + * + * @return hotbar slot (0-8 inclusive) + */ -+ @Range(from = 0, to = 8) -+ public int getTargetSlot() { ++ public @Range(from = 0, to = 8) int getTargetSlot() { + return this.targetSlot; + } + @@ -60,7 +60,7 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 + * + * @param targetSlot hotbar slot (0-8 inclusive) + */ -+ public void setTargetSlot(@Range(from = 0, to = 8) int targetSlot) { ++ public void setTargetSlot(final @Range(from = 0, to = 8) int targetSlot) { + Preconditions.checkArgument(targetSlot >= 0 && targetSlot <= 8, "Target slot must be in range 0 - 8 (inclusive)"); + this.targetSlot = targetSlot; + } @@ -70,8 +70,7 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 + * + * @return player inventory slot (0-35 inclusive) + */ -+ @Range(from = 0, to = 35) -+ public int getSourceSlot() { ++ public @Range(from = 0, to = 35) int getSourceSlot() { + return this.sourceSlot; + } + @@ -80,7 +79,7 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 + * + * @param sourceSlot player inventory slot (0-35 inclusive) + */ -+ public void setSourceSlot(@Range(from = 0, to = 35) int sourceSlot) { ++ public void setSourceSlot(final @Range(from = 0, to = 35) int sourceSlot) { + Preconditions.checkArgument(sourceSlot >= 0 && sourceSlot <= 35, "Source slot must be in range of the player's inventory slot"); + this.sourceSlot = sourceSlot; + } @@ -91,17 +90,15 @@ index 0000000000000000000000000000000000000000..c5987ebea49e4b99c9ff7fa967aad153 + } + + @Override -+ public void setCancelled(boolean cancel) { ++ public void setCancelled(final boolean cancel) { + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0435-Add-PlayerShieldDisableEvent.patch b/patches/api/0435-Add-PlayerShieldDisableEvent.patch index 29c7daa0e..ddc6deadf 100644 --- a/patches/api/0435-Add-PlayerShieldDisableEvent.patch +++ b/patches/api/0435-Add-PlayerShieldDisableEvent.patch @@ -17,10 +17,10 @@ the cooldown event. diff --git a/src/main/java/io/papermc/paper/event/player/PlayerShieldDisableEvent.java b/src/main/java/io/papermc/paper/event/player/PlayerShieldDisableEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..25c13b01c5630a6de30058532458d779763e4e42 +index 0000000000000000000000000000000000000000..aa2fb7923b121cda547291d14cff60895361a4dd --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/PlayerShieldDisableEvent.java -@@ -0,0 +1,92 @@ +@@ -0,0 +1,90 @@ +package io.papermc.paper.event.player; + +import com.google.common.base.Preconditions; @@ -30,7 +30,7 @@ index 0000000000000000000000000000000000000000..25c13b01c5630a6de30058532458d779 +import org.bukkit.event.HandlerList; +import org.bukkit.event.player.PlayerEvent; +import org.jetbrains.annotations.ApiStatus; -+import org.jetbrains.annotations.NotNull; ++import org.jspecify.annotations.NullMarked; + +/** + * Called whenever a players shield is disabled due to an attack from another entity that was capable of disabling the @@ -41,6 +41,7 @@ index 0000000000000000000000000000000000000000..25c13b01c5630a6de30058532458d779 + * It follows that, if this event is cancelled, no {@link PlayerItemCooldownEvent} is called as the shield is never + * disabled in the first place. + */ ++@NullMarked +public class PlayerShieldDisableEvent extends PlayerEvent implements Cancellable { + + private static final HandlerList HANDLER_LIST = new HandlerList(); @@ -51,7 +52,7 @@ index 0000000000000000000000000000000000000000..25c13b01c5630a6de30058532458d779 + private boolean cancelled; + + @ApiStatus.Internal -+ public PlayerShieldDisableEvent(@NotNull final Player player, @NotNull final Entity damager, final int cooldown) { ++ public PlayerShieldDisableEvent(final Player player, final Entity damager, final int cooldown) { + super(player); + this.damager = damager; + this.cooldown = cooldown; @@ -62,7 +63,6 @@ index 0000000000000000000000000000000000000000..25c13b01c5630a6de30058532458d779 + * + * @return the entity instance that damaged the player in a way that caused the shield to be disabled. + */ -+ @NotNull + public Entity getDamager() { + return this.damager; + } @@ -87,7 +87,7 @@ index 0000000000000000000000000000000000000000..25c13b01c5630a6de30058532458d779 + * + * @param cooldown cooldown in ticks, has to be a positive number + */ -+ public void setCooldown(int cooldown) { ++ public void setCooldown(final int cooldown) { + Preconditions.checkArgument(cooldown >= 0, "The cooldown has to be equal to or greater than 0!"); + this.cooldown = cooldown; + } @@ -102,13 +102,11 @@ index 0000000000000000000000000000000000000000..25c13b01c5630a6de30058532458d779 + this.cancelled = cancel; + } + -+ @NotNull + @Override + public HandlerList getHandlers() { + return HANDLER_LIST; + } + -+ @NotNull + public static HandlerList getHandlerList() { + return HANDLER_LIST; + } diff --git a/patches/api/0455-Add-CartographyItemEvent.patch b/patches/api/0455-Add-CartographyItemEvent.patch index 1f19663c9..8bfd237e0 100644 --- a/patches/api/0455-Add-CartographyItemEvent.patch +++ b/patches/api/0455-Add-CartographyItemEvent.patch @@ -7,36 +7,37 @@ Similar to SmithItemEvent, but for cartography tables. diff --git a/src/main/java/io/papermc/paper/event/player/CartographyItemEvent.java b/src/main/java/io/papermc/paper/event/player/CartographyItemEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..659b620696e5cc0784ed707c70876e4348897c7f +index 0000000000000000000000000000000000000000..d5c67f5462b9011683ce742a197959f9c4380d40 --- /dev/null +++ b/src/main/java/io/papermc/paper/event/player/CartographyItemEvent.java -@@ -0,0 +1,31 @@ +@@ -0,0 +1,32 @@ +package io.papermc.paper.event.player; + -+import org.bukkit.inventory.InventoryView; -+import org.bukkit.inventory.CartographyInventory; +import org.bukkit.event.inventory.ClickType; -+import org.bukkit.event.inventory.InventoryType; +import org.bukkit.event.inventory.InventoryAction; +import org.bukkit.event.inventory.InventoryClickEvent; -+import org.jetbrains.annotations.NotNull; ++import org.bukkit.event.inventory.InventoryType; ++import org.bukkit.inventory.CartographyInventory; ++import org.bukkit.inventory.InventoryView; +import org.jetbrains.annotations.ApiStatus; ++import org.jspecify.annotations.NullMarked; + +/** + * Called when the recipe of an Item is completed inside a cartography table. + */ ++@NullMarked +public class CartographyItemEvent extends InventoryClickEvent { ++ + @ApiStatus.Internal -+ public CartographyItemEvent(@NotNull InventoryView view, @NotNull InventoryType.SlotType type, int slot, @NotNull ClickType click, @NotNull InventoryAction action) { ++ public CartographyItemEvent(final InventoryView view, final InventoryType.SlotType type, final int slot, final ClickType click, final InventoryAction action) { + super(view, type, slot, click, action); + } + + @ApiStatus.Internal -+ public CartographyItemEvent(@NotNull InventoryView view, @NotNull InventoryType.SlotType type, int slot, @NotNull ClickType click, @NotNull InventoryAction action, int key) { ++ public CartographyItemEvent(final InventoryView view, final InventoryType.SlotType type, final int slot, final ClickType click, final InventoryAction action, final int key) { + super(view, type, slot, click, action, key); + } + -+ @NotNull + @Override + public CartographyInventory getInventory() { + return (CartographyInventory) super.getInventory(); diff --git a/patches/api/0466-Brigadier-based-command-API.patch b/patches/api/0466-Brigadier-based-command-API.patch index 55f6b9997..34193bec6 100644 --- a/patches/api/0466-Brigadier-based-command-API.patch +++ b/patches/api/0466-Brigadier-based-command-API.patch @@ -6,7 +6,7 @@ Subject: [PATCH] Brigadier based command API Co-authored-by: Jake Potrebic diff --git a/build.gradle.kts b/build.gradle.kts -index 37ff4cb89dfb28eab6f836840ff1838d67895c1e..2074c9aee1affbce57571398f8519f0d425cf5e3 100644 +index 76aa23da778b0fe8a093429c56cb29b044359b40..ab84a1405acc1f0d5f267892243b82b8dab03e21 100644 --- a/build.gradle.kts +++ b/build.gradle.kts @@ -27,6 +27,7 @@ configurations.api { @@ -102,10 +102,10 @@ index 0000000000000000000000000000000000000000..28b44789e3be586c4b680fff56e5d2ff +} diff --git a/src/main/java/com/destroystokyo/paper/event/brigadier/AsyncPlayerSendCommandsEvent.java b/src/main/java/com/destroystokyo/paper/event/brigadier/AsyncPlayerSendCommandsEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..18e0618901eb6eec7677661b8448cb95926ee3ab +index 0000000000000000000000000000000000000000..9e1b70d438c4341ec944503b5bbe6b1f08bc0478 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/brigadier/AsyncPlayerSendCommandsEvent.java -@@ -0,0 +1,72 @@ +@@ -0,0 +1,73 @@ +package com.destroystokyo.paper.event.brigadier; + +import com.mojang.brigadier.tree.RootCommandNode; @@ -141,7 +141,7 @@ index 0000000000000000000000000000000000000000..18e0618901eb6eec7677661b8448cb95 +@NullMarked +public class AsyncPlayerSendCommandsEvent extends PlayerEvent { + -+ private static final HandlerList handlers = new HandlerList(); ++ private static final HandlerList HANDLER_LIST = new HandlerList(); + private final RootCommandNode node; + private final boolean hasFiredAsync; + @@ -170,20 +170,21 @@ index 0000000000000000000000000000000000000000..18e0618901eb6eec7677661b8448cb95 + return this.hasFiredAsync; + } + ++ @Override + public HandlerList getHandlers() { -+ return handlers; ++ return HANDLER_LIST; + } + + public static HandlerList getHandlerList() { -+ return handlers; ++ return HANDLER_LIST; + } +} diff --git a/src/main/java/com/destroystokyo/paper/event/brigadier/AsyncPlayerSendSuggestionsEvent.java b/src/main/java/com/destroystokyo/paper/event/brigadier/AsyncPlayerSendSuggestionsEvent.java new file mode 100644 -index 0000000000000000000000000000000000000000..f2ed3af699c2df92227693830c135d0b4718d41f +index 0000000000000000000000000000000000000000..faade9d35514687f21a0e8b62fa2e392d4ad238a --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/event/brigadier/AsyncPlayerSendSuggestionsEvent.java -@@ -0,0 +1,84 @@ +@@ -0,0 +1,85 @@ +package com.destroystokyo.paper.event.brigadier; + +import com.mojang.brigadier.suggestion.Suggestions; @@ -203,7 +204,7 @@ index 0000000000000000000000000000000000000000..f2ed3af699c2df92227693830c135d0b +@NullMarked +public class AsyncPlayerSendSuggestionsEvent extends PlayerEvent implements Cancellable { + -+ private static final HandlerList handlers = new HandlerList(); ++ private static final HandlerList HANDLER_LIST = new HandlerList(); + private boolean cancelled = false; + + private Suggestions suggestions; @@ -260,12 +261,13 @@ index 0000000000000000000000000000000000000000..f2ed3af699c2df92227693830c135d0b + this.cancelled = cancel; + } + ++ @Override + public HandlerList getHandlers() { -+ return handlers; ++ return HANDLER_LIST; + } + + public static HandlerList getHandlerList() { -+ return handlers; ++ return HANDLER_LIST; + } +} diff --git a/src/main/java/com/destroystokyo/paper/event/brigadier/CommandRegisteredEvent.java b/src/main/java/com/destroystokyo/paper/event/brigadier/CommandRegisteredEvent.java diff --git a/patches/server/0353-Implement-Mob-Goal-API.patch b/patches/server/0353-Implement-Mob-Goal-API.patch index 938235210..a3f61fbfb 100644 --- a/patches/server/0353-Implement-Mob-Goal-API.patch +++ b/patches/server/0353-Implement-Mob-Goal-API.patch @@ -460,10 +460,10 @@ index 0000000000000000000000000000000000000000..26c745dd9ccdfdd5c5039f2acc5201b9 +} diff --git a/src/main/java/com/destroystokyo/paper/entity/ai/PaperMobGoals.java b/src/main/java/com/destroystokyo/paper/entity/ai/PaperMobGoals.java new file mode 100644 -index 0000000000000000000000000000000000000000..24c30e8a462c59829ab2bd9ee52a1b248550d8ab +index 0000000000000000000000000000000000000000..e8a427ea777af040d0e2b9cc0ba2a80b9176d026 --- /dev/null +++ b/src/main/java/com/destroystokyo/paper/entity/ai/PaperMobGoals.java -@@ -0,0 +1,224 @@ +@@ -0,0 +1,226 @@ +package com.destroystokyo.paper.entity.ai; + +import java.util.Collection; @@ -476,7 +476,9 @@ index 0000000000000000000000000000000000000000..24c30e8a462c59829ab2bd9ee52a1b24 +import net.minecraft.world.entity.ai.goal.WrappedGoal; +import org.bukkit.craftbukkit.entity.CraftMob; +import org.bukkit.entity.Mob; ++import org.jspecify.annotations.NullMarked; + ++@NullMarked +public class PaperMobGoals implements MobGoals { + + @Override